| Revision as of 08:07, 19 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 09:29, 13 November 2024 edit undoCbare (talk | contribs)104 editsm Add DrugBank accession |
| (32 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{one source|date=October 2014}} |
| ⚫ |
| IUPAC_name = α-aspartyl-''O''-sulfotyrosylmethionylglycyltryptophylmethionyl-α-aspartylphenylalaninamide |
|
|
|
{{Drugbox |
| ⚫ |
| image = Sincalide.svg |
|
|
|
| Verifiedfields = changed |
| ⚫ |
| CAS_number = 25126-32-3 |
|
|
|
| Watchedfields = changed |
| ⚫ |
| ATC_prefix = V04 |
|
|
|
| verifiedrevid = 408748961 |
| ⚫ |
| ATC_suffix = CC03 |
|
|
⚫ |
| IUPAC_name = α-aspartyl-''O''-sulfotyrosylmethionylglycyltryptophylmethionyl-α-aspartylphenylalaninamide |
| ⚫ |
| PubChem = 32800 |
|
|
⚫ |
| image = Sincalide.svg |
| ⚫ |
| DrugBank = |
|
|
|
|
| ⚫ |
| KEGG = D05845 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| C=49|H=62|N=10|O=16|S=3 |
|
|
|
| tradename = |
|
| molecular_weight = 1143.27 g/mol |
|
|
|
| Drugs.com = {{drugs.com|CONS|sincalide}} |
| ⚫ |
| synonyms = <small>1-De(5-oxo-L-proline)-2-de-L-glutamine-<br>5-L-methioninecaerulein, <nowiki>3--3-(4-sulfooxyphenyl)propanoyl]amino]-4-<br>methylsulfanyl-butanoyl]amino]acetyl]amino]-3-<br>(1''H''-indol-3-yl)propanoyl]amino]-4-methylsulfanyl-<br>butanoyl]amino]-3-propanoic acid</small> |
|
|
|
| pregnancy_AU = <!-- A, B1, B2, B3, C, D, X --> |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| pregnancy_US = B |
|
⚫ |
| pregnancy_category = |
| ⚫ |
| metabolism = |
|
|
⚫ |
| legal_AU = <!-- Unscheduled, S2, S3, S4, S5, S6, S7, S8, S9 --> |
| ⚫ |
| elimination_half-life = |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
| ⚫ |
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_UK_comment = Available on a named-patient basis <!-- GSL, P, POM, CD, Class A, B, C --> |
|
⚫ |
| legal_US = Rx-only |
|
| pregnancy_US = B |
|
|
|
| legal_status = |
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = Rx-only |
|
|
| legal_status = Available on a named-patient basis <small>(])</small> |
|
|
| routes_of_administration = ] |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 25126-32-3 |
|
⚫ |
| ATC_prefix = V04 |
|
⚫ |
| ATC_suffix = CC03 |
|
⚫ |
| PubChem = 32800 |
|
|
| IUPHAR_ligand = 864 |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = DB09142 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = M03GIQ7Z6P |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D05845 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 1121 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8009168 |
|
|
|
|
|
|
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=49 | H=62 | N=10 | O=16 | S=3 |
|
⚫ |
| synonyms = <small>1-De(5-oxo-L-proline)-2-de-L-glutamine-<br>5-L-methioninecaerulein, <nowiki>3--3-(4-sulfooxyphenyl)propanoyl]amino]-4-<br>methylsulfanyl-butanoyl]amino]acetyl]amino]-3-<br>(1''H''-indol-3-yl)propanoyl]amino]-4-methylsulfanyl-<br>butanoyl]amino]-3-propanoic acid</small> |
|
|
| smiles = CSCC(C(=O)NCC(=O)N(CC1=CNC2=CC=CC=C21)C(=O)N(CCSC)C(=O)N(CC(=O)O)C(=O)N(CC3=CC=CC=C3)C(=O)N)NC(=O)(CC4=CC=C(C=C4)OS(=O)(=O)O)NC(=O)(CC(=O)O)N |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C49H62N10O16S3/c1-76-18-16-34(55-47(69)37(58-44(66)32(50)23-41(61)62)21-28-12-14-30(15-13-28)75-78(72,73)74)45(67)53-26-40(60)54-38(22-29-25-52-33-11-7-6-10-31(29)33)48(70)56-35(17-19-77-2)46(68)59-39(24-42(63)64)49(71)57-36(43(51)65)20-27-8-4-3-5-9-27/h3-15,25,32,34-39,52H,16-24,26,50H2,1-2H3,(H2,51,65)(H,53,67)(H,54,60)(H,55,69)(H,56,70)(H,57,71)(H,58,66)(H,59,68)(H,61,62)(H,63,64)(H,72,73,74)/t32-,34-,35-,36-,37-,38-,39-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IZTQOLKUZKXIRV-YRVFCXMDSA-N |
|
}} |
|
}} |
|
'''Sincalide''' (]) is a ] drug administered by ] to aid in diagnosing disorders of the gallbladder and pancreas. It is the 8-amino acid ] fragment of ], and also known as '''CCK-8'''. |
|
'''Sincalide''' (]) is a ] drug administered by ] to aid in diagnosing disorders of the ] and ]. It is the 8-amino acid ] fragment of ], and also known as '''CCK-8'''. |
|
|
|
|
|
Common adverse effects following administration include abdominal discomfort and nausea. These effects are more pronounced following rapid infusion. |
|
Common adverse effects following administration include abdominal discomfort and nausea. These effects are more pronounced following rapid infusion. |
|
|
|
|
|
==Clinical Use== |
|
|
|
|
|
===Indications=== |
|
|
Sincalide may be used to stimulate ] contraction, as may be assessed by ] ] or ], or to obtain by duodenal aspiration a sample of concentrated bile for analysis of cholesterol, ]s, phospholipids, and crystals.<ref name="Ziessman_2019">{{cite journal | vauthors = Ziessman HA | title = Sincalide: A Review of Clinical Utility, Proper Infusion Methodology, and Alternative Cholecystogogues | journal = Journal of Nuclear Medicine Technology | volume = 47 | issue = 3 | pages = 210–212 | date = September 2019 | pmid = 31019045 | doi = 10.2967/jnmt.119.226019 | s2cid = 131775567 | doi-access = free }}</ref> It can also be used to stimulate pancreatic secretion (especially in conjunction with ]) prior to obtaining a duodenal aspirate for analysis of enzyme activity, composition, and ]. In some instances it is used to accelerate the transit of a ] through the small bowel, thereby decreasing the time and-extent of radiation associated with ] and x-ray examination of the intestinal tract.<ref>Kinevac Package Insert</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
==External links== |
|
* on NIH.gov |
|
* {{cite web | url = http://dailymed.nlm.nih.gov/dailymed/lookup.cfm?setid=d7f3d501-a389-4fe1-b20a-c9665b3f3d37 | title = KINEVAC (sincalide)] | work = DailyMed | publisher = U.S. National Library of Medicine }} |
|
|
|
|
|
|
|
|
| ⚫ |
{{drug-stub}} |
|
|
{{Diagnostic agents}} |
|
{{Diagnostic agents}} |
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
⚫ |
{{drug-stub}} |