| Revision as of 17:27, 10 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per [[Misplaced Pages:WikiProject Chemicals/Chem← Previous edit |
Latest revision as of 21:10, 6 December 2024 edit undoMfernflower (talk | contribs)Extended confirmed users7,828 editsNo edit summary |
| (27 intermediate revisions by 20 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 444095119 |
|
|
|
| Watchedfields = changed |
| ⚫ |
|Reference=<ref> at chemicalland21.com</ref> |
|
|
⚫ |
| verifiedrevid = 444097323 |
|
|ImageFile=salicylanilide.png |
|
|
⚫ |
| Reference = <ref> at chemicalland21.com</ref> |
| ⚫ |
|ImageSize=180px |
|
|
⚫ |
| ImageFile = Salicylanilide.svg |
| ⚫ |
|IUPACName=2-Hydroxy-''N''-phenylbenzamide |
|
|
⚫ |
| ImageSize = 175px |
| ⚫ |
|OtherNames=2-Hydroxybenzanilide |
|
|
⚫ |
| PIN =2-Hydroxy-''N''-phenylbenzamide |
| ⚫ |
|Section1={{Chembox Identifiers |
|
|
⚫ |
| OtherNames = 2-Hydroxybenzanilide |
| ⚫ |
| CASNo=87-17-2 |
|
|
|
|
| ⚫ |
| PubChem=6872 |
|
|
⚫ |
| Section1 = {{Chembox Identifiers |
| ⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 87-17-2 |
|
|
| Beilstein = 1108135 |
|
|
| ChEBI = 239133 |
|
|
| ChEMBL = 82970 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6610 |
|
|
| EINECS = 201-727-8 |
|
|
| KEGG = C18915 |
|
⚫ |
| PubChem = 6872 |
|
⚫ |
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = LHP8NEY345 |
|
| UNII = LHP8NEY345 |
|
|
| InChI = 1/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) |
| ⚫ |
| SMILES=C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2O |
|
|
|
| InChIKey = WKEDVNSFRWHDNR-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C13H11NO2/c15-12-9-5-4-8-11(12)13(16)14-10-6-2-1-3-7-10/h1-9,15H,(H,14,16) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = WKEDVNSFRWHDNR-UHFFFAOYSA-N |
|
⚫ |
| SMILES =C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2O |
|
}} |
|
}} |
| ⚫ |
|Section2={{Chembox Properties |
|
| ⚫ |
| C=13|H=11|N=1|O=2 |
|
| ⚫ |
| Appearance=White to off-white crystalline solid |
|
|
| Density= |
|
|
| MeltingPt=136-138 °C |
|
|
|
|
|
|
⚫ |
| Section2 = {{Chembox Properties |
|
| BoilingPt= |
|
|
⚫ |
| C=13 | H=11 | N=1 | O=2 |
|
| Solubility= |
|
|
⚫ |
| Appearance = White to off-white crystalline solid |
|
|
| Density = |
|
|
| MeltingPtC = 136 to 138 |
|
|
| MeltingPt_notes = |
|
|
| BoilingPt = |
|
|
| Solubility = |
|
}} |
|
}} |
|
|
|
|
|Section3={{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| EUClass = Xi |
|
|
| FlashPt= |
|
| FlashPt = |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
|
| GHS_ref=<ref>{{cite web |title=Salicylanilide |url=https://pubchem.ncbi.nlm.nih.gov/compound/6872#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |access-date=13 December 2021 |language=en}}</ref> |
|
| RPhrases = {{R36/37/38}} |
|
|
| SPhrases = {{S36/37/39}} |
|
| GHSPictograms = {{GHS07}}{{GHS09}} |
|
|
| GHSSignalWord = Warning |
|
|
| HPhrases = {{H-phrases|315|319|335|400}} |
|
|
| PPhrases = {{P-phrases|261|264|271|273|280|302+352|304+340|305+351+338|312|321|332+313|337+313|362|391|403+233|405|501}} |
|
}} |
|
}} |
|
}} |
|
}} |
| Line 33: |
Line 54: |
|
'''Salicylanilide''' is a chemical compound which is the ] of ] and ]. It is classified as both a ] and an ].<ref>{{MeshName|Salicylanilides}}</ref> |
|
'''Salicylanilide''' is a chemical compound which is the ] of ] and ]. It is classified as both a ] and an ].<ref>{{MeshName|Salicylanilides}}</ref> |
|
|
|
|
|
Derivatives of salicylanilide have a variety of pharmacological uses. ] derivatives including ], ], and ] are used as ]s, especially as flukicides. ] derivatives including ], ], and ] are used as ]s with ] and ] activities. |
|
Derivatives of salicylanilide have a variety of pharmacological uses. ] derivatives including ], ], and ] are used as ]s, especially as ]. {{anchor|Tribromsalan}}] derivatives including ], ], and tribromsalan are used as topical ]s and ]s. |
|
|
|
|
|
|
|
|
<gallery> |
|
<gallery> |
|
|
File:Bromochlorosalicylanilide.svg | ] |
|
File:Niclosamide.svg|Niclosamide |
|
File:Niclosamide.svg | Niclosamide |
|
File:Oxyclozanide.png|Oxyclozanide |
|
File:Oxyclozanide.svg | Oxyclozanide |
|
File:Rafoxanide.png|Rafoxanide |
|
File:Rafoxanide.svg | Rafoxanide |
|
</gallery> |
|
</gallery> |
|
|
|
|
|
|
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{Authority control}} |
| ⚫ |
] |
|
|
|
|
|
|
⚫ |
] |
| ⚫ |
] |
|