Revision as of 13:56, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Saving copy of the {{drugbox}} taken from revid 447815979 of page Seletracetam for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 22:33, 8 March 2024 edit InternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,388,413 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Maxim Masiutin - 17855 |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
{{cs1 config|name-list-style=vanc}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 443441438 |
|
| verifiedrevid = 464388926 |
|
| IUPAC_name = ''(2S)-2-butanamide'' |
|
| IUPAC_name = (2''S'')-2-butanamide<ref name=Malykh /> |
|
| image = Seletracetam.svg |
|
| image = Seletracetam.svg |
|
| width = 150 |
|
| width = 140 |
|
| image2 = Selectracetam3d.png |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
|
| legal_AU = S4 |
|
| legal_status = Unscheduled (US) |
|
| legal_US = Unscheduled |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral<ref name=Malykh /><ref name="Bennett" /> |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = >90% |
|
| bioavailability = >90%<ref name=Malykh /><ref name="Bennett" /> |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 8h |
|
| elimination_half-life = 8 hours<ref name=Malykh /><ref name="Bennett" /> |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 357336-74-4 --> |
|
| CAS_number = 357336-74-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| PubChem = 9856063 |
|
| PubChem = 9856063 |
Line 34: |
Line 37: |
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=14 | F=2 | N=2 | O=1 |
|
| C=10 | H=14 | F=2 | N=2 | O=1 |
|
| molecular_weight = 232.227 |
|
|
| smiles = F\C(F)=C/1CC(=O)N((C(=O)N)CC)C1 |
|
| smiles = F\C(F)=C/1CC(=O)N((C(=O)N)CC)C1 |
|
| InChI = 1/C10H14F2N2O2/c1-2-7(10(13)16)14-5-6(3-8(11)12)4-9(14)15/h3,6-7H,2,4-5H2,1H3,(H2,13,16)/t6-,7-/m0/s1 |
|
|
| InChIKey = ANWPENAPCIFDSZ-BQBZGAKWBQ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C10H14F2N2O2/c1-2-7(10(13)16)14-5-6(3-8(11)12)4-9(14)15/h3,6-7H,2,4-5H2,1H3,(H2,13,16)/t6-,7-/m0/s1 |
|
| StdInChI = 1S/C10H14F2N2O2/c1-2-7(10(13)16)14-5-6(3-8(11)12)4-9(14)15/h3,6-7H,2,4-5H2,1H3,(H2,13,16)/t6-,7-/m0/s1 |
Line 43: |
Line 43: |
|
| StdInChIKey = ANWPENAPCIFDSZ-BQBZGAKWSA-N |
|
| StdInChIKey = ANWPENAPCIFDSZ-BQBZGAKWSA-N |
|
}} |
|
}} |
|
|
'''Seletracetam''' (UCB 44212) is a ]-derived<ref name="Bennett" /> ] of the ] family that is structurally related to ] (trade name Keppra).<ref name="Bennett" /><ref name=Pollard /> It was under ] by UCB Pharmaceuticals as a more potent and effective ] drug to replace ] but its development has been halted.<ref name=Malykh /> |
|
|
|
|
|
There are two main mechanisms of action for seletracetam. The first is its high-affinity ] binding to synaptic vesicle glycoprotein 2A (]).<ref name="Bennett" /><ref name=Pollard>{{cite journal | vauthors = Pollard JR | title = Seletracetam, a small molecule SV2A modulator for the treatment of epilepsy | journal = Current Opinion in Investigational Drugs | volume = 9 | issue = 1 | pages = 101–107 | date = January 2008 | pmid = 18183537 }}</ref> Seletracetam has shown potent seizure suppression in models of acquired and genetic epilepsy,<ref name=Pollard /> and has been well tolerated by various animal models.<ref name=Pollard /> The second is its binding to ]s and preventing influx of ] during high-voltage activation that is typical of ].<ref name=Martella /><ref name=Pisani2004 /><ref name=Custer/> |
|
|
|
|
|
While similar in structure to ] drugs, it is not expected to have cognitive enhancing properties.<ref name=Matagne /> Seletracetam was in Phase II ] under the supervision of the U.S. ] (FDA) but its production is on hold.<ref name=Pollard /> |
|
|
|
|
|
==Synthesis== |
|
|
Seletracetam's molecular structure contains elements common to other ], including ] and ], such as a nitrogen heterocyclic system.<ref>{{cite journal | vauthors = Wong MG, Defina JA, Andrews PR | title = Conformational analysis of clinically active anticonvulsant drugs | journal = Journal of Medicinal Chemistry | volume = 29 | issue = 4 | pages = 562–572 | date = April 1986 | pmid = 3959032 | doi = 10.1021/jm00154a022 }}</ref><ref>{{cite journal | vauthors = Bruno-Blanch L, Gálvez J, García-Domenech R | title = Topological virtual screening: a way to find new anticonvulsant drugs from chemical diversity | journal = Bioorganic & Medicinal Chemistry Letters | volume = 13 | issue = 16 | pages = 2749–2754 | date = August 2003 | pmid = 12873507 | doi = 10.1016/S0960-894X(03)00535-3 }}</ref> Like ], seletracetam is a derivative of ]. |
|
|
|
|
|
Structure and activity relationship studies have concluded that the most potent anticonvulsant activity was at the ] nitrogen atom and that this activity was further enhanced by nearby ] ]s such as the di-fluoro group on seletracetam.<ref>{{cite journal | vauthors = Kamiński K, Rzepka S, Obniska J | title = Synthesis and anticonvulsant activity of new 1-pyrrolidine-2,5-diones | journal = Bioorganic & Medicinal Chemistry Letters | volume = 21 | issue = 19 | pages = 5800–5803 | date = October 2011 | pmid = 21875804 | doi = 10.1016/j.bmcl.2011.07.118 }}</ref> |
|
|
|
|
|
==Administration== |
|
|
Seletracetam is an orally administered drug, after which it is quickly and efficiently absorbed.<ref name = "Bennett">{{cite journal | vauthors = Bennett B, Matagne A, Michel P, Leonard M, Cornet M, Meeus MA, Toublanc N | title = Seletracetam (UCB 44212) | journal = Neurotherapeutics | volume = 4 | issue = 1 | pages = 117–122 | date = January 2007 | pmid = 17199025 | pmc = 7479702 | doi = 10.1016/j.nurt.2006.11.014 | doi-access = free }}</ref> The typical dosage is 0.03–10 mg/kg per day (up to 0.6g per day).<ref name=Malykh>{{cite journal | vauthors = Malykh AG, Sadaie MR | title = Piracetam and piracetam-like drugs: from basic science to novel clinical applications to CNS disorders | journal = Drugs | volume = 70 | issue = 3 | pages = 287–312 | date = February 2010 | pmid = 20166767 | doi = 10.2165/11319230-000000000-00000 | s2cid = 12176745 }}</ref> |
|
|
|
|
|
==Mechanism of action== |
|
|
Seletracetam's anti-epileptic effects are due to its high affinity binding to synaptic vesicle glycoprotein 2A (])<ref name=Malykh /><ref name="Bennett" /><ref name=Pollard />—part of a ] regulator. The ] protein assists with the coordination of synaptic vesicle exocytosis,<ref name=Bialer /><ref name=Crowder>{{cite journal | vauthors = Crowder KM, Gunther JM, Jones TA, Hale BD, Zhang HZ, Peterson MR, Scheller RH, Chavkin C, Bajjalieh SM | display-authors = 6 | title = Abnormal neurotransmission in mice lacking synaptic vesicle protein 2A (SV2A) | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 96 | issue = 26 | pages = 15268–15273 | date = December 1999 | pmid = 10611374 | pmc = 24809 | doi = 10.1073/pnas.96.26.15268 | doi-access = free | bibcode = 1999PNAS...9615268C }}</ref> which induces ] release in the presence of an influx in ]. A correlation has been drawn between the binding affinity of seletracetam (and its analogues) to ] and the degree of seizure prevention in animal models.<ref name=Matagne>{{cite journal | vauthors = Matagne A, Margineanu DG, Potschka H, Löscher W, Michel P, Kenda B, Klitgaard H | title = Profile of the new pyrrolidone derivative seletracetam (ucb 44212) in animal models of epilepsy | journal = European Journal of Pharmacology | volume = 614 | issue = 1–3 | pages = 30–37 | date = July 2009 | pmid = 19383493 | doi = 10.1016/j.ejphar.2009.04.024 }}</ref><ref name=Bialer /><ref name=Lynch /> |
|
|
|
|
|
In addition, studies of ion currents have shown that seletracetam significantly decreases the amount of high-voltage derived ] currents<ref name=Martella>{{cite journal | vauthors = Martella G, Bonsi P, Sciamanna G, Platania P, Madeo G, Tassone A, Cuomo D, Pisani A | display-authors = 6 | title = Seletracetam (ucb 44212) inhibits high-voltage-activated Ca2+ currents and intracellular Ca2+ increase in rat cortical neurons in vitro | journal = Epilepsia | volume = 50 | issue = 4 | pages = 702–710 | date = April 2009 | pmid = 19055493 | doi = 10.1111/j.1528-1167.2008.01915.x | s2cid = 9067249 | doi-access = free }}</ref> which have been implicated in causing the high intracellular ] influx during ] activity.<ref name=Pisani2004>{{cite journal | vauthors = Pisani A, Bonsi P, Martella G, De Persis C, Costa C, Pisani F, Bernardi G, Calabresi P | display-authors = 6 | title = Intracellular calcium increase in epileptiform activity: modulation by levetiracetam and lamotrigine | journal = Epilepsia | volume = 45 | issue = 7 | pages = 719–728 | date = July 2004 | pmid = 15230693 | doi = 10.1111/j.0013-9580.2004.02204.x | s2cid = 31781002 | doi-access = free }}</ref> It is thought that seletracetam binds to ] and inhibits their ability to allow calcium ions to enter the cell,<ref name=Martella /><ref name=Pisani2004 /> although the drug does not bind to ] that mediate low-voltage activated Ca<sup>2+</sup> currents.<ref name="Bennett" /><ref name=Luszcki /> Seletracetam thereby decreases cellular excitation, but it does not seem to affect voltage-gated ] or ] currents.<ref name=Martella /> Selectracetam has been demonstrated to not significantly affect currents gated by ], ], ], ], or ].<ref name=Rigo>{{cite journal| vauthors = Faria LC, Silva AC, Priel MR, Naffah-Mazzacoratti MD, Mody I, Cavalheiro EA | title=Seletracetam (ucb 44212): effect on inhibitory and excitatory neurotransmission| journal=Epilepsia| year=2005| volume=46|issue=Suppl. 8|page=110|doi=10.1111/j.1528-1167.2005.460801_14.x|s2cid=221732819|doi-access=free}}</ref> |
|
|
|
|
|
The dual effect of seletracetam is an overall decrease in the amount of ] influx in the cell during an ] due to binding at ], which prevents over-excitation of the ], as well as a decrease in ] release as a product of cellular excitation due to the interaction of the drug with ], which reduces the spread of excitation to nearby cells.<ref name=Custer>{{cite journal | vauthors = Custer KL, Austin NS, Sullivan JM, Bajjalieh SM | title = Synaptic vesicle protein 2 enhances release probability at quiescent synapses | journal = The Journal of Neuroscience | volume = 26 | issue = 4 | pages = 1303–1313 | date = January 2006 | pmid = 16436618 | pmc = 6674579 | doi = 10.1523/JNEUROSCI.2699-05.2006 | doi-access = free }}</ref> |
|
|
|
|
|
Compared to ], which binds at the same site,<ref name=Bialer>{{cite journal | vauthors = Bialer M, Johannessen SI, Kupferberg HJ, Levy RH, Perucca E, Tomson T | title = Progress report on new antiepileptic drugs: a summary of the Eighth Eilat Conference (EILAT VIII) | journal = Epilepsy Research | volume = 73 | issue = 1 | pages = 1–52 | date = January 2007 | pmid = 17158031 | doi = 10.1016/j.eplepsyres.2006.10.008 | s2cid = 45026113 }}</ref> seletracetam binds to ] with ten times higher affinity.<ref name=Matagne /><ref name=Lynch>{{cite journal | vauthors = Lynch BA, Lambeng N, Nocka K, Kensel-Hammes P, Bajjalieh SM, Matagne A, Fuks B | title = The synaptic vesicle protein SV2A is the binding site for the antiepileptic drug levetiracetam | journal = Proceedings of the National Academy of Sciences of the United States of America | volume = 101 | issue = 26 | pages = 9861–9866 | date = June 2004 | pmid = 15210974 | pmc = 470764 | doi = 10.1073/pnas.0308208101 | doi-access = free | bibcode = 2004PNAS..101.9861L }}</ref> |
|
|
|
|
|
The nature of why the seletracetam molecule binds so specifically to SV2A and how SV2A affects exocytosis is unclear.<ref>{{cite journal | vauthors = Pollard JR, French J | title = Antiepileptic drugs in development | journal = The Lancet. Neurology | volume = 5 | issue = 12 | pages = 1064–1067 | date = December 2006 | pmid = 17110287 | doi = 10.1016/S1474-4422(06)70627-5 | s2cid = 22569327 }}</ref> |
|
|
|
|
|
==Pharmacokinetics== |
|
|
The oral ] of seletracetam is >90%<ref name="Bennett" /> and its ] is approximately 8 hours.<ref name=Malykh /><ref name="Bennett" /> 25% of ingested seletracetam is metabolized and excreted unchanged and about 53% is excreted in the form of an inactive ] metabolite.<ref name=Bialer /><ref name=Luszcki /> The main metabolic mechanism is the hydrolysis of an ] to a ].<ref name=Luszcki /><ref name=Strolin>{{cite journal | vauthors = Strolin Benedetti M, Whomsley R, Nicolas JM, Young C, Baltes E | title = Pharmacokinetics and metabolism of 14C-levetiracetam, a new antiepileptic agent, in healthy volunteers | journal = European Journal of Clinical Pharmacology | volume = 59 | issue = 8–9 | pages = 621–630 | date = November 2003 | pmid = 14530892 | doi = 10.1007/s00228-003-0655-6 | s2cid = 25017909 }}</ref> |
|
|
|
|
|
Seletracetam exhibits ] mono-compartmental ], in which there is a simple linear relationship between the amount of drug that was administered, the time that has passed, and the amount of drug subsequently remaining in the body.<ref name="Bennett" /> This contrasts the nonlinear pharmacokinetics typical of previously available ] such as ], phenytolin, ] and ].<ref name="Bennett" /> The benefit of linear kinetics is that the steady-state concentration of the drug is directly and reliably related to the dose of the drug that is administered; this allows for simple and reliable dose adjustments. |
|
|
|
|
|
==''In vitro'' studies== |
|
|
''In vitro'' studies performed in rodent hippocampal slices found that seletracetam causes a complete reversal of the increases in activity of ] ] in epilepsy models.<ref name =Matagne/> These reductions in ''in vitro'' epilepsy symptoms were present at ] concentrations of 3.2 μM.<ref name =Matagne/> This is approximately 10% of the most effective concentration of ] in similar tests.<ref>{{cite journal | vauthors = Margineanu DG, Klitgaard H | title = Inhibition of neuronal hypersynchrony in vitro differentiates levetiracetam from classical antiepileptic drugs | journal = Pharmacological Research | volume = 42 | issue = 4 | pages = 281–285 | date = October 2000 | pmid = 10987984 | doi = 10.1006/phrs.2000.0689 }}</ref> |
|
|
|
|
|
==Animal studies== |
|
|
Seletracetam has been tested on various ] for epilepsy, with mixed results. |
|
|
|
|
|
Unlike drugs that act on ]s,<ref name="pmid16621450">{{cite journal | vauthors = Rogawski MA | title = Diverse mechanisms of antiepileptic drugs in the development pipeline | journal = Epilepsy Research | volume = 69 | issue = 3 | pages = 273–294 | date = June 2006 | pmid = 16621450 | pmc = 1562526 | doi = 10.1016/j.eplepsyres.2006.02.004 }}</ref> seletracetam was demonstrated to have no significant effect on the maximal electroshock seizure test results in mice.<ref name =Matagne/> It similarly had no relieving effects in mice of the other most common acute seizure model, the ] convulsion-induction model.<ref name="Bennett" /><ref name =Matagne/><ref name=Luszcki /> |
|
|
|
|
|
Seletracetam did, however, show promising results in acquired and genetic epilepsy models.<ref name="Bennett" /><ref name =Matagne/> In the mouse model of corneal kindling, which exhibits the anticonvulsant capability of generalized motor seizures, doses as low as 0.07 mg/kg ] (i.p.), and ] of 0.31 mg/kg i.p. were effective.<ref name =Matagne/> Occurrence of audiogenic seizures—those induced by white noise—in mice were also significantly reduced by an ] of 0.17 mg/kg i.p., which suggests that selectracetam reduces convulsions caused by ].<ref name =Matagne/> |
|
|
|
|
|
In hippocampal ] rats, seizure severity was significantly reduced by seletracetam oral doses of 0.23 mg/kg. This provides further evidence of the potential benefits of selectracetam on generalized motor seizures.<ref name =Matagne/> Seletracetam also performed well as a method to reduce the suppression of spontaneous spike-and-wave discharges that are often associated with ] activity.<ref name=Hughes>{{cite journal | vauthors = Hughes JR | title = Absence seizures: a review of recent reports with new concepts | journal = Epilepsy & Behavior | volume = 15 | issue = 4 | pages = 404–412 | date = August 2009 | pmid = 19632158 | doi = 10.1016/j.yebeh.2009.06.007 | s2cid = 22023692 }}</ref> This was demonstrated by its effect on Strasbourg genetic absence epilepsy rats (GAERS).<ref>{{cite conference |vauthors = Marescaux C, Vergnes M, Depaulis A |title=Genetic absence epilepsy in rats from Strasbourg — A review |veditors=Marescaux C, Vergnes M, Bernasconi R |book-title=Generalized Non-Convulsive Epilepsy: Focus on GABA-B Receptors |year=1992 |pages=37–69 |doi=10.1007/978-3-7091-9206-1_4 |isbn=978-3-211-82340-8}}</ref> This model had an ] of 0.15 mg/kg i.p.<ref name =Matagne/> |
|
|
|
|
|
Rodents were found to have negligible behavioral deficits as a result of seletracetam administration, as measured by performance on a ] task.<ref name=Matagne/><ref>{{cite journal | vauthors = Stefan H, Steinhoff BJ | title = Emerging drugs for epilepsy and other treatment options | journal = European Journal of Neurology | volume = 14 | issue = 10 | pages = 1154–1161 | date = October 2007 | pmid = 17880570 | doi = 10.1111/j.1468-1331.2007.01706.x | s2cid = 41155699 }}</ref> |
|
|
|
|
|
==Adverse effects and tolerance== |
|
|
Unlike currently prescribed ] such as phenytoin, ], and ], seletracetam shows few ] (CNS) side effects and is predicted to have low levels of drug-drug interactions due to its low binding (<10%) to plasma proteins.<ref name="Bennett" /><ref name = "Brodie">{{cite journal | vauthors = Brodie MJ | title = Do we need any more new antiepileptic drugs? | journal = Epilepsy Research | volume = 45 | issue = 1–3 | pages = 3–6 | date = May 2001 | pmid = 11461782 | doi = 10.1016/S0920-1211(01)00203-0 | s2cid = 37908949 }}</ref> There have been, however, no formal studies conducted on drug-drug interactions with seletracetam.<ref name=Bialer /> |
|
|
|
|
|
Other than ] and the high-voltage-activated Ca<sup>2+</sup> channels, seletracetam does not significantly bind to other CNS receptors, ion channels, or uptake mechanisms.<ref name=Bialer /> Seletracetam has, however, shown a slight selectivity for glycine receptors.<ref name=Bialer /><ref name=Luszcki>{{cite journal | vauthors = Luszczki JJ | title = Third-generation antiepileptic drugs: mechanisms of action, pharmacokinetics and interactions | journal = Pharmacological Reports | volume = 61 | issue = 2 | pages = 197–216 | date = Mar–Apr 2009 | pmid = 19443931 | doi = 10.1016/s1734-1140(09)70024-6 | s2cid = 72918370 }}</ref><ref name=Bialer2004>{{cite journal | vauthors = Bialer M, Johannessen SI, Kupferberg HJ, Levy RH, Perucca E, Tomson T | title = Progress report on new antiepileptic drugs: a summary of the Seventh Eilat Conference (EILAT VII) | journal = Epilepsy Research | volume = 61 | issue = 1–3 | pages = 1–48 | date = Sep–Oct 2004 | pmid = 15570674 | doi = 10.1016/j.eplepsyres.2004.07.010 | s2cid = 1154454 }}</ref> This drug neither inhibits nor unnecessarily induces the action of any major human metabolizing enzymes, which further reduces adverse effects.<ref name=Brodie /> |
|
|
|
|
|
Early data from phase I trials were optimistic, and found seletracetam to be well tolerated by human volunteers.<ref>{{cite journal|vauthors=Leese PT, Goldwater DR, Hulhoven R, Salas E, Toublanc N, Chen D, Sargentini-Maier ML, Stockis A|display-authors=6|title=Seletracetam (UCB 44212): Single and Multiple Rising Dose Safety, Tolerability and Pharmacokinetics in Healthy Subjects|journal=American Epilepsy Society Abstracts|year=2006|pages=2.131|url=http://www.aesnet.org/go/publications/aes-abstracts/abstract-search/mode/display/st/leese/sy/2006/sb/All/id/6570|access-date=2012-05-15|archive-date=2013-10-29|archive-url=https://web.archive.org/web/20131029190516/http://www.aesnet.org/go/publications/aes-abstracts/abstract-search/mode/display/st/leese/sy/2006/sb/All/id/6570|url-status=dead}}</ref> |
|
|
|
|
|
In phase II trials side effects were limited to the CNS in origin, were of mild to moderate severity, and most were resolved within 24 hours<ref name="Bennett" /> and with no medical intervention.<ref name=Bialer /> The most frequently reported adverse effects of seletracetam were dizziness, feeling drunk, euphoria, nausea, and ].<ref name=Bialer /> |
|
|
|
|
|
Seletracetam was well tolerated by healthy individuals after single oral doses ranging from 2 to 600 mg, as well as after b.i.d. (twice daily) doses of 200 mg.<ref name=Bialer /> ] studies have shown that this drug has low acute oral toxicity and no significant negative effects on the CNS, cardiac, or respiratory systems.<ref name=Bialer /> High doses of 2000 mg/kg per day (in mice and rats) and greater than 600 mg/kg per day (in dogs) were poorly tolerated.<ref name=Bialer /> |
|
|
|
|
|
==FDA approval status== |
|
|
Phase II ] of seletracetam were ongoing but in July 2007 the company stated that the drug's development has been put on hold.<ref name=Pollard /> Although the conducted Phase II trials showed success, it was less than expected given the performance of seletracetam in animal models.<ref name=Malykh /> There have been no known Phase IIb or Phase III ].<ref name=Pollard /> |
|
|
|
|
|
In 2010, development of seletracetam was halted in favor of the development of ], a newer variation of the drug.<ref name=Malykh /> |
|
|
|
|
|
== References == |
|
|
{{Reflist|33em}} |
|
|
|
|
|
{{Racetams}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |