| Revision as of 13:45, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456495290 of page Scarlet_GN for the Chem/Drugbox validation project (updated: 'ChemSpiderID', 'StdInChI', 'StdInChIKey', 'CASNo'). |
Latest revision as of 13:50, 19 March 2024 edit Tautropfli (talk | contribs)149 editsm Use of Unbulleted list macro for OtherNames property of Chembox as is the recommendation in the docs.Tag: 2017 wikitext editor |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 456489563 |
|
| verifiedrevid = 464387733 |
|
| ImageFile = Scarlet_GN.svg |
|
| ImageFile = Scarlet_GN.svg |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageName = Kekulé, canonical skeletal formula of scarlet GN ((6E)-6-hydrazinylidene) |
|
| ImageName = Kekulé, canonical skeletal formula of scarlet GN ((6E)-6-hydrazinylidene) |
|
| PIN = Disodium 3--4-oxonaphthalene-1-sulfonate{{Citation needed|date = September 2011}} |
|
| SystematicName = Disodium 3--4-oxonaphthalene-1-sulfonate |
|
|
| OtherNames = {{Unbulleted list|Crimson 4R|C.I. Food Red 1|Food red 1|FD & C Red no. 4|Hexacol Ponceau SX|Maple Ponceau SX|Ponceau SX|Purple 4R|E125}} |
|
| OtherNames = Crimson 4R{{Citation needed|date = September 2011}}<br /> |
|
|
⚫ |
|Section1={{Chembox Identifiers |
|
C.I. Food Red 1{{Citation needed|date = September 2011}}<br /> |
|
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
Food red 1{{Citation needed|date = September 2011}}<br /> |
|
|
|
| CASNo = 4548-53-2 |
|
FD & C Red no. 4{{Citation needed|date = September 2011}}<br /> |
|
|
⚫ |
| CASNo_Comment = <small>(''Z'')</small> |
|
Hexacol Ponceau SX{{Citation needed|date = September 2011}}<br /> |
|
|
⚫ |
| PubChem = 6537642 |
|
Maple Ponceau SX{{Citation needed|date = September 2011}}<br /> |
|
|
⚫ |
| PubChem_Comment = <small>(''Z'')</small> |
|
Ponceau SX Lake 4R purple{{Citation needed|date = September 2011}}<br /> |
|
|
⚫ |
| PubChem1 = 5483118 |
|
Purple 4R{{Citation needed|date = September 2011}} |
|
|
⚫ |
| PubChem1_Comment = <small>(''E'')</small> |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = X3W0AM1JLX |
|
| CASNo = <!-- blanked - oldvalue: 3257-28-1 --> |
|
|
⚫ |
| ChemSpiderID = 5020702 |
| ⚫ |
| CASNo_Comment = <small>(6''Z'')-6-hydrazinylidene</small> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| PubChem = 6537642 |
|
|
⚫ |
| ChemSpiderID_Comment = <small>(''Z'')</small> |
|
| PubChem_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
⚫ |
| EINECS = 221-856-3 |
| ⚫ |
| PubChem_Comment = <small>(6''Z'')-6-hydrazinylidene</small> |
|
|
|
| SMILES = .Cc3cc(S(=O)(=O))c(N=Nc2c(O)c1c(cc2)c(S(=O)(=O))ccc1)c(C)c3. |
| ⚫ |
| PubChem1 = 5483118 |
|
|
⚫ |
| SMILES1 = CC1=CC(=C(NN=C2C=CC3=C(C=CC=C3C2=O)S(=O)(=O)O)C(C)=C1)S(=O)(=O)O |
|
| PubChem1_Ref = {{Pubchemcite|correct|Pubchem}} |
|
|
⚫ |
| StdInChI = 1S/C18H16N2O7S2.2Na/c1-10-8-11(2)17(16(9-10)29(25,26)27)20-19-14-7-6-12-13(18(14)21)4-3-5-15(12)28(22,23)24;;/h3-9,20H,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b19-14-;; |
| ⚫ |
| PubChem1_Comment = <small>(6''E'')-6-hydrazinylidene</small> |
|
|
⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| ChemSpiderID = 21106479 |
|
|
⚫ |
| StdInChIKey = AQJHOKDCKYSJAS-MHZTUVSFSA-L |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| ChemSpiderID_Comment = <small>(6''Z'')-6-hydrazinylidene</small> |
|
| ⚫ |
| EINECS = 221-856-3 |
|
|
| SMILES = Cc1cc(C)c(NN=c2ccc3c(cccc3c2=O)S(=O)(=O)O)c(c1)S(=O)(=O)O |
|
| ⚫ |
| SMILES1 = CC1=CC(=C(NN=C2C=CC3=C(C=CC=C3C2=O)S(=O)(=O)O)C(C)=C1)S(=O)(=O)O |
|
| ⚫ |
| StdInChI = 1S/C18H16N2O7S2.2Na/c1-10-7-11(2)16(28(22,23)24)8-14(10)19-20-15-9-17(29(25,26)27)12-5-3-4-6-13(12)18(15)21;;/h3-9,15H,1-2H3,(H,22,23,24)(H,25,26,27);;/q;2*+1/p-2/b20-19+;; |
|
| ⚫ |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
| ⚫ |
| StdInChIKey = BLTDGHUKBPVCPH-LLIZZRELSA-L |
|
| ⚫ |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = {{Chem|Na|2|C|18|H|14|N|2|S|2|O|7}} |
|
| C=18 | H=14 | N=2 | Na=2 | O=7 | S=2 |
|
| MolarMass = 480.422 g mol<sup>-1</sup> |
|
|
| ExactMass = 480.003781542 g mol<sup>-1</sup> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Scarlet GN''', or '''C.I. Food Red 2''', '''FD&C Red No. 4''', or '''C.I. 14815''' is a red ] once used as a ]. As a ], it has the ] E125. It is usually used as a disodium ]. |
|
|
|
|
|
In the United States, it is not permitted for use in food or ingested drugs and may only be used in externally applied drugs and cosmetics, due to potential ] effects from ingesting it.<ref>{{CodeFedReg|21|81|10}}</ref><ref>{{CodeFedReg|21|81|30}}</ref><ref>{{CodeFedReg|21|82|304}}</ref> An exception was added in 1965 to allow its use in the coloring of ], which were considered mainly decorative and not a foodstuff.<ref>{{cite book |last=Pavia|first=Donald L.|year=2005|title=Introduction to Organic Laboratory Techniques: A Small Scale Approach|edition=2nd |pages=387–389|publisher=Thomson Brooks/Cole |isbn=0534408338|url=https://books.google.com/books?id=ega5c11VHvkC|accessdate=January 25, 2013}}</ref> This exception was repealed in 1976 due to mounting safety concerns. In the European Union, it is not permitted as a food additive.<ref name=FSAlist>, ]</ref> |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{DEFAULTSORT:Scarlet Gn}} |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |