Revision as of 15:01, 18 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Flavonol rhamnosides← Previous edit |
Latest revision as of 06:47, 30 July 2023 edit undoJosve05a (talk | contribs)Autopatrolled, Extended confirmed users, New page reviewers, Pending changes reviewers, Rollbackers155,585 edits Reference edited with ProveIt #proveit | Alter: doi. Add: s2cid, pages, issue, volume, journal, year, title, authors 1-1. | Use this tool. Report bugs. | #UCB_GadgetTag: ProveIt edit |
(21 intermediate revisions by 15 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 412207802 |
|
| verifiedrevid = 440129500 |
|
| Name = Robinin |
|
| Name = Robinin |
|
| ImageFile = Robinin.svg |
|
| ImageFile = Robinin.svg |
|
| ImageSize = 350px |
|
| ImageSize = 350px |
|
| ImageName = Robinin structure |
|
| ImageName = Robinin structure |
|
|
| IUPACName = 4′,5-Dihydroxy-3--7-(α-<small>L</small>-rhamnopyranosyloxy)flavone |
|
| IUPACName = |
|
|
|
| SystematicName = (1<sup>2</sup>''S'',1<sup>3</sup>''R'',1<sup>4</sup>''R'',1<sup>5</sup>''R'',1<sup>6</sup>''S'',5<sup>2</sup>''S'',5<sup>3</sup>''R'',5<sup>4</sup>''S'',5<sup>5</sup>''R'',5<sup>6</sup>''R'',8<sup>2</sup>''R'',8<sup>3</sup>''R'',8<sup>4</sup>''R'',8<sup>5</sup>''R'',8<sup>6</sup>''S'')-1<sup>3</sup>,1<sup>4</sup>,1<sup>5</sup>,3<sup>5</sup>,5<sup>3</sup>,5<sup>4</sup>,5<sup>5</sup>,8<sup>3</sup>,8<sup>4</sup>,8<sup>5</sup>-Decahydroxy-3<sup>2</sup>-(4-hydroxyphenyl)-1<sup>6</sup>,8<sup>6</sup>-dimethyl-3<sup>4</sup>''H''-2,4,7-trioxa-3(7,3)-benzopyrana-1,8(2),5(2,6)-tris(oxana)octaphan-3<sup>4</sup>-one |
|
| OtherNames= ]-3-O-]-]-7-O-rham<br>Kaempferol-3-O-]-7-O-rhamnoside<br>Kaempferol robinoside |
|
| OtherNames= ]-3-O-]-]-7-O-rham<br>Kaempferol-3-O-]-7-O-rhamnoside<br>Kaempferol robinoside |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
⚫ |
| CASNo = 301-19-9 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
⚫ |
| PubChem = 5281693 |
|
|
⚫ |
| CASNo = 301-19-9 |
|
| SMILES = CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OC5C(C(C(C(O5)C) |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
O)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O |
|
|
|
| UNII = 75RT1VGM60 |
|
⚫ |
| PubChem = 5281693 |
|
|
| KEGG = C10178 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445010 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 8878 |
|
|
| SMILES = C1((((O1)OC2((((O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)O5((((O5)C)O)O)O)C6=CC=C(C=C6)O)O)O)O)O)O)O |
|
|
| InChI = 1/C33H40O19/c1-10-19(36)23(40)26(43)31(47-10)46-9-17-21(38)25(42)28(45)33(51-17)52-30-22(39)18-15(35)7-14(49-32-27(44)24(41)20(37)11(2)48-32)8-16(18)50-29(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-28,31-38,40-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21-,23+,24+,25-,26+,27+,28+,31+,32-,33-/m0/s1 |
|
|
| InChIKey = PEFASEPMJYRQBW-HKWQTAEVBB |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C33H40O19/c1-10-19(36)23(40)26(43)31(47-10)46-9-17-21(38)25(42)28(45)33(51-17)52-30-22(39)18-15(35)7-14(49-32-27(44)24(41)20(37)11(2)48-32)8-16(18)50-29(30)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-28,31-38,40-45H,9H2,1-2H3/t10-,11-,17+,19-,20-,21-,23+,24+,25-,26+,27+,28+,31+,32-,33-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PEFASEPMJYRQBW-HKWQTAEVSA-N |
|
|
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>33</sub>H<sub>40</sub>O<sub>19</sub> |
|
| Formula = C<sub>33</sub>H<sub>40</sub>O<sub>19</sub> |
|
| MolarMass = 740.66 g/mol |
|
| MolarMass = 740.66 g/mol |
|
|
| Density = |
|
| ExactMass = 740.216379 u |
|
|
| Density = |
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
| MeltingPt = <!-- °C --> |
|
⚫ |
| BoilingPt = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Robinin''' is a chemical compound. It can be isolated from '']''<ref></ref> or from the common locust '']''<ref></ref>. |
|
'''Robinin''' is a chemical compound. It can be isolated from '']''<ref>{{cite journal|doi=10.1007/BF00599275 |title=Robinin and kaempfereol fromVinca erecta |year=1986 |last1=Akhmedzhanova |first1=V. |journal=Chemistry of Natural Compounds |volume=22 |issue=5 |pages=601–602 |s2cid=4827681 }}</ref> or from the common locust '']''.<ref>{{Cite journal |doi=10.1016/s0021-9258(18)76392-8 |doi-access=free |title=The Plant Coloring Matter, Robinin |year=1932 |last1=Sando |first1=Charles E. |journal=Journal of Biological Chemistry |volume=94 |issue=3 |pages=675–680 }}</ref> It is a ] ] based on ]. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{flavonol}} |
|
{{flavonol}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |