| Revision as of 15:05, 18 July 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Flavanonol rhamnosides← Previous edit |
Latest revision as of 02:19, 5 December 2021 edit undoRlink2 (talk | contribs)Extended confirmed users309,868 editsm →top: archive link repair, may include: archive.* -> archive.today, and http->https for ghostarchive.org and archive.org (wp:el#Specifying_protocols)Tag: AWB |
| (20 intermediate revisions by 13 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 401004697 |
|
| verifiedrevid = 440130282 |
|
| Name = Smitilbin |
|
| Name = Smitilbin |
|
| ImageFile = Smitilbin.svg |
|
| ImageFile = Smitilbin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 250px |
|
| IUPACName = (2''R'',3''S'')-2-(3,5-dihydroxyphenyl)-5,7-dihydroxy-3-oxy-2,3-dihydrochromen-4-one |
|
| IUPACName = (2''R'',3''S'')-2-(3,5-dihydroxyphenyl)-5,7-dihydroxy-3-oxy-2,3-dihydrochromen-4-one |
|
| OtherNames = Isoastilbin B |
|
| OtherNames = Isoastilbin B |
|
| Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 222846-33-5 |
|
| CASNo = 222846-33-5 |
|
| CASOther = <ref></ref> |
|
| CASNoOther = <ref></ref> |
|
| PubChem = 9889962 |
|
| PubChem = 9889962 |
|
| SMILES = CC1C(C(C(C(O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=CC(=C4)O)O)O)O)OC1C((((O1)OC2C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=CC(=C4)O)O)O)O)O |
|
|
|
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 58539792 |
|
|
| SMILES = Cc1cc(c2c(c1)O((C2=O)O3((((O3)C)O)O)O)c4cc(cc(c4)O)O)C |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C23H26O9/c1-9-4-10(2)16-15(5-9)31-21(12-6-13(24)8-14(25)7-12)22(18(16)27)32-23-20(29)19(28)17(26)11(3)30-23/h4-8,11,17,19-26,28-29H,1-3H3/t11-,17-,19+,20+,21+,22+,23-/m0/s1 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = XIFOLBFVNYGHBL-SZGUTPPVSA-N |
|
|
|
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub> |
|
| Formula = C<sub>21</sub>H<sub>22</sub>O<sub>11</sub> |
|
| MolarMass = 450.39 g/mol |
|
| MolarMass = 450.39 g/mol |
|
⚫ |
| Appearance = |
|
| ExactMass = 450.116212 u |
|
|
|
| Density= |
| ⚫ |
| Appearance = |
|
|
| Density= |
|
| MeltingPt= |
|
| MeltingPt= |
|
| BoilingPt= |
|
⚫ |
| Solubility = |
|
| BoilingPt= |
|
| ⚫ |
| Solubility = |
|
|
}} |
|
}} |
|
|Section3= {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt= |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Smitilbin''' is a ], a type of flavonoid. It is a ] that can be isolated in '']''<ref></ref> (Chinaroot, ]<ref></ref>, ]). |
|
'''Smitilbin''' is a ], a type of flavonoid. It is a ] that can be isolated in '']''<ref></ref> (Chinaroot, sarsaparilla). |
|
|
|
|
|
==Uses== |
|
== Uses == |
|
Smitilbin could be used for preventing ] ] damage.<ref></ref> |
|
Smitilbin could be used for preventing ] ] damage.<ref></ref> |
|
|
|
|
|
==Related compounds== |
|
== Related compounds == |
|
]{{clear-left}} |
|
]{{clear-left}} |
|
Neosmitilbin is a ] of smitilbin. |
|
Neosmitilbin is a ] of smitilbin. |
| Line 46: |
Line 55: |
|
{{Flavanonol}} |
|
{{Flavanonol}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{Aromatic-stub}} |