| Revision as of 19:19, 5 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEMBL_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chembox validation|Chem/Drug← Previous edit |
Latest revision as of 08:39, 9 September 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
| (19 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 448215878 |
| ⚫ |
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
⚫ |
| IUPAC_name = 1,2-Bisguanidine |
| ⚫ |
| UNII = 4888ME6C4E |
|
|
⚫ |
| image = Robenidine.png |
| ⚫ |
| verifiedrevid = 376278242 |
|
|
|
|
| ⚫ |
| IUPAC_name = 1,2-Bisguanidine |
|
|
|
<!--Clinical data--> |
| ⚫ |
| image = Robenidine.png |
|
|
|
| tradename = |
| ⚫ |
| CAS_number = 25875-51-8 |
|
|
|
| Drugs.com = {{drugs.com|international|robenidine}} |
| ⚫ |
| ATCvet = yes |
|
|
| ATC_prefix = P51 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| ATC_suffix = AX13 |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| PubChem = 9570438 |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 25875-51-8 |
|
⚫ |
| ATCvet = yes |
|
|
| ATC_prefix = P51 |
|
⚫ |
| ATC_suffix = BX03 |
|
⚫ |
| PubChem = 9570438 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| chemical_formula = |
|
|
⚫ |
| UNII = 4888ME6C4E |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 7844905 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| chemical_formula = |
|
| C=15 | H=13 | Cl=2 | N=5 |
|
| C=15 | H=13 | Cl=2 | N=5 |
|
| molecular_weight = 334.20 g/mol |
|
|
| smiles = C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl |
|
| smiles = C1=CC(=CC=C1C=NNC(=NN=CC2=CC=C(C=C2)Cl)N)Cl |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| bioavailability = |
|
|
|
| StdInChI = 1S/C15H13Cl2N5/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12/h1-10H,(H3,18,21,22)/b19-9+,20-10+ |
| ⚫ |
| protein_bound = |
|
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| metabolism = |
|
|
|
| StdInChIKey = MOOFYEJFXBSZGE-LQGKIZFRSA-N |
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Robenidine''' is a ]. Robenidine is an ] used for the control of ], a debilitating protozoal infection in ].<ref>{{cite book | vauthors = Mehlhorn H |title=Encyclopedia of Parasitology |date=2008 |publisher=Springer Science & Business Media |location=Berlin |isbn=978-3-540-48994-8 |page=274 |edition=3rd |url=https://books.google.com/books?id=Jpg1ysgVn-AC&dq=Robenidine&pg=PA274}}</ref> Although there are alternative antibiotics available, robenidine is important in the management of ] as farmers rotate the use of robenidine with other antibiotics to try to preserve the effectiveness of these products in fighting infections.<ref>{{cite web | title = Robenidine review | work = Australian Pesticides and Veterinary Medicines Authority (APVMA)| url = http://www.apvma.gov.au/products/review/completed/robenidine.php | archive-url = https://web.archive.org/web/20140211231613/http://www.apvma.gov.au/products/review/completed/robenidine.php | archive-date = 11 February 2014 }}</ref> |
|
'''Robenidine''' is a ]. |
|
|
|
|
|
|
|
==References== |
|
|
|
|
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|