Revision as of 22:09, 3 January 2011 editRjwilmsi (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers932,073 editsm Journal cites:, added 1 DOIs, using AWB (7524)← Previous edit |
Latest revision as of 01:26, 26 November 2024 edit undo76.174.0.57 (talk) Link chem group. |
(29 intermediate revisions by 26 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox | |
|
|
|
{{Drugbox |
|
|
| verifiedrevid = 405764492 |
|
| IUPAC_name = (S)-6-Chloro-5-fluoro-1H-indole-2-propanamine |
|
| IUPAC_name = (S)-6-Chloro-5-fluoro-1H-indole-2-propanamine |
|
| image = Ro60-0175_structure.png |
|
| image = Ro60-0175.svg |
|
| width = 240 |
|
| width = 240 |
|
|
|
⚫ |
| CAS_number = 169675-09-6 |
|
|
|
<!--Clinical data--> |
⚫ |
| ATC_prefix = |
|
|
| ATC_suffix = |
|
| tradename = |
⚫ |
| PubChem = 5312145 |
|
⚫ |
| C=11 | H=12 | Cl=1 | F=1 | N=2 |
|
|
| molecular_weight = 226.677 g/mol |
|
|
| smiles = Clc1cc2n(CC(C)N)ccc2cc1F |
|
⚫ |
| melting_point = |
|
⚫ |
| melting_high = |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
| pregnancy_AU = |
|
| pregnancy_AU = |
|
| pregnancy_US = |
|
| pregnancy_US = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = |
|
| legal_AU = |
|
| legal_CA = |
|
| legal_CA = |
|
| legal_UK = |
|
| legal_UK = |
|
| legal_US = |
|
| legal_US = |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
}} |
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 274 |
|
⚫ |
| ATC_prefix = |
|
|
| ATC_suffix = |
|
⚫ |
| PubChem = 3045227 |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 169675-09-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = YQP8J4N96A |
|
|
| ChemSpiderID = 2308002 |
|
|
| ChEBI = 142183 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=11 | H=12 | Cl=1 | F=1 | N=2 |
|
|
| smiles = C(Cn1ccc2c1cc(c(c2)F)Cl)N |
|
|
| StdInChI = 1S/C11H12ClFN2/c1-7(14)6-15-3-2-8-4-10(13)9(12)5-11(8)15/h2-5,7H,6,14H2,1H3/t7-/m0/s1 |
|
|
| StdInChIKey = XJJZQXUGLLXTHO-ZETCQYMHSA-N |
|
⚫ |
| melting_point = |
|
⚫ |
| melting_high = |
|
|
|drug_name=|alt=|caption=|type=|MedlinePlus=|licence_EU=|licence_US=|DrugBank=}} |
|
|
|
|
|
'''Ro60-0175''' is a drug developed by ], which has applications in scientific research.<ref>Quarta D, Naylor CG, Stolerman IP. The serotonin 2C receptor agonist Ro-60-0175 attenuates effects of nicotine in the five-choice serial reaction time task and in drug discrimination. ''Psychopharmacology (Berlin)''. 2007 Aug;193(3):391-402. PMID 17473916</ref><ref>Fletcher PJ, Rizos Z, Sinyard J, Tampakeras M, Higgins GA. The 5-HT2C receptor agonist Ro60-0175 reduces cocaine self-administration and reinstatement induced by the stressor yohimbine, and contextual cues. ''Neuropsychopharmacology''. 2008 May;33(6):1402-12. PMID 17653111</ref> It acts as a potent and selective ] for both the ] and ] ] ] subtypes, with good selectivity over the closely related ] subtype, and little or no affinity at other receptors.<ref>Porter RH, Benwell KR, Lamb H, Malcolm CS, Allen NH, Revell DF, Adams DR, Sheardown MJ. Functional characterization of agonists at recombinant human 5-HT2A, 5-HT2B and 5-HT2C receptors in CHO-K1 cells. ''British Journal of Pharmacology''. 1999 Sep;128(1):13-20. {{DOI|10.1038/sj.bjp.0702751}} PMID 10498829</ref><ref>Damjanoska KJ, Muma NA, Zhang Y, D'Souza DN, Garcia F, Carrasco GA, Kindel GH, Haskins KA, Shankaran M, Petersen BR, Van De Kar LD. Neuroendocrine evidence that (S)-2-(6-chloro-5-fluoro-indol-1-yl)-1-methylethylamine fumarate (Ro 60-0175) is not a selective 5-hydroxytryptamine(2C) receptor agonist. ''Journal of Pharmacology and Experimental Therapeutics''. 2003 Mar;304(3):1209-16. PMID 12604698</ref> |
|
'''Ro60-0175''' is a drug of the ] group developed by ], which has applications in scientific research.<ref>{{cite journal | vauthors = Quarta D, Naylor CG, Stolerman IP | title = The serotonin 2C receptor agonist Ro-60-0175 attenuates effects of nicotine in the five-choice serial reaction time task and in drug discrimination | journal = Psychopharmacology | volume = 193 | issue = 3 | pages = 391–402 | date = August 2007 | pmid = 17473916 | doi = 10.1007/s00213-007-0802-3 | s2cid = 21020653 }}</ref><ref>{{cite journal | vauthors = Fletcher PJ, Rizos Z, Sinyard J, Tampakeras M, Higgins GA | title = The 5-HT2C receptor agonist Ro60-0175 reduces cocaine self-administration and reinstatement induced by the stressor yohimbine, and contextual cues | journal = Neuropsychopharmacology | volume = 33 | issue = 6 | pages = 1402–12 | date = May 2008 | pmid = 17653111 | doi = 10.1038/sj.npp.1301509 | doi-access = free }}</ref> It acts as a potent and selective ] for both the ] and ] ] ] subtypes, with good selectivity over the closely related ] subtype, and little or no affinity at other receptors.<ref>{{cite journal | vauthors = Porter RH, Benwell KR, Lamb H, Malcolm CS, Allen NH, Revell DF, Adams DR, Sheardown MJ | display-authors = 6 | title = Functional characterization of agonists at recombinant human 5-HT2A, 5-HT2B and 5-HT2C receptors in CHO-K1 cells | journal = British Journal of Pharmacology | volume = 128 | issue = 1 | pages = 13–20 | date = September 1999 | pmid = 10498829 | pmc = 1571597 | doi = 10.1038/sj.bjp.0702751 }}</ref><ref>{{cite journal | vauthors = Damjanoska KJ, Muma NA, Zhang Y, D'Souza DN, Garcia F, Carrasco GA, Kindel GH, Haskins KA, Shankaran M, Petersen BR, Van De Kar LD | display-authors = 6 | title = Neuroendocrine evidence that (S)-2-(chloro-5-fluoro-indol- l-yl)-1-methylethylamine fumarate (Ro 60-0175) is not a selective 5-hydroxytryptamine(2C) receptor agonist | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 304 | issue = 3 | pages = 1209–16 | date = March 2003 | pmid = 12604698 | doi = 10.1124/jpet.102.043489 | s2cid = 23880629 }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
* ] |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
{{Serotonergics}} |
|
{{Serotonergics}} |
|
|
{{Tryptamines}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
{{pharm-stub}} |
|
{{nervous-system-drug-stub}} |