Revision as of 13:08, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457104161 of page Ronifibrate for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 08:39, 9 September 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits removed Category:Chloroarenes; added Category:4-Chlorophenyl compounds using HotCat |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 464383547 |
|
| Watchedfields = changed |
|
|
⚫ |
| IUPAC_name = 3-<nowiki/>{oxy}propyl nicotinate |
⚫ |
| verifiedrevid = 417962889 |
|
⚫ |
| IUPAC_name = 3-{oxy}propyl nicotinate |
|
|
| image = Ronifibrate.svg |
|
| image = Ronifibrate.svg |
|
|
|
|
Line 27: |
Line 26: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 42597-57-9 --> |
|
| CAS_number = 42597-57-9 |
|
| ATC_prefix = C10 |
|
| ATC_prefix = C10 |
|
| ATC_suffix = AB07 |
|
| ATC_suffix = AB07 |
Line 36: |
Line 35: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 61925 |
|
| ChemSpiderID = 61925 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = W86I18X716 |
|
| UNII = W86I18X716 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
Line 43: |
Line 42: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=19 | H=20 | Cl=1 | N=1 | O=5 |
|
| C=19 | H=20 | Cl=1 | N=1 | O=5 |
|
| molecular_weight = 377.819 g/mol |
|
|
| smiles = O=C(OCCCOC(=O)C(Oc1ccc(Cl)cc1)(C)C)c2cccnc2 |
|
| smiles = O=C(OCCCOC(=O)C(Oc1ccc(Cl)cc1)(C)C)c2cccnc2 |
|
| InChI = 1/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3 |
|
|
| InChIKey = AYJVGKWCGIYEAK-UHFFFAOYAD |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3 |
|
| StdInChI = 1S/C19H20ClNO5/c1-19(2,26-16-8-6-15(20)7-9-16)18(23)25-12-4-11-24-17(22)14-5-3-10-21-13-14/h3,5-10,13H,4,11-12H2,1-2H3 |
Line 53: |
Line 49: |
|
| synonyms = <small>3-propyl 2-(4-chlorophenoxy)-2-methylpropanoate</small> |
|
| synonyms = <small>3-propyl 2-(4-chlorophenoxy)-2-methylpropanoate</small> |
|
}} |
|
}} |
|
|
|
|
|
'''Ronifibrate''' is a ], a ]. It is a combined ] of ] and ] (nicotinic acid) with ]. In the body, the ester is ] to 1,3-propanediol and both acids which work in the same way, lowering ] in blood. |
|
|
|
|
|
==References== |
|
|
{{Reflist|2}} |
|
|
|
|
|
|
|
|
{{Lipid modifying agents}} |
|
|
{{PPAR modulators}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{cardiovascular-drug-stub}} |