| Revision as of 13:35, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 418108765 of page Samandaridine for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 21:17, 27 October 2023 edit Graeme Bartlett (talk | contribs)Administrators249,716 edits removed Category:Vertebrate toxins; added Category:Amphibian toxins using HotCat |
| Line 1: |
Line 1: |
|
|
{{Chembox |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
| Verifiedfields = changed |
|
{{chembox |
|
|
|
| Watchedfields = changed |
|
| verifiedrevid = 401047670 |
|
| verifiedrevid = 464386497 |
|
| ImageFile = Samandaridine.png |
|
| ImageFile = Samandaridine.png |
|
| ImageSize = |
|
| ImageSize = |
|
| IUPACName = (''2S,5R,5aS,5bS,7aS,7bR,10aS,11aS,11bS,13aR'')-Octadecahydro-5a,7a-dimethyl-2,5-epoxyfurocyclopentanaphthazepin-9(1H)-one |
|
| PIN = (2''S'',5''R'',5a''S'',5b''S'',7a''S'',7b''R'',10a''S'',11a''S'',11b''S'',13a''R'')-5a,7a-Dimethyloctadecahydro-2,5-epoxyfurocyclopentanaphthoazepin-9(1''H'')-one |
|
| OtherNames = Samandaridine<br>Samandaridin |
|
| OtherNames = Samandaridine<br>Samandaridin |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
| InChI = 1S/C21H31NO3/c1-20-6-5-13-12(14(20)8-16-15(20)9-19(23)24-16)4-3-11-7-18-22-10-17(25-18)21(11,13)2/h11-18,22H,3-10H2,1-2H3/t11-,12-,13+,14+,15+,16+,17+,18+,20+,21+/m1/s1 |
|
| InChI = 1S/C21H31NO3/c1-20-6-5-13-12(14(20)8-16-15(20)9-19(23)24-16)4-3-11-7-18-22-10-17(25-18)21(11,13)2/h11-18,22H,3-10H2,1-2H3/t11-,12-,13+,14+,15+,16+,17+,18+,20+,21+/m1/s1 |
| Line 15: |
Line 16: |
|
| StdInChIKey = GUSZSGSYIVZEDM-MZDLDJOOSA-N |
|
| StdInChIKey = GUSZSGSYIVZEDM-MZDLDJOOSA-N |
|
| InChIKey1 = GUSZSGSYIVZEDM-MZDLDJOOSA-N |
|
| InChIKey1 = GUSZSGSYIVZEDM-MZDLDJOOSA-N |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 6384-73-2 --> |
|
|
|
| CASNo = 6384-73-2 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = WCB49WL3GW |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 21106478 |
|
| ChemSpiderID = 21106478 |
|
| EINECS = |
|
| EINECS = |
|
| PubChem = |
|
| PubChem = 12315225 |
|
| SMILES = O=C2C34(C)CC15(C)6CN(C5CC14C3O2)O6 |
|
| SMILES = O=C2C34(C)CC15(C)6CN(C5CC14C3O2)O6 |
|
| InChI = |
|
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
| ChEBI = |
|
| ChEBI = |
|
| KEGG = |
|
| KEGG = |
|
|
}} |
|
| ATCCode_prefix = |
|
|
⚫ |
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
|
| C=21 | H=31 | N=1 | O=3 |
|
| ATC_Supplemental =}} |
|
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
| Formula = {{carbon}}<sub>21</sub>{{hydrogen}}<sub>31</sub>{{nitrogen}}{{oxygen}}<sub>3</sub> |
|
|
| MolarMass = 345.48 g/mol |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| Melting_notes = |
|
| MeltingPt_notes = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Boiling_notes = |
|
| BoilingPt_notes = |
|
| Solubility = |
|
| Solubility = |
|
| SolubleOther = |
|
| SolubleOther = |
|
| Solvent = |
|
| Solvent = |
|
| pKa = |
|
| pKa = |
|
| pKb = }} |
|
| pKb = |
|
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| ExternalMSDS = |
|
| ExternalSDS = |
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| MainHazards = |
|
| NFPA-H = |
|
| NFPA-H = |
|
| NFPA-F = |
|
| NFPA-F = |
|
| NFPA-R = |
|
| NFPA-R = |
|
| NFPA-O = |
|
| NFPA-S = |
|
| RPhrases = |
|
| HPhrases = |
|
| SPhrases = |
|
| PPhrases = |
|
| RSPhrases = |
|
| GHS_ref = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| ExploLimits = |
|
| ExploLimits = |
|
| PEL = }} |
|
| PEL = |
|
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Samandaridine''' is an extremely ] ] produced by the ] ]s of various ]s.<ref>{{cite journal | title = Über Samandaron und Samandaridin, Nebenalkaloide im Gift des Feuer- und Alpensalamanders |trans-title=Salamander alkaloids. II. Samandarone and samandaridine, secondary alkaloids in the poison of the fire and alpine salamanders |author1=Schöpf, C. |author2=Koch, K. | journal = Justus Liebigs Annalen der Chemie | year = 1942 | volume = 552 | issue = 1 | pages = 37–61 | doi = 10.1002/jlac.19425520103 }}</ref> |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
|
|
|
{{Toxins}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{alkaloid-stub}} |