| Revision as of 17:08, 18 February 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm cleanup← Previous edit |
Latest revision as of 01:05, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (25 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
|ImageFile=Scutellarein.png |
|
|
|
| Watchedfields = changed |
| ⚫ |
|ImageSize=200px |
|
|
|
| verifiedrevid = 414643244 |
| ⚫ |
|IUPACName=5,6,7,4'-Tetrahydroxyflavone |
|
|
⚫ |
| ImageFile=Scutellarein.svg |
| ⚫ |
|OtherNames=6-Hydroxyapigenin; 5,6,7,4'-tetrahydroxyflavone |
|
|
⚫ |
| ImageSize=200px |
| ⚫ |
|Section1= {{Chembox Identifiers |
|
|
|
| ImageFile1 = Scutellarein molecule ball.png |
| ⚫ |
| CASNo = 529-53-3 |
|
|
| PubChem = 5281697 |
|
| ImageSize1 = 220 |
|
|
| ImageAlt1 = Ball-and-stick model of scutellarein |
| ⚫ |
| SMILES = C13=C(OC(=CC1=O)C2=CC=C(O)C=C2)C=C(O)C(=C3O)O |
|
|
⚫ |
| IUPACName=4′,5,6,7-Tetrahydroxyflavone |
|
|
| SystematicName=5,6,7-Trihydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one |
|
⚫ |
| OtherNames=6-Hydroxyapigenin |
|
⚫ |
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
⚫ |
| CASNo = 529-53-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = P460GTI853 |
|
|
| PubChem = 5281697 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 55415 |
|
⚫ |
| SMILES = C13=C(OC(=CC1=O)C2=CC=C(O)C=C2)C=C(O)C(=C3O)O |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4445014 |
|
|
| InChI = 1/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
|
|
| InChIKey = JVXZRQGOGOXCEC-UHFFFAOYAD |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = JVXZRQGOGOXCEC-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9062 |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| Formula=C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| MolarMass= 286.241 g/mol |
|
| MolarMass= 286.241 g/mol |
|
|
| Appearance= |
|
| ExactMass = 286.047738 |
|
|
| Appearance= |
|
| Density= |
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= |
|
| Solubility= |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Scutellarein''' is chemical organic compound. It is a ] that can be found in '']''. |
|
'''Scutellarein''' is a ] that can be found in '']'' and other members of the genus '']'', as well as the fern '']''.<ref>{{cite journal | title=Flavonoid distribution in asplenioid ferns | first1=Yusuf | last1=UmiKalsom | first2=Jeffrey B. | last2=Harborne | journal=Pertanika | year=1991 | volume=14 | issue=3 | pages=297–300}}</ref> |
|
|
|
|
|
==]s== |
|
== ]s == |
|
The ] (Scutellarein-7-]) is transformed by hydrolysis into scutellarein. |
|
The ] (Scutellarein-7-]) is transformed by hydrolysis into scutellarein. |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
==External links== |
|
|
* |
|
|
|
|
|
|
{{Flavone}} |
|
{{Flavone}} |
| Line 42: |
Line 62: |
|
] |
|
] |
|
|
|
|
|
{{Ketone-stub}} |
|
{{Aromatic-stub}} |
|
|
|
|
] |
|