| Revision as of 17:56, 25 February 2011 editChemNerd (talk | contribs)Extended confirmed users17,568 edits removed Category:Oxazolopyrazines using HotCat← Previous edit |
Latest revision as of 07:33, 6 November 2024 edit undoGraeme Bartlett (talk | contribs)Administrators249,758 edits variable cols |
| (20 intermediate revisions by 15 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
| ⚫ |
| IUPAC_name = ''N''--3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-oxazolopyrazine-7-carboxamide |
|
|
|
| verifiedrevid = 415898693 |
| ⚫ |
| image = SHA-68_structure.png |
|
|
⚫ |
| IUPAC_name = ''N''--3-oxo-1,1-diphenyl-5,6,8,8a-tetrahydro-oxazolopyrazine-7-carboxamide |
| ⚫ |
| CAS_number = |
|
|
⚫ |
| image = SHA-68_structure.png |
| ⚫ |
| ATC_prefix = none |
|
|
|
|
| ⚫ |
| ATC_suffix = |
|
|
|
<!--Clinical data--> |
| ⚫ |
| PubChem = 11374217 |
|
|
|
| tradename = |
| ⚫ |
| C = 26 | H = 24 | F = 1 | N = 3 | O = 3 |
|
|
⚫ |
| pregnancy_category = |
|
| molecular_weight = 445.484 g/mol |
|
|
⚫ |
| legal_status = |
| ⚫ |
| smiles = c4ccccc4C1(c5ccccc5)OC(=O)N3C1CN(CC3)C(=O)NCc(cc2)ccc2F |
|
|
⚫ |
| routes_of_administration = |
| ⚫ |
| bioavailability = |
|
|
|
|
| ⚫ |
| metabolism = |
|
|
|
<!--Pharmacokinetic data--> |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| bioavailability = |
| ⚫ |
| excretion = |
|
|
⚫ |
| metabolism = |
| ⚫ |
| pregnancy_category = |
|
|
⚫ |
| elimination_half-life = |
| ⚫ |
| legal_status = |
|
|
⚫ |
| excretion = |
| ⚫ |
| routes_of_administration = |
|
|
|
|
|
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 5813 |
|
⚫ |
| CAS_number = 847553-89-3 |
|
|
| CAS_number_Ref = {{Cascite|changed|EPA}} |
|
⚫ |
| ATC_prefix = none |
|
⚫ |
| ATC_suffix = |
|
⚫ |
| PubChem = 11374217 |
|
|
| ChemSpiderID = 9549134 |
|
|
| ChEMBL = 469695 |
|
|
| UNII = 8Q99A974BL |
|
|
<!--Chemical data--> |
|
⚫ |
| C=26 | H=24 | F=1 | N=3 | O=3 |
|
⚫ |
| smiles = c4ccccc4C1(c5ccccc5)OC(=O)N3C1CN(CC3)C(=O)NCc(cc2)ccc2F |
|
|
| StdInChI = 1S/C26H24FN3O3/c27-22-13-11-19(12-14-22)17-28-24(31)29-15-16-30-23(18-29)26(33-25(30)32,20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,23H,15-18H2,(H,28,31) |
|
|
| StdInChIKey = SFRQIPRTNYHJHP-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''SHA-68''' is a ] which acts as a ], non-] ] at the ] ] ]. In animal studies it has ] effects, and blocks the ] action of neuropeptide S.<ref>Fukatsu K, Nakayama Y, Tarui N, Mori M, Matsumoto H, Kurasawa O, Banno H. Bicyclic Piperazine Compound and Use Thereof. PCT Patent WO 2005/021555 A1. Published 26.08.2004</ref><ref name="pmid18337476">{{cite journal |author=Okamura N, Habay SA, Zeng J, Chamberlin AR, Reinscheid RK |title=Synthesis and pharmacological in vitro and in vivo profile of 3-oxo-1,1-diphenyl-tetrahydro-oxazolopyrazine-7-carboxylic acid 4-fluoro-benzylamide (SHA 68), a selective antagonist of the neuropeptide S receptor |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=325 |issue=3 |pages=893–901 |year=2008 |month=June |pmid=18337476 |pmc=2583099 |doi=10.1124/jpet.107.135103 |url=}}</ref> |
|
'''SHA-68''' is a ] which acts as a ], non-] ] at the ] ] ]. In animal studies it reduced motor stereotypes, and blocks the ] action of neuropeptide S.<ref>Fukatsu K, Nakayama Y, Tarui N, Mori M, Matsumoto H, Kurasawa O, Banno H. Bicyclic Piperazine Compound and Use Thereof. PCT Patent WO 2005/021555 A1. Published 26.08.2004</ref><ref name="pmid18337476">{{cite journal |vauthors=Okamura N, Habay SA, Zeng J, Chamberlin AR, Reinscheid RK |title=Synthesis and pharmacological in vitro and in vivo profile of 3-oxo-1,1-diphenyl-tetrahydro-oxazolopyrazine-7-carboxylic acid 4-fluoro-benzylamide (SHA 68), a selective antagonist of the neuropeptide S receptor |journal=The Journal of Pharmacology and Experimental Therapeutics |volume=325 |issue=3 |pages=893–901 |date=June 2008 |pmid=18337476 |pmc=2583099 |doi=10.1124/jpet.107.135103 }}</ref> |
|
|
|
|
|
== See also == |
|
== See also == |
| Line 24: |
Line 40: |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
{{Neuropeptidergics}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{pharmacology-stub}} |
|
{{nervous-system-drug-stub}} |