| Revision as of 12:57, 15 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 472787562 of page Sedoheptulose_7-phosphate for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 18:51, 30 September 2024 edit Marbletan (talk | contribs)Extended confirmed users5,456 editsNo edit summary |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 464388344 |
|
| verifiedrevid = 476997500 |
|
| ImageFile = Sedoheptulose 7-phosphate.svg |
|
| ImageFile = Sedoheptulose 7-phosphate.svg |
|
| ImageSize = |
|
| ImageSize = |
|
|
| IUPACName = <small>D</small>-''altro''-Hept-2-ulose 7-phosphate |
|
| IUPACName = |
|
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 144663 |
|
| ChemSpiderID = 144663 |
|
| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 |
|
| InChI = 1/C7H15O10P/c8-1-3(9)5(11)7(13)6(12)4(10)2-17-18(14,15)16/h4-8,10-13H,1-2H2,(H2,14,15,16)/t4-,5-,6-,7+/m1/s1 |
| Line 17: |
Line 16: |
|
| StdInChIKey = JDTUMPKOJBQPKX-GBNDHIKLSA-N |
|
| StdInChIKey = JDTUMPKOJBQPKX-GBNDHIKLSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 2646-35-7 --> |
|
| CASNo = 2646-35-7 |
|
| PubChem = 165007 |
|
| PubChem = 165007 |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 15721 |
|
| ChEBI = 15721 |
|
| SMILES = O=P(O)(OC(O)(O)(O)(O)C(=O)CO)O |
|
| SMILES = O=P(O)(OC(O)(O)(O)(O)C(=O)CO)O |
|
| MeSHName = sedoheptulose+7-phosphate |
|
| MeSHName = sedoheptulose+7-phosphate |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
| Section2 = {{Chembox Properties |
|
|
| C=7 | H=15 | O=10 | P=1 |
|
| Formula = C<sub>7</sub>H<sub>15</sub>O<sub>10</sub>P |
|
|
|
| Appearance = |
|
| MolarMass = 290.162 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
| Section3 = {{Chembox Hazards |
|
| Solubility = |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| AutoignitionPt = |
|
| Autoignition = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Sedoheptulose 7-phosphate''' is an intermediate in the ].<ref>{{cite web | url = https://hmdb.ca/metabolites/HMDB0001068 | title = Metabocard for D-Sedoheptulose 7-phosphate | work = Human Metabolism Database }}</ref> |
|
|
|
|
|
It is formed by ] and acted upon by ]. |
|
|
|
|
|
] is an enzyme that uses ] and ATP to produce ADP and sedoheptulose 7-phosphate. |
|
|
|
|
|
] is an enzyme that uses ] and H<sub>2</sub>O to produce sedoheptulose 7-phosphate and phosphate. |
|
|
|
|
|
== See also == |
|
|
* ] |
|
|
* ], a related compound and an intermediate in the biosynthesis of shikimic acid |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Pentose phosphate pathway intermediates}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{biochem-stub}} |