| Revision as of 13:20, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458959417 of page Ryanodine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'KEGG'). |
Latest revision as of 23:10, 12 November 2024 edit Mrfoogles (talk | contribs)Extended confirmed users8,042 edits correct name ryanoid -> diamide insecticideTag: Visual edit |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 458958336 |
|
| verifiedrevid = 464384841 |
|
| ImageFile = Ryanodine_structure.png |
|
| ImageFile = Ryanodine.svg |
|
| Width = 240px |
|
|
| IUPACName = |
|
| ImageSize = 240px |
|
|
| PIN = (1''S'',2''R'',2a''S'',2a<sup>1</sup>''R'',3''S'',3a''S'',6''S'',7''R'',7a''R'',9''S'',9a''S'')-1,2a,2a<sup>1</sup>,3a,7,9-Hexahydroxy-3,6,9a-trimethyl-1-(propan-2-yl)dodecahydro-3,9-methanobenzopentalenofuran-2-yl 1''H''-pyrrole-2-carboxylate |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4303 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 16736002 |
|
| ChemSpiderID = 16736002 |
|
| InChI = 1/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19+,20-,21-,22+,23+,24+,25+/m0/s1 |
|
| InChI = 1/C25H35NO9/c1-12(2)22(31)17(34-16(28)14-7-6-10-26-14)23(32)18(4)11-21(30)19(22,5)25(23,33)24(35-21)15(27)13(3)8-9-20(18,24)29/h6-7,10,12-13,15,17,26-27,29-33H,8-9,11H2,1-5H3/t13-,15+,17+,18-,19+,20-,21-,22+,23+,24+,25+/m0/s1 |
| Line 18: |
Line 19: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 15662-33-6 |
|
| CASNo = 15662-33-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| PubChem = 5114 |
|
|
|
| UNII = 37H6ATE4SA |
|
⚫ |
| PubChem = 5114 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = <!-- blanked - oldvalue: 612231 --> |
|
| ChEMBL = 612231 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 8925 |
|
| ChEBI = 8925 |
|
| SMILES = C1CC2(3(C4(5(((3(5(2(1O)O4)O)O)OC(=O)c6ccc6)(C(C)C)O)C)O)C)O |
|
| SMILES = C1CC2(3(C4(5(((3(5(2(1O)O4)O)O)OC(=O)c6ccc6)(C(C)C)O)C)O)C)O |
|
| MeSHName = Ryanodine |
|
| MeSHName = Ryanodine |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C08705 --> |
|
| KEGG = C08705 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=25 | H=35 | N=1 | O=9 |
|
| Formula = C<sub>25</sub>H<sub>35</sub>NO<sub>9</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 493.547 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Ryanodine''' is a poisonous ] found in the South American plant '']'' (]). It was originally used as an ]. |
|
|
|
|
|
The compound has extremely high affinity to the open-form ], a group of ]s found in ] muscle, smooth muscle, and ] cells.<ref name="Marks2015">{{cite journal|last1=Santulli|first1=Gaetano|last2=Marks|first2=Andrew|title=Essential Roles of Intracellular Calcium Release Channels in Muscle, Brain, Metabolism, and Aging|journal=Current Molecular Pharmacology|volume=8|issue=2|year=2015|pages=206–222|issn=1874-4672|doi=10.2174/1874467208666150507105105|pmid=25966694}}</ref> It binds with such high affinity to the receptor that it was used as a label for the first purification of that class of ]s and gave its name to it. |
|
|
|
|
|
At ] concentrations, ryanodine locks the receptor in a half-open state, whereas it fully closes them at ] concentration. The effect of the nanomolar-level binding is that ryanodine causes release of ] from calcium stores as the ] in the cytoplasm, leading to massive ]s. The effect of micromolar-level binding is ]. This is true for both mammals and insects.<ref>{{cite journal | last1 = Van Petegem | first1 = F | year = 2012 | title = Ryanodine receptors: structure and function | journal = The Journal of Biological Chemistry | volume = 287 | issue = 38| pages = 31624–32 | doi = 10.1074/jbc.r112.349068 | pmid = 22822064 | pmc = 3442496 | doi-access = free }}</ref> |
|
|
|
|
|
== See also == |
|
|
* ], a class of insecticides with the same mechanism of action as ryanodine |
|
|
* ] |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
==Further reading== |
|
|
* {{cite journal | doi = 10.2174/1874467208666150507105105 | title = Essential Roles of Intracellular Calcium Release Channels in Muscle, Brain, Metabolism, and Aging | date = 2015 | last1 = Santulli | first1 = Gaetano | last2 = Marks | first2 = Andrew | journal = Current Molecular Pharmacology | volume = 8 | issue = 2 | pages = 206–222 | pmid = 25966694 }} |
|
|
* ], ''Ionic Channels of Excitable Membranes'', 2nd edition, Sinauer Associates, Sunderland, MA, 01375, {{ISBN|0-87893-323-9}} |
|
|
|
|
|
{{Insecticides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |