| Revision as of 07:49, 16 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validati← Previous edit |
Latest revision as of 15:10, 27 March 2024 edit undoMarbletan (talk | contribs)Extended confirmed users5,418 edits ref |
| (22 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 445115379 |
|
⚫ |
| ImageFile=Risocaine.svg |
|
⚫ |
| ImageSize=200px |
|
|
| PIN = Propyl 4-aminobenzoate |
|
⚫ |
| OtherNames = 4-Aminobenzoic acid propyl ester |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo=94-12-2 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = 5CQ88I59ZI |
|
| UNII = 5CQ88I59ZI |
|
⚫ |
| PubChem=7174 |
| ⚫ |
| verifiedrevid = 437149421 |
|
|
⚫ |
| SMILES=O=C(OCCC)c1ccc(N)cc1 |
| ⚫ |
|ImageFile=Risocaine.png |
|
|
|
| EINECS = 202-306-1 |
| ⚫ |
|ImageSize=200px |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
|IUPACName=4-aminobenzoic acid propyl ester |
|
|
|
| ChemSpiderID = 6906 |
|
|OtherNames= |
|
|
|
| InChI = 1/C10H13NO2/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6H,2,7,11H2,1H3 |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
|
| InChIKey = NBFQYHKHPBMJJV-UHFFFAOYAX |
| ⚫ |
| CASNo=94-12-2 |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| PubChem=7174 |
|
|
|
| StdInChI = 1S/C10H13NO2/c1-2-7-13-10(12)8-3-5-9(11)6-4-8/h3-6H,2,7,11H2,1H3 |
| ⚫ |
| SMILES=O=C(OCCC)c1ccc(N)cc1 |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NBFQYHKHPBMJJV-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = C067183 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>10</sub>H<sub>13</sub>NO<sub>2</sub> |
|
| Formula=C<sub>10</sub>H<sub>13</sub>NO<sub>2</sub> |
|
| MolarMass=179.21572 |
|
| MolarMass=179.21572 |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
'''Risocaine''' (or '''propyl 4-aminobenzoate''') is a ]. |
|
|
|
'''Risocaine''' (or '''propyl 4-aminobenzoate''') is a ].<ref>{{Cite web | url = https://drugs.ncats.io/substance/5CQ88I59ZI | title = Risocaine | work = Inxight Drugs | publisher = National Center for Advancing Translational Sciences }}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
{{Local anesthetics}} |
|
{{Local anesthetics}} |
|
|
|
|
|
|
|
|
|
{{chemistry-stub}} |
|
{{ester-stub}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |