| Revision as of 09:36, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 449644957 of page Santin_(flavonol) for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo'). |
Latest revision as of 00:42, 7 May 2023 edit LegionMammal978 (talk | contribs)Extended confirmed users7,894 edits add semisystematic name |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 448820626 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 477856896 |
|
| Name = Santin |
|
| Name = Santin |
|
| ImageFile = santin.PNG |
|
| ImageFile = santin.svg |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of santin |
|
| ImageName = Chemical structure of santin |
|
| IUPACName = 5,7-dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
|
| IUPACName = 5,7-Dihydroxy-3,4′,6-trimethoxyflavone |
|
| OtherNames = 5,7-Dihydroxy-3,6,4'-trimethoxyflavone |
|
| SystematicName = 5,7-Dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)-4''H''-1-benzopyran-4-one |
|
|
| OtherNames = 5,7-Dihydroxy-3,6,4′-trimethoxyflavone |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = <!-- blanked - oldvalue: 27782-63-4 --> |
|
| CASNo = 27782-63-4 |
|
| CASNo_Ref = |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = 5785Y952EH |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CASNoOther = |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 161957 |
|
| ChEMBL = 161957 |
|
| PubChem = 5281695 |
|
| PubChem = 5281695 |
|
| SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)O)OC)O)OC |
|
| SMILES = COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)O)OC)O)OC |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 4445012 |
|
| ChemSpiderID = 4445012 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
| ⚫ |
| InChI = 1/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 |
|
|
|
| ChEBI = 9024 |
| ⚫ |
| InChIKey = DWZAJFZEYZIHPO-UHFFFAOYAB |
|
|
⚫ |
| InChI = 1/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 |
| ⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
|
⚫ |
| InChIKey = DWZAJFZEYZIHPO-UHFFFAOYAB |
|
⚫ |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 |
|
| StdInChI = 1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DWZAJFZEYZIHPO-UHFFFAOYSA-N |
|
| StdInChIKey = DWZAJFZEYZIHPO-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=18 | H=16 | O=7 |
|
| Formula = C<sub>18</sub>H<sub>16</sub>O<sub>7</sub> |
|
|
| MolarMass = 344.31 g/mol |
|
|
| ExactMass = 344.089603 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''Santin''' is an ]. It was isolated from '']''.<ref>Martinez, J., et al. (1997). ''Journal of Natural Products'' 60(2), 142-44.</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{flavonol}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{aromatic-stub}} |