| Revision as of 13:24, 17 April 2011 editSsschhh (talk | contribs)Extended confirmed users1,375 editsNo edit summary← Previous edit |
Latest revision as of 23:20, 15 November 2023 edit undoSix Oh Five (talk | contribs)Extended confirmed users1,288 edits →Toxicity: styleTags: Mobile edit Mobile app edit Android app edit |
| (37 intermediate revisions by 21 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference = |
|
|
⚫ |
| verifiedrevid = 424521737 |
| ⚫ |
|ImageFile1= |
|
|
⚫ |
| Reference = |
| ⚫ |
|ImageSize1= |
|
|
⚫ |
| ImageFile1= Rhoeadine.svg |
|
|ImageFile2= |
|
|
⚫ |
| ImageSize1= 200px |
| ⚫ |
|ImageSize2= |
|
|
|
| ImageFile2= Rhoeadine-3D-balls.png |
|
|IUPACName = |
|
|
⚫ |
| ImageSize2= |
|
|OtherNames= |
|
|
|
| IUPACName = 8β-Methoxy-16-methyl-2′''H'',2′′''H''-bis(dioxolo)rhedan |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| SystematicName = (5b''R'',13b''R'',15''S'')-15-Methoxy-6-methyl-5b,6,7,8,13b,15-hexahydro-2''H'',11''H''-dioxolodioxolobenzopyranobenzazepine |
|
| ChemSpiderID_Ref = |
|
|
|
| OtherNames = Rheadine; Rhoeadin |
|
| ChemSpiderID = |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
| KEGG_Ref = |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| KEGG = |
|
|
| InChIKey = |
|
| ChemSpiderID = 171184 |
|
|
| InChI = 1/C21H21NO6/c1-22-6-5-11-7-15-16(26-9-25-15)8-13(11)19-18(22)12-3-4-14-20(27-10-24-14)17(12)21(23-2)28-19/h3-4,7-8,18-19,21H,5-6,9-10H2,1-2H3/t18-,19-,21+/m1/s1 |
|
| ChEMBL_Ref = |
|
|
|
| InChIKey = XRBIHOLQAKITPP-SBHAEUEKBA |
| ⚫ |
| ChEMBL = |
|
|
| StdInChI_Ref = |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
| StdInChI = 1S/C21H21NO6/c1-22-6-5-11-7-15-16(26-9-25-15)8-13(11)19-18(22)12-3-4-14-20(27-10-24-14)17(12)21(23-2)28-19/h3-4,7-8,18-19,21H,5-6,9-10H2,1-2H3/t18-,19-,21+/m1/s1 |
|
| StdInChI = |
|
|
| StdInChIKey_Ref = |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = |
|
| StdInChIKey = XRBIHOLQAKITPP-SBHAEUEKSA-N |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| CASNo_Ref = |
|
|
⚫ |
| KEGG = C09619 |
| ⚫ |
| CASNo= |
|
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| EINECS= |
|
|
⚫ |
| ChEMBL = |
| ⚫ |
| SMILES = CN1CCC2=CC3=C(C=C2C4C1C5=C(C(O4)OC)C6=C(C=C5)OCO6)OCO3 |
|
|
| PubChem = 197775 |
|
| ChEBI = 8836 |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| InChI = |
|
|
⚫ |
| CASNo=2718-25-4 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9Q9C65WH3B |
|
⚫ |
| EINECS= |
|
⚫ |
| SMILES = CN1CCC2=CC3=C(C=C241C5=C((O4)OC)C6=C(C=C5)OCO6)OCO3 |
|
|
| PubChem = 197775 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=21 | H=21 | N=1 | O=6 |
|
| C=21 | H=21 | N=1 | O=6 |
|
| Density = 1.45 g/cm³ |
|
| Density = 1.45 g/cm<sup>3</sup> |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
| ⚫ |
}} |
|
| ⚫ |
|Section3= {{Chembox Hazards |
|
| ⚫ |
| MainHazards= |
|
| ⚫ |
| FlashPt= |
|
|
| Autoignition= |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
}} |
|
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
|
| HPhrases = |
|
|
| PPhrases = |
|
|
| GHS_ref = |
|
}} |
|
}} |
|
⚫ |
}} |
|
'''Rhoeadine''' is an alkaloid derived from the flowers of the ] (Papaver rhoeas). It is used as mild ] and mild ]. |
|
|
|
|
|
|
'''Rhoeadine''' ('''rheadine''') is an ] derived from the flowers of the ] (''Papaver rhoeas'').<ref name="Montgomery1983">{{Cite journal| doi = 10.1021/np50028a001| issn = 0163-3864| volume = 46| issue = 4| pages = 441–453| last1 = Montgomery| first1 = Craig T.| last2 = Cassels| first2 = Bruce K.| last3 = Shamma| first3 = Maurice| title = The Rhoeadine Alkaloids| journal = Journal of Natural Products| accessdate = 2021-04-07| date = 1983-07-01| url = https://doi.org/10.1021/np50028a001}}</ref> It has been studied for its potential use in the treatment of morphine dependence.<ref>{{cite journal | doi = 10.22037/ijpr.2010.757 | year = 2008 | issue = 2 | volume = 7 | last1 = Shams | first1 = J. | title = Effects of Papaver rhoeas Extract on the Tolerance Development to Analgesic Effects of Morphine in Mice | journal = Iranian Journal of Pharmaceutical Research | last2 = Sahraei | first2 = H. | last3 = Faghih-Monzavi | first3 = Z. | last4 = Salimi | first4 = SH | last5 = Fatemi | first5 = SM | last6 = Pourmatabbed | first6 = A. | last7 = Ghoshooni | first7 = H. | last8 = Kamalinejad | first8 = M. }}</ref> |
|
|
|
|
|
== Toxicity == |
|
|
5 different patients were admitted to ER after being intoxicated with ]. Symptoms of intoxication include nausea, vomiting, confusion, seizures, myosis and arrhythmia. These symptoms may be an outlier due to the exceptionally high dose ingested.<ref name="Günaydın">{{Cite journal| doi = 10.1155/2015/321360| issn = 1687-9627| volume = 2015| pages = –321360| last1 = Günaydın| first1 = Yahya Kemal| last2 = Dündar| first2 = Zerrin Defne| last3 = Çekmen| first3 = Bora| last4 = Akıllı| first4 = Nazire Belgin| last5 = Köylü| first5 = Ramazan| last6 = Cander| first6 = Başar| title = Intoxication due to Papaver rhoeas (Corn Poppy): Five Case Reports| journal = Case Reports in Medicine| date = 2015-05-13| pmid = 26074968| pmc = 4444563| doi-access = free}}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |