| Revision as of 18:02, 5 March 2010 edit77.220.102.63 (talk) + german← Previous edit |
Latest revision as of 18:03, 2 January 2024 edit undoMazewaxie (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers113,603 editsm formattingTag: AWB |
| (31 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=saralasin.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 347942559 |
| ⚫ |
|IUPACName=(2''S'')-2-<nowiki>amino]pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(1''H''-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
|
|
⚫ |
| ImageFile=saralasin.png |
| ⚫ |
|OtherNames=Sar-Arg-Val-Tyr-Val-His-Pro-Ala |
|
|
⚫ |
| ImageSize=200px |
|
⚫ |
| IUPACName=(2''S'')-2-<nowiki>amino]pentanoyl]amino]-3-methylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]-3-methylbutanoyl]amino]-3-(1''H''-imidazol-5-yl)propanoyl]pyrrolidine-2-carbonyl]amino]propanoic acid |
|
⚫ |
| OtherNames=Sar-Arg-Val-Tyr-Val-His-Pro-Ala |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| CASNo=34273-10-4 |
|
|
|
| UNII = H2AFV2HE66 |
| ⚫ |
| PubChem=6324663 |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| SMILES=C(C(=O)O)NC(=O)1CCCN1C(=O)(CC2=CN=CN2)NC(=O)(C(C)C)NC(=O)(CC3=CC=C(C=C3)O)NC(=O)(C(C)C)NC(=O)(CCCN=C(N)N)NC(=O)CNC |
|
|
⚫ |
| CASNo=34273-10-4 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 938 |
|
|
| ChEMBL2_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL2 = 1200670 |
|
⚫ |
| PubChem=6324663 |
|
⚫ |
| SMILES=C(C(=O)O)NC(=O)1CCCN1C(=O)(CC2=CN=CN2)NC(=O)(C(C)C)NC(=O)(CC3=CC=C(C=C3)O)NC(=O)(C(C)C)NC(=O)(CCCN=C(N)N)NC(=O)CNC |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4884380 |
|
|
| InChI = 1/C42H65N13O10/c1-22(2)33(53-35(58)28(50-32(57)20-45-6)9-7-15-47-42(43)44)38(61)51-29(17-25-11-13-27(56)14-12-25)36(59)54-34(23(3)4)39(62)52-30(18-26-19-46-21-48-26)40(63)55-16-8-10-31(55)37(60)49-24(5)41(64)65/h11-14,19,21-24,28-31,33-34,45,56H,7-10,15-18,20H2,1-6H3,(H,46,48)(H,49,60)(H,50,57)(H,51,61)(H,52,62)(H,53,58)(H,54,59)(H,64,65)(H4,43,44,47)/t24-,28-,29-,30-,31-,33-,34-/m0/s1 |
|
|
| InChIKey = PFGWGEPQIUAZME-NXSMLHPHBA |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C42H65N13O10/c1-22(2)33(53-35(58)28(50-32(57)20-45-6)9-7-15-47-42(43)44)38(61)51-29(17-25-11-13-27(56)14-12-25)36(59)54-34(23(3)4)39(62)52-30(18-26-19-46-21-48-26)40(63)55-16-8-10-31(55)37(60)49-24(5)41(64)65/h11-14,19,21-24,28-31,33-34,45,56H,7-10,15-18,20H2,1-6H3,(H,46,48)(H,49,60)(H,50,57)(H,51,61)(H,52,62)(H,53,58)(H,54,59)(H,64,65)(H4,43,44,47)/t24-,28-,29-,30-,31-,33-,34-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = PFGWGEPQIUAZME-NXSMLHPHSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>42</sub>H<sub>65</sub>N<sub>13</sub>O<sub>10</sub> |
|
| Formula=C<sub>42</sub>H<sub>65</sub>N<sub>13</sub>O<sub>10</sub> |
|
| MolarMass=912.05 g/mol |
|
| MolarMass=912.05 g/mol |
|
| Appearance= |
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Saralasin''' is a ] of ]. It is an angiotensin II analogue, containing ]-1 and ]-8, hence the name ('''sar'''cosine, '''ala'''nine, angioten'''sin'''). |
|
'''Saralasin''' is a ] ] with ]ic activity. The aminopeptide sequence for saralasin differs from ] at three sites: |
|
|
* At position 1, ] replaces ], thereby increasing the affinity for ] ]s and making sara resistant to degradation by ]s.<ref>Pals et al (1979)</ref> |
|
|
* At position 5, ] is replaced by ] |
|
|
* At position 8, ] is replaced by ] which leads to a smaller stimulatory effect. Saralasin was used to distinguish ] from ] before its discontinuation in January 1984 because of many false-positive and false-negative reports.<ref>Hutchison and Shahan (2004)</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
==External links== |
|
* {{MeshName|Saralasin}} |
|
* {{MeshName|Saralasin}} |
|
* {{cite journal | author = Olsson M, Annerbrink K, Hedner J, Eriksson E | title = Intracerebroventricular administration of the angiotensin II receptor antagonist saralasin reduces respiratory rate and tidal volume variability in freely moving Wistar rats. | journal = Psychoneuroendocrinology | volume = 29 | issue = 1 | pages = 107–12 | year = 2004 | pmid = 14575733 | doi = 10.1016/S0306-4530(02)00147-6}} |
|
* {{cite journal | vauthors = Olsson M, Annerbrink K, Hedner J, Eriksson E | title = Intracerebroventricular administration of the angiotensin II receptor antagonist saralasin reduces respiratory rate and tidal volume variability in freely moving Wistar rats. | journal = Psychoneuroendocrinology | volume = 29 | issue = 1 | pages = 107–12 | year = 2004 | pmid = 14575733 | doi = 10.1016/S0306-4530(02)00147-6| s2cid = 44451942 }} |
|
* {{cite journal | author = Ip S, Tsang S, Wong T, Che C, Leung P | title = Saralasin, a nonspecific angiotensin II receptor antagonist, attenuates oxidative stress and tissue injury in cerulein-induced acute pancreatitis. | journal = Pancreas | volume = 26 | issue = 3 | pages = 224–9 | year = 2003 | pmid = 12657946 | doi = 10.1097/00006676-200304000-00003}} |
|
* {{cite journal | vauthors = Ip S, Tsang S, Wong T, Che C, Leung P | title = Saralasin, a nonspecific angiotensin II receptor antagonist, attenuates oxidative stress and tissue injury in cerulein-induced acute pancreatitis. | journal = Pancreas | volume = 26 | issue = 3 | pages = 224–9 | year = 2003 | pmid = 12657946 | doi = 10.1097/00006676-200304000-00003| s2cid = 28646144 }} |
|
* {{cite journal | author = Tsang S, Ip S, Wong T, Che C, Leung P | title = Differential effects of saralasin and ramiprilat, the inhibitors of renin-angiotensin system, on cerulein-induced acute pancreatitis. | journal = Regul Pept | volume = 111 | issue = 1-3 | pages = 47–53 | year = 2003 | pmid = 12609748 | doi = 10.1016/S0167-0115(02)00226-4}} |
|
* {{cite journal | vauthors = Tsang S, Ip S, Wong T, Che C, Leung P | title = Differential effects of saralasin and ramiprilat, the inhibitors of renin-angiotensin system, on cerulein-induced acute pancreatitis. | journal = Regul Pept | volume = 111 | issue = 1–3 | pages = 47–53 | year = 2003 | pmid = 12609748 | doi = 10.1016/S0167-0115(02)00226-4| s2cid = 2150707 }} |
|
|
|
|
|
{{Angiotensin receptor modulators}} |
|
|
|
|
|
] |
|
] |
| Line 37: |
Line 64: |
|
|
|
|
|
|
|
|
|
{{biochemistry-stub}} |
|
{{pharmacology-stub}} |
|
|
|
|
] |
|
|
] |
|
|
] |
|