| Revision as of 13:04, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444091224 of page Rodiasine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 00:06, 25 March 2021 edit KoIobok (talk | contribs)Extended confirmed users1,350 edits Changed category |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444089340 |
|
| verifiedrevid = 464383152 |
|
|ImageFile=Rodiasine structure.png |
|
| ImageFile=Rodiasine structure.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName= |
|
| IUPACName= |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 390797 |
|
| ChemSpiderID = 390797 |
|
| InChI = 1/C38H42N2O6/c1-39-13-11-24-19-33(43-4)34-21-26(24)29(39)17-22-7-9-31(41)27(15-22)28-16-23(8-10-32(28)42-3)18-30-36-25(12-14-40(30)2)20-35(44-5)37(45-6)38(36)46-34/h7-10,15-16,19-21,29-30,41H,11-14,17-18H2,1-6H3/t29-,30+/m1/s1 |
|
| InChI = 1/C38H42N2O6/c1-39-13-11-24-19-33(43-4)34-21-26(24)29(39)17-22-7-9-31(41)27(15-22)28-16-23(8-10-32(28)42-3)18-30-36-25(12-14-40(30)2)20-35(44-5)37(45-6)38(36)46-34/h7-10,15-16,19-21,29-30,41H,11-14,17-18H2,1-6H3/t29-,30+/m1/s1 |
| Line 15: |
Line 15: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = HIQZXOFBXJICTD-IHLOFXLRSA-N |
|
| StdInChIKey = HIQZXOFBXJICTD-IHLOFXLRSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 6391-64-6 --> |
|
|
|
| CASNo=6391-64-6 |
| ⚫ |
| ChEMBL = 1170881 |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 1170881 |
|
| PubChem=442345 |
|
| PubChem=442345 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8886 |
|
| ChEBI = 8886 |
|
| SMILES = O(c1ccc5cc1c2c(O)ccc(c2)C7N(CCc6cc(OC)c(Oc3c4c(cc(OC)c3OC)CCN(C)4C5)cc67)C)C |
|
| SMILES = O(c1ccc5cc1c2c(O)ccc(c2)C7N(CCc6cc(OC)c(Oc3c4c(cc(OC)c3OC)CCN(C)4C5)cc67)C)C |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>38</sub>H<sub>42</sub>N<sub>2</sub>O<sub>6</sub> |
|
| Formula=C<sub>38</sub>H<sub>42</sub>N<sub>2</sub>O<sub>6</sub> |
|
| MolarMass=622.75 g/mol |
|
| MolarMass=622.75 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Rodiasine''' is a cyclic ] ] that was first isolated from the South American greenheart tree '']''.<ref name=Grundon1966>{{cite journal |
|
|
| author = Grundon, M.F. |
|
|
|author2=McGarvey, J.E.B. |
|
|
| year = 1966 |
|
|
| title = Alkaloids from greenheart. Part III. The structure of rodiasine. Mass spectra of bisbenzylisoquinoline alkaloids |
|
|
| journal = Journal of the Chemical Society C: Organic |
|
|
| volume = 1966 |
|
|
| pages = 1082–1084 |
|
|
| doi = 10.1039/J39660001082 |
|
|
}}</ref> The synthesis of ''O''-demethylrodiasine (antioquine) and its derivatives, and the possible application of these compounds as anti-cancer, ], and ] has been described.<ref name=Bentley2004>{{cite journal |
|
|
| author = Bentley, K. W. |
|
|
| year = 1996 |
|
|
| title = β-Phenylethylamines and the isoquinoline alkaloids |
|
|
| journal = Natural Product Reports |
|
|
| volume = 13 |
|
|
| issue = 2 |
|
|
| pages = 127–150 |
|
|
| doi = 10.1039/NP9961300127 |
|
|
| url = http://www.rsc.org/ejarchive/NP/1996/NP9961300127.pdf |
|
|
}}</ref><ref>{{cite journal |vauthors=D'Ocon MP, Candenas ML, Anselmi E, Zafra-Polo MC, Cortes D |title=Antioquine: a new bisbenzylisoquinoleine alkaloid with calcium antagonist activity |journal=Arch Int Pharmacodyn Ther |volume=297 |pages=205–16 |year=1989 |pmid=2730236}}</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
|
|
|
|
|
|
{{alkaloid-stub}} |