Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Sepiapterin: Difference between pages - Misplaced Pages

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 13:58, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 456908937 of page Sepiapterin for the Chem/Drugbox validation project (updated: 'ChEMBL', 'CASNo').  Latest revision as of 02:03, 23 December 2024 edit Whywhenwhohow (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers49,181 edits templates 
Line 1: Line 1:
{{Short description|Medication}}
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
{{Use dmy dates|date=December 2024}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{chembox {{chembox
| Verifiedfields = changed | Verifiedfields = changed
| verifiedrevid = 409177403 | verifiedrevid = 464389189
|Name=<small>L</small>-Sepiapterin | Name={{sm|l}}-Sepiapterin
|ImageFile=Sepiapterin.png | ImageFile=Sepiapterin.png
|ImageSize=200px | ImageSize=200px
|IUPACName=2-amino-6--7,8-dihydro-1''H''-pteridin-4-one | IUPACName=2-amino-6--7,8-dihydro-1''H''-pteridin-4-one
|OtherNames= | OtherNames=
|Section1={{Chembox Identifiers |Section1={{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 58746 | ChemSpiderID = 58746
| KEGG_Ref = {{keggcite|correct|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = C00835 | KEGG = C00835
| ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = <!-- blanked - oldvalue: 1255653 --> | ChEMBL = 1255653
| InChI = 1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,15H,2H2,1H3,(H4,10,11,13,14,17)/t3-/m0/s1 | InChI = 1/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3,15H,2H2,1H3,(H4,10,11,13,14,17)/t3-/m0/s1
| InChIKey = VPVOXUSPXFPWBN-VKHMYHEABT | InChIKey = VPVOXUSPXFPWBN-VKHMYHEABT
Line 21: Line 23:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = VPVOXUSPXFPWBN-VKHMYHEASA-N | StdInChIKey = VPVOXUSPXFPWBN-VKHMYHEASA-N
| CASNo_Ref = {{cascite|correct|??}} | CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = <!-- blanked - oldvalue: 17094-01-8 --> | CASNo=17094-01-8
| UNII_Ref = {{fdacite|correct|FDA}}
| PubChem=65253
| UNII = CJQ26KO7HP
| SMILES = O=C1\N=C(/NC=2NCC(=N/C1=2)\C(=O)(O)C)N
| PubChem=65253
| SMILES = O=C1\N=C(/NC=2NCC(=N/C1=2)\C(=O)(O)C)N
}} }}
|Section2={{Chembox Properties |Section2={{Chembox Properties
| Formula=C<sub>9</sub>H<sub>11</sub>N<sub>5</sub>O<sub>3</sub> | Formula=C<sub>9</sub>H<sub>11</sub>N<sub>5</sub>O<sub>3</sub>
| MolarMass=237.22 g/mol | MolarMass=237.22 g/mol
| Appearance= | Appearance=
| Density= | Density=
| MeltingPt= | MeltingPt=
| BoilingPt= | BoilingPt=
| Solubility= | Solubility=
}} }}
|Section3={{Chembox Hazards |Section3={{Chembox Hazards
| MainHazards= | MainHazards=
| FlashPt= | FlashPt=
| AutoignitionPt =
| Autoignition=
}} }}
| Section6 = {{Chembox Pharmacology
| Pharmacology_ref =
| ATCCode_prefix = None <!-- Scheduled to be A16AX28 in 2026 -->
| ATCCode_suffix =
| ATC_Supplemental =
| ATCvet =
| Licence_EU =
| INN =
| INN_EMA =
| Licence_US =
| Legal_status =
| Legal_AU =
| Legal_AU_comment =
| Legal_CA =
| Legal_CA_comment =
| Legal_NZ =
| Legal_NZ_comment =
| Legal_UK =
| Legal_UK_comment =
| Legal_US =
| Legal_US_comment =
| Legal_EU =
| Legal_EU_comment =
| Legal_UN =
| Legal_UN_comment =
| Pregnancy_category =
| Pregnancy_AU =
| Pregnancy_AU_comment =
| Dependence_liability =
| AdminRoutes =
| Bioavail =
| ProteinBound =
| Metabolism =
| Metabolites =
| OnsetOfAction =
| HalfLife =
| DurationOfAction =
| Excretion =
}}
}} }}

'''Sepiapterin''', also known as 2-amino-6--7,8-dihydro-1''H''-pteridin-4-one, is a member of the ] class of organic chemicals.

Sepiapterin can be metabolized into ] via a ]. Tetrahydrobiopterin is an essential ] in humans for breakdown of phenylalanine and a catalyst of the metabolism of phenylalanine, tyrosine, and tryptophan to precursors of the ]s ] and ].

] can cause toxic buildup of ] (]) as well as deficiencies of ], ], and ], leading to ] and other neurological illnesses. This has led to clinical study of sepiapterin in humans to treat tetrahydrobiopterin deficiency.<ref name="Smith">{{cite journal |last1=Smith |first1=Neil |last2=Longo |first2=Nicola |last3=Levert |first3=Keith |last4=Hyland |first4=Keith |last5=Blau |first5=Nenad |title=Phase I clinical evaluation of CNSA-001 (sepiapterin), a novel pharmacological treatment for phenylketonuria and tetrahydrobiopterin deficiencies, in healthy volunteers |journal=Molecular Genetics and Metabolism |date=1 April 2019 |volume=126 |issue=4 |pages=406–412 |doi=10.1016/j.ymgme.2019.02.001 |pmid=30922814 |s2cid=85564348 |issn=1096-7192}}</ref>

Since ] and other circulatory diseases associated with ] are also associated with tetrahydrobiopterin deficiency, animal studies of the value of sepiaterin in these vascular diseases have been done. These studies show that relaxation of the blood vessels studied was impaired after animals were given sepiapterin, even though their levels of tetrahydrobiopterin were replenished.<ref name="Vasquez-Vivar">{{cite journal |last1=Vasquez-Vivar |first1=Jeannette |last2=Duquiane |first2=Damon |last3=Whitsett |first3=Jennifer |last4=Kalyanaraman |first4=B. |last5=Rajagopalan |first5=Sanjay |title=Altered Tetrahydrobiopterin Metabolism in Atherosclerosis |journal=Arteriosclerosis, Thrombosis, and Vascular Biology |date=1 October 2002 |volume=22 |issue=10 |pages=1655–1661 |doi=10.1161/01.ATV.0000029122.79665.D9 |pmid=12377745 |doi-access=free }}</ref>

==References==
{{Reflist}}

{{Other alimentary tract and metabolism products}}
{{Portal bar | Medicine}}
{{Authority control}}

]
]
]
]


{{ketone-stub}}