| Revision as of 14:25, 6 December 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 457293128 of page Sivelestat for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 06:39, 2 November 2023 edit Boghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,805 edits consistent citation formatting |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 457292162 |
|
| verifiedrevid = 464392270 |
|
| IUPAC_name = ''N''-{2-phenyl}sulfonyl)amino]benzoyl}glycine |
|
| IUPAC_name = ''N''-<nowiki/>{2-phenyl}sulfonyl)amino]benzoyl}glycine |
|
| image = Sivelestat.png |
|
| image = Sivelestat.svg |
| ⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ⚫ |
| ChEMBL = 76688 |
|
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| Drugs.com = {{drugs.com|international|sivelestat}} |
|
| Drugs.com = {{drugs.com|international|sivelestat}} |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = Not approved |
|
| legal_status = Rx-only |
|
| legal_status = Rx-only |
|
| routes_of_administration = ] |
|
| routes_of_administration = ] |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| IUPHAR_ligand = 6441 |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 127373-66-4 --> |
|
| CAS_number = 127373-66-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = None |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 107706 |
|
| PubChem = 107706 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = DWI62G0P59 |
|
| UNII = DWI62G0P59 |
| Line 43: |
Line 43: |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 96875 |
|
| ChemSpiderID = 96875 |
|
⚫ |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
⚫ |
| ChEMBL = 76688 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=20 | H=22 | N=2 | O=7 | S=1 |
|
| C=20 | H=22 | N=2 | O=7 | S=1 |
|
| molecular_weight = 434.46 g/mol |
|
|
| smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O |
|
| smiles = CC(C)(C)C(=O)OC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(=O)NCC(=O)O |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 54: |
Line 55: |
|
| StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N |
|
| StdInChIKey = BTGNGJJLZOIYID-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Sivelestat''' (], research name '''ONO 5046''', marketed as '''Elaspol''') is an inhibitor of human ].<ref name="pmid2049103">{{cite journal | vauthors = Kawabata K, Suzuki M, Sugitani M, Imaki K, Toda M, Miyamoto T | title = ONO-5046, a novel inhibitor of human neutrophil elastase | journal = Biochemical and Biophysical Research Communications | volume = 177 | issue = 2 | pages = 814–820 | date = June 1991 | pmid = 2049103 | doi = 10.1016/0006-291X(91)91862-7 }}</ref> |
|
|
|
|
|
It is used in the treatment of acute ]<ref name="pmid18592991">{{cite journal | vauthors = Imokawa S, Mori K, Harada M, Sagisaka S, Sano T, Uchiyama H, Yasuda K, Ukita T, Fujisawa T, Suda T, Chida K | display-authors = 6 | title = | language = Japanese | journal = Nihon Kokyuki Gakkai Zasshi = the Journal of the Japanese Respiratory Society | volume = 46 | issue = 6 | pages = 461–465 | date = June 2008 | pmid = 18592991 | name-list-style = vanc }}</ref> and preliminary studies show it may also improve neuropathic pain.<ref>{{cite journal | vauthors = Weyer AD, Stucky CL | title = Repurposing a leukocyte elastase inhibitor for neuropathic pain | journal = Nature Medicine | volume = 21 | issue = 5 | pages = 429–430 | date = May 2015 | pmid = 25951529 | doi = 10.1038/nm.3861 | s2cid = 10240018 }}</ref> |
|
|
|
|
|
==Synthesis== |
|
|
Sivelestat is synthesised as follows:<ref>{{cite patent | country = US | number = 5017610 | title = Derivatives of p-substituted phenyl ester of pivalic acid | inventor = Imaki K, Arai Y, Okegawa T | assign1 = Ono Pharmaceutical Co Ltd | url = https://patents.google.com/patent/US5017610 | gdate = 21 May 1991 }}</ref> |
|
|
|
|
|
] |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{respiratory-system-drug-stub}} |