| Revision as of 22:39, 18 March 2010 editحسن علي البط (talk | contribs)Extended confirmed users, Pending changes reviewers19,940 editsm Quick-adding category Phenol ethers (using HotCat)← Previous edit |
Latest revision as of 10:10, 9 January 2025 edit undoПсевдотсуга (talk | contribs)18 edits error: Rhamnus petiolaris has no to do with Sri Lanka |
| (29 intermediate revisions by 22 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| Name = Rhamnazin |
|
|
|
| Watchedfields = changed |
|
| ImageFile = Rhamnazin.svg |
|
|
|
| verifiedrevid = 350682249 |
| ⚫ |
| ImageSize = 250px |
|
|
| ImageName = Rhamnazin structure |
|
| Name = Rhamnazin |
|
⚫ |
| ImageFile = Rhamnazin.svg |
| ⚫ |
| IUPACName = 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxychromen-4-one |
|
|
⚫ |
| ImageSize = 250px |
| ⚫ |
| OtherNames= 3',7-Dimethylquercetin<br>3,5,4'-Trihydroxy-7,3'-dimethoxyflavone<br>5,3',4'-trihydroxy-3,7-dimethoxyflavone<!-- <br>Flavone, 3,4',5-trihydroxy-3',7-dimethoxy- |
|
|
|
| ImageName = Rhamnazin structure |
|
3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4H-chromen-4-one --> |
|
|
|
| ImageFile2 = Rhamnazin 3D BS.png |
|
|
|
|
|
| ImageSize2 = 250px |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
|
| ImageName2 = Rhamnazin structure |
| ⚫ |
| CASNo = 552-54-5 |
|
|
|
| IUPACName = 3,4′,5-Trihydroxy-3′,7-dimethoxyflavone |
| ⚫ |
| PubChem = 5320945 |
|
|
⚫ |
| SystematicName = 3,5-Dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-methoxy-4''H''-1-benzopyran-4-one |
| ⚫ |
| SMILES =COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)OC)O |
|
|
⚫ |
| OtherNames = 3′,7-Dimethylquercetin<br>3,5,4′-Trihydroxy-7,3′-dimethoxyflavone<br>5,3′,4′-Trihydroxy-3,7-dimethoxyflavone<br>Flavone, 3,4′,5-trihydroxy-3′,7-dimethoxy- |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 552-54-5 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 276CK9GP9Y |
|
⚫ |
| PubChem = 5320945 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 133721 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 457148 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4478873 |
|
|
| InChI = 1/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 |
|
|
| InChIKey = MYMGKIQXYXSRIJ-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C17H14O7/c1-22-9-6-11(19)14-13(7-9)24-17(16(21)15(14)20)8-3-4-10(18)12(5-8)23-2/h3-7,18-19,21H,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MYMGKIQXYXSRIJ-UHFFFAOYSA-N |
|
⚫ |
| SMILES = COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)OC)O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>17</sub>H<sub>14</sub>O<sub>7</sub> |
|
| C = 17 | H = 14 | O = 7 |
|
| MolarMass = 330.29 g/mol |
|
| MolarMass = |
|
|
| Density = |
|
| ExactMass = 330.073953 |
|
|
| Density = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = <!-- °C --> |
|
| ⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Rhamnazin''' is an ], a type of chemical compound. It can be found in '']''<ref>, a ] plant endemic to Sri Lanka. |
|
'''Rhamnazin''' is an ], a type of chemical compound. It can be found in '']'',<ref>{{cite journal|title = Rhamnazin- und rhamnetin-3-''O''-trioside aus ''Rhamnus petiolaris''|first1 = H.|last1 = Wagner|first2 = M.|last2 = Ertan|first3 = O.|last3 = Seligmann|journal = ]|volume = 13|issue = 5|year = 1974|pages = 857–860|doi = 10.1016/S0031-9422(00)91151-8| bibcode=1974PChem..13..857W |language = German}}</ref> a ] plant native to ], ], ], and ].<ref name=KewPOWO>{{cite web|url= https://powo.science.kew.org/taxon/urn:lsid:ipni.org:names:718561-1|title= Rhamnus petiolaris Boiss. & Balansa|author=<!--Not stated-->|date=n.d.|website=Plants of the World Online|publisher=The Trustees of the Royal Botanic Gardens, Kew|access-date= January 9, 2025}}</ref> |
|
|
|
|
|
==Metabolism== |
|
== Metabolism == |
|
The enzyme ] uses S-adenosyl methionine and ] to produce S-adenosylhomocysteine and rhamnazin. |
|
The enzyme ] uses ] and ] to produce ] and rhamnazin. |
|
|
|
|
|
The enzyme ] uses S-adenosyl methionine and rhamnazin to produce S-adenosylhomocysteine and ]. |
|
The enzyme ] uses ''S''-adenosyl methionine and rhamnazin to produce ''S''-adenosyl homocysteine and ]. |
|
|
|
|
|
==External links== |
|
== References == |
| ⚫ |
* |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
{{Reflist}} |
|
|
== External links == |
|
⚫ |
* |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
] |
|
|
|
|
| ⚫ |
{{Polyphenol-stub}} |
|
|
|
|
|
|
⚫ |
{{Aromatic-stub}} |
|
] |
|