Revision as of 03:08, 16 September 2011 editEmausBot (talk | contribs)Bots, Template editors2,860,578 editsm r2.6.4) (Robot: Modifying pl:Salen← Previous edit |
Latest revision as of 13:03, 21 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,127 edits added Category:2-Hydroxyphenyl compounds using HotCat |
(99 intermediate revisions by 44 users not shown) |
Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 418011133 |
|
|
|
| Watchedfields = changed |
⚫ |
|ImageFile=Salen.jpg |
|
|
⚫ |
| verifiedrevid = 450746497 |
|
|ImageFile1=Salen structure.svg |
|
|
⚫ |
| ImageFile=Salen structure.svg |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|ImageFile2=Salen-3D-balls.png |
|
|
⚫ |
| IUPACName= |
|
|ImageSize1=200px |
|
|
⚫ |
| OtherNames= 2,2′-Ethylenebis(nitrilomethylidene)diphenol, ''N'',''N''′-Ethylenebis(salicylimine) |
⚫ |
|IUPACName= |
|
|
⚫ |
|Section1={{Chembox Identifiers |
⚫ |
|OtherNames= 2,2'-Ethylenebis(nitrilomethylidene)diphenol, N,N'-Ethylenebis(salicylimine) |
|
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
⚫ |
|Section1= {{Chembox Identifiers |
|
|
| CASNo=94-93-9 |
|
| CASNo=129409-01-4 |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
|
| CASNo1 = 94-93-9 |
⚫ |
| PubChem= |
|
|
|
| CASNo1_Comment =(non-specific) |
|
| SMILES= |
|
|
|
| EC_number = 202-376-3 |
⚫ |
}} |
|
|
⚫ |
| PubChem=26518 |
⚫ |
|Section2= {{Chembox Properties |
|
|
|
| SMILES= C1=CC=C(C(=C1)/C=N/CC/N=C/C2=CC=CC=C2O)O |
⚫ |
| Formula=C<sub>16</sub>H<sub>16</sub>N<sub>2</sub>O<sub>2</sub> |
|
|
|
| InChI = 1S/C16H16N2O2/c19-15-7-3-1-5-13(15)11-17-9-10-18-12-14-6-2-4-8-16(14)20/h1-8,11-12,19-20H,9-10H2/b17-11+,18-12+ |
⚫ |
| MolarMass=268.31 |
|
|
|
| InChIKey = VEUMANXWQDHAJV-JYFOCSDGSA-N |
⚫ |
| Appearance=yellow solid |
|
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
⚫ |
| Density= |
|
|
|
| ChEMBL = 594100 |
⚫ |
| MeltingPtC=125-129 |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
⚫ |
| BoilingPt= |
|
|
|
| UNII = M122L9EGR6 |
⚫ |
| Solubility=organic solvents |
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
⚫ |
}} |
|
|
|
| ChemSpiderID = 10484366 |
⚫ |
|Section3= {{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| Autoignition= |
|
⚫ |
}} |
|
|
}} |
|
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
'''Salen''' is the abbreviation for a popular ] ] used in ] and ]. The name salen is a contraction for ] and ]. The ligand is a bright yellow micaceous solid that is soluble in polar organic solvents. |
|
|
⚫ |
| Formula=C<sub>16</sub>H<sub>16</sub>N<sub>2</sub>O<sub>2</sub> |
|
⚫ |
| MolarMass=268.32 |
|
⚫ |
| Appearance= |
|
⚫ |
| Density= |
|
⚫ |
| MeltingPtC= 126 |
|
⚫ |
| BoilingPt= |
|
⚫ |
| Solubility= |
|
⚫ |
}} |
|
⚫ |
|Section3={{Chembox Hazards |
|
⚫ |
| MainHazards= |
|
⚫ |
| FlashPt= |
|
|
| AutoignitionPt = |
|
|
| GHSPictograms = {{GHS07}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335}} |
|
|
| PPhrases = {{P-phrases|261|264|271|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|403+233|405|501}} |
|
⚫ |
}} |
|
⚫ |
}} |
|
|
{{about|Salen|Complexes of salen and related ligands|Metal salen complexes}} |
|
|
'''Salen''' refers to a ] ] synthesized from ] ('''sal''') and ] ('''en'''). It may also refer to a class of compounds, which are structurally related to the classical salen ligand, primarily bis-]. Salen ligands are notable for coordinating a wide range of different metals, which they can often stabilise in various oxidation states.<ref>{{cite journal |last1=Cozzi |first1=Pier Giorgio |title=Metal–Salen Schiff base complexes in catalysis: practical aspects |journal=Chem. Soc. Rev. |date=2004 |volume=33 |issue=7 |pages=410–421 |doi=10.1039/B307853C|pmid=15354222 }}</ref> For this reason salen-type compounds are used as ]s. ] also find use as ].<ref>{{cite journal |last1=Shaw |first1=Subrata |last2=White |first2=James D. |title=Asymmetric Catalysis Using Chiral Salen–Metal Complexes: Recent Advances |journal=Chemical Reviews |volume=119 |issue=16 |pages=9381–9426 |date=11 June 2019 |doi=10.1021/acs.chemrev.9b00074|pmid=31184109 |s2cid=184486101 }}</ref> |
|
|
|
|
|
|
==Synthesis and complexation== |
|
==Nomenclature== |
|
|
|
{{main|Metal salen complexes}} |
|
The diphenol H<sub>2</sub>salen is the conjugate acid of the ligand that logically is salen<sup>2-</sup>. But the terminology is used loosely. As an ]ic ] ligand, salen<sup>2-</sup> resembles tetradentate ligands including those that are macrocyclic, such as ]ate, ], ], and some ]s. |
|
|
|
H<sub>2</sub>salen may be synthesized by the ] of ethylenediamine and salicylaldehyde.<ref>{{cite journal | author = Tsumaki, T. | title = Nebenvalenzringverbindungen. IV. Über einige innerkomplexe Kobaltsalze der Oxyaldimine | journal = ] | year = 1938 | volume = 13 | issue = 2 | language = German | pages = 252–260 | doi = 10.1246/bcsj.13.252| doi-access = free }}</ref> |
|
⚫ |
:] |
|
|
] |
|
|
] |
|
|
|
|
|
|
Complexes of salen with metal cations can often be made in situ, i.e., without isolating the H<sub>2</sub>salen.<ref>{{cite book | first1= Harvey |last1=Diehl|first2= Clifford C. |last2=Hach |title=Inorganic Syntheses |chapter=Bis( ''N,N'' '-Disalicylalethylenediamine)-μ - Aquodicobalt(II) | journal = ] | year = 1950 | volume = 3 | pages = 196–201 | doi = 10.1002/9780470132340.ch53 | isbn = 978-0-470-13234-0}}</ref><ref name = cozzi>{{cite journal | doi = 10.1039/B307853C | journal = Chem. Soc. Rev. | title = Metal-Salen Schiff base complexes in catalysis: Practical aspects | year = 2004 | author = Pier Giorgio Cozzi| volume = 33 | issue = 7 | pages = 410–421 | pmid=15354222}}</ref> |
|
==Preparation== |
|
|
|
:H<sub>2</sub>salen + M<sup>2+</sup> → M(salen) + 2 H<sup>+</sup> |
|
SalenH<sub>2</sub> is commercially available. It was first prepared by Pfeiffer.<ref>{{cite journal | author = P. Pfeiffer, E. Breith, E. Lübbe, T. Tsumaki| title = "Tricyclische orthokondensierte Nebenvalenzringe | journal = ] | volume = 503 | pages = 84–130 | year = 1933 | doi = 10.1002/jlac.19335030106}}</ref> It is often generated in situ followed by the addition of the metal salt, but the ligand is also easily prepared as a pure organic compound by the ] of ] and ].<ref>{{cite journal | author = Harvey Diehl, Clifford C. Hach | journal = ] | year = 1950 | volume = 3 | pages = 196–201 | doi = 10.1002/9780470132340.ch53 | title = Bis(N,N' - Disalicylalethylenediamine) -μ - Aquodicobalt(II)}}</ref> |
|
|
|
|
|
|
|
==See also== |
⚫ |
:] |
|
|
|
*]s, a structurally related class of ] |
|
|
|
|
|
==References== |
|
==References== |
Line 43: |
Line 64: |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
] |
|
|
] |
|