| Revision as of 12:56, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444088044 of page Ricinelaidic_acid for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 15:41, 18 August 2022 edit Fswitzer4 (talk | contribs)Extended confirmed users10,578 editsm Added UNII |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444086188 |
|
| verifiedrevid = 464382297 |
|
|ImageFile=Ricinelaidic acid.png |
|
| ImageFile=Ricinelaidic acid.svg |
|
|ImageSize=250px |
|
| ImageSize=250px |
|
|IUPACName=(9''E'',12''R'')-12-Hydroxyoctadec-9-enoic acid |
|
|
|OtherNames=(+)-(''R'')-Ricinelaidic acid |
|
| PIN=(9''E'',12''R'')-12-Hydroxyoctadec-9-enoic acid |
|
|
| OtherNames=(+)-(''R'')-Ricinelaidic acid |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 393218 |
|
| ChemSpiderID = 393218 |
|
| InChI = 1/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9+/t17-/m1/s1 |
|
| InChI = 1/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9+/t17-/m1/s1 |
| Line 15: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = WBHHMMIMDMUBKC-XLNAKTSKSA-N |
|
| StdInChIKey = WBHHMMIMDMUBKC-XLNAKTSKSA-N |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = <!-- blanked - oldvalue: 540-12-5 --> |
|
|
|
| CASNo = 540-12-5 |
| ⚫ |
| PubChem=445641 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 9O64E391KI |
|
⚫ |
| PubChem=445641 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 45478 |
|
| ChEBI = 45478 |
|
| SMILES = O=C(O)CCCCCCC/C=C/C(O)CCCCCC |
|
| SMILES = O=C(O)CCCCCCC/C=C/C(O)CCCCCC |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>18</sub>H<sub>34</sub>O<sub>3</sub> |
|
| Formula=C<sub>18</sub>H<sub>34</sub>O<sub>3</sub> |
|
| MolarMass=298.46 |
|
| MolarMass=298.46{{nbsp}}g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ricinelaidic acid''' or '''(+)-(''R'')-ricinelaidic acid''' is an ] ] ]. It is the ] of the ] ]. |
|
|
|
|
|
== External links == |
|
|
* in '']'' |
|
|
*{{cite journal|url=http://cat.inist.fr/?aModele=afficheN&cpsidt=18483403|author1=Wright, Amanda J. |author2=Marangoni, Alejandro G. |title= Time, temperature, and concentration dependence of ricinelaidic acid-canola oil organogelation|journal=Journal of the American Oil Chemists' Society |year=2007| volume=84| issue=1| pages=3–9|doi= 10.1007/s11746-006-1012-6|s2cid=96323666 }} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{alkene-stub}} |