(Difference between pages)

Page 1

Page 1Revision 1

Page 2

Page 2Revision 2

Content deleted Content addedVisualWikitext

Revision as of 14:09, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 458612487 of page Silicon_sulfide for the Chem/Drugbox validation project (updated: 'CASNo').		Latest revision as of 09:05, 25 November 2024 edit Zephiramine (talk | contribs)6 edits →Synthesis, structure, and properties
Line 1:		Line 1:
	{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}}
	{{chembox		{{chembox
			| Verifiedfields = changed
⚫	| verifiedrevid = 440983266
			| Watchedfields = changed
		⚫	| verifiedrevid = 464390444
	| ImageFile1 = SiS2typeSilica.png		| ImageFile1 = SiS2typeSilica.png
	| ImageSize1 = 200px		| ImageSize1 = 300px
	| ImageFile2 = SiS2.png		| ImageFile2 = SiS2-chain-from-Ibam-xtal-2015-3D-balls.png
	| ImageSize2 = 300px		| ImageSize2 = 300px
			| ImageFile3 = SiS2.png
			| ImageSize3 = 300px
	| IUPACName = silicon(IV) sulfide		| IUPACName = silicon(IV) sulfide
	| SystematicName =		| SystematicName =
	| OtherNames = silicon disulfide		| OtherNames = silicon disulfide
	| Section1 = {{Chembox Identifiers		|Section1={{Chembox Identifiers
	| Abbreviations =		| Abbreviations =
	| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}		| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 19:		Line 22:
	| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}		| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
	| StdInChIKey = KHDSWONFYIAAPE-UHFFFAOYSA-N		| StdInChIKey = KHDSWONFYIAAPE-UHFFFAOYSA-N
	| CASNo_Ref = {{cascite|correct|??}}		| CASNo_Ref = {{cascite|correct|CAS}}
	| CASNo = <!-- blanked - oldvalue: 13759-10-9 -->		| CASNo = 13759-10-9
			| UNII_Ref = {{fdacite|correct|FDA}}
			| UNII = 35Y5PHW16K
	| EINECS =		| EINECS =
	| EINECSCASNO =
	| PubChem = 83705		| PubChem = 83705
	| SMILES = S==S		| SMILES = S==S
			| SMILES_Comment = monomer
	| InChI =
			| SMILES1 = S=(S0)S0(S0)S0(S0)S0(S0)S0(S0)S0(S0)S0=S
			| SMILES1_Comment = polymer
	| RTECS =		| RTECS =
	| MeSHName =		| MeSHName =
Line 32:		Line 38:
	| KEGG_Ref = {{keggcite|correct|kegg}}		| KEGG_Ref = {{keggcite|correct|kegg}}
	| KEGG =		| KEGG =
			}}
	| ATCCode_prefix =
		⚫	|Section2={{Chembox Properties
	| ATCCode_suffix =
	| ATC_Supplemental =}}
⚫	| Section2 = {{Chembox Properties
	| Formula = SiS<sub>2</sub>		| Formula = SiS<sub>2</sub>
	| MolarMass = 92.218 g/mol		| MolarMass = 92.218 g/mol
	| Appearance = white (samples are sometimes grey or brown) needles<br/>rotten egg smell in moist air		| Appearance = White (samples are sometimes grey or brown) needles.<br/>Rotten egg smell in moist air.
	| Density = 1.853 g/cm<sup>3</sup>		| Density = 1.853 g/cm<sup>3</sup>
	| MeltingPt = 1090 °C		| MeltingPtC = 1090
	| Melting_notes = sublimes		| MeltingPt_notes = sublimes
	| BoilingPt =		| BoilingPtC =
	| Boiling_notes =		| BoilingPt_notes =
	| Solubility = decomposes		| Solubility = Decomposes
	| SolubleOther =		| SolubleOther =
	| Solvent =		| Solvent =
Line 52:		Line 56:
	| AtmosphericOHRateConstant =		| AtmosphericOHRateConstant =
	| pKa =		| pKa =
	| pKb = }}		| pKb =
			}}
	| Section3 = {{Chembox Structure		|Section3={{Chembox Structure
	| Coordination = ]		| Coordination = ]
	| CrystalStruct = ], ]		| CrystalStruct = ], ]
	| SpaceGroup = Ibam, No.72<ref>{{cite journal|journal=Zeitschrift fuer Anorganische und Allgemeine Chemie|year=1954 |volume=276|pages=95–112|title=Zur Kenntnis der faserigen Siliciumdioxyd-Modifikation|author=Weiss A.|doi=10.1002/zaac.19542760110}}</ref>		| SpaceGroup = Ibam, No.72<ref>{{cite journal |author1=Weiss, A. |author2=Weiss, A. | title = Über Siliciumchalkogenide. VI. Zur Kenntnis der faserigen Siliciumdioxyd-Modifikation | journal = Zeitschrift für Anorganische und Allgemeine Chemie | year = 1954 | volume = 276 | issue = 1–2 | pages = 95–112 | doi = 10.1002/zaac.19542760110 }}</ref>
	}}		}}
	| Section4 = {{Chembox Thermochemistry		|Section4={{Chembox Thermochemistry
	| DeltaHf =		| DeltaHf =
	| DeltaHc =		| DeltaHc =
	| Entropy =		| Entropy =
	| HeatCapacity = }}		| HeatCapacity =
			}}
	| Section5 = {{Chembox Pharmacology		|Section5={{Chembox Pharmacology
	| AdminRoutes =		| AdminRoutes =
	| Bioavail =		| Bioavail =
Line 75:		Line 81:
	| Legal_AU =		| Legal_AU =
	| Legal_CA =		| Legal_CA =
	| PregCat =		| Pregnancy_category =
	| PregCat_AU =		| Pregnancy_AU =
	| PregCat_US = }}		| Pregnancy_US =
			}}
	| Section6 = {{Chembox Explosive		|Section6={{Chembox Explosive
	| ShockSens =		| ShockSens =
	| FrictionSens =		| FrictionSens =
	| ExplosiveV =		| DetonationV =
	| REFactor = }}		| REFactor =
			}}
	| Section7 = {{Chembox Hazards		|Section7={{Chembox Hazards
	| EUClass =
	| EUIndex =
	| MainHazards =		| MainHazards =
	| NFPA-H = 2		| NFPA-H = 2
	| NFPA-F = 2		| NFPA-F = 2
	| NFPA-R = 3		| NFPA-R = 3
	| NFPA-O =		| NFPA-S =
	| RPhrases =		| HPhrases =
	| SPhrases =		| PPhrases =
	| RSPhrases =		| GHS_ref =
	| FlashPt =		| FlashPt =
	| Autoignition =		| AutoignitionPt =
	| ExploLimits =		| ExploLimits =
	| LD50 =		| LD50 =
	| PEL = }}		| PEL =
			}}
	| Section8 = {{Chembox Related		|Section8={{Chembox Related
	| OtherAnions = ]		| OtherAnions = ]
	| OtherCations = ]<br/>]<br/>]<br/>]		| OtherCations = ]<br/>]<br/>]<br/>]
	| OtherFunctn =		| OtherFunction =
	| Function =		| OtherFunction_label =
	| OtherCpds = }}		| OtherCompounds =
			}}
	}}		}}
			'''Silicon disulfide''' is the ] with the formula ]]. Like ], this material is ]ic, but it adopts a 1-dimensional structure quite different from the usual ] of SiO<sub>2</sub>.
			==Synthesis, structure, and properties==
			The material is formed by heating silicon and sulfur or by the exchange reaction between ] and ]. The material consists of chains of edge-shared ], -Si(μ-S)<sub>2</sub>Si(μ-S)<sub>2</sub>-.<ref>{{ cite book |author1=Holleman, A. F. |author2=Wiberg, E. | title = Inorganic Chemistry | publisher = Academic Press | location = San Diego | year = 2001 | isbn = 0-12-352651-5 }} A printing error in this book states that r<sub>SiSi</sub> is 214 ]s, when in fact that distance describes r<sub>SiS</sub>.</ref>
			Like other silicon sulfur-compounds (e.g., ]) SiS<sub>2</sub> hydrolyzes readily to release H<sub>2</sub>S.
			In liquid ] it is reported to form the imide Si(NH)<sub>2</sub> and NH<sub>4</sub>SH,<ref name="Greenwood">{{Greenwood&Earnshaw1st| pages =359}}</ref> but a recent report has identified crystalline (NH<sub>4</sub>)<sub>2</sub>·2NH<sub>3</sub> as a product which contains the tetrahedral thiosilicate anion, SiS<sub>3</sub>(NH<sub>3</sub>)<sup>2-</sup>.<ref name="MeierKorber2009">{{cite journal| last1 =Meier| first1 =Martin| last2 =Korber| first2 =Nikolaus| title =The first thiosilicate from solution: synthesis and crystal structure of (NH4)2·2NH3| journal =Dalton Transactions| issue =9| year =2009| pages =1506–1508| issn =1477-9226| doi =10.1039/b818856d| pmid =19421590}}</ref>
			Reaction with ethanol gives the ] ] and H<sub>2</sub>S.<ref name="Greenwood"/> With bulky tert-butanol, alcoholysis gives ]:<ref>{{cite journal|author=R. Piękoś, W. Wojnowski|title=Untersuchungen über die Alkoholyse des SiS2. II. Darstellung von Trialkoxysilanthiolen und Tetraalkoxycyclodisilthianen aus den tertiären Alkoholen|journal=Z. Anorg. Allg. Chem.|volume=318|year=1962|issue=3–4 |pages=212–216|doi=10.1002/zaac.19623180310}}</ref>
			:3 (CH<sub>3</sub>)<sub>3</sub>COH + SiS<sub>2</sub> → <sub>3</sub>SiSH + H<sub>2</sub>S
			Reaction with ], ] and ] give ]s.<ref name="Greenwood"/>
			SiS<sub>2</sub> is claimed to occur in certain interstellar objects.<ref>{{ cite journal | author = Goebel, J. H. | title = SiS<sub>2</sub> in Circumstellar Shells | journal = Astronomy and Astrophysics | year = 1993 | volume = 278 | issue = 1 | pages = 226–230 | bibcode = 1993A&A...278..226G | url = http://articles.adsabs.harvard.edu/cgi-bin/nph-iarticle_query?1993A%26A...278..226G&amp;data_type=PDF_HIGH&amp;whole_paper=YES&amp;type=PRINTER&amp;filetype=.pdf }}</ref>
			==References==
			{{reflist}}
			{{silicon compounds}}
			{{Sulfides}}
			]
			]
			]
			]
			{{Inorganic-compound-stub}}