| Revision as of 09:58, 20 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 473997148 of page Solasodine for the Chem/Drugbox validation project (updated: 'ChEMBL', 'ChEBI', 'KEGG', 'CASNo'). |
Latest revision as of 03:17, 30 August 2024 edit Jokullmusic (talk | contribs)Extended confirmed users1,303 edits Using more neutral language |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 429737371 |
|
| verifiedrevid = 477858890 |
|
| ImageFile = Solasodine.svg |
|
| ImageFile = Solasodine.svg |
|
⚫ |
| IUPACName = (22''R'',25''R'')-Spirosol-5α-en-3β-ol |
|
| ImageSize = 200px |
|
|
|
| SystematicName = (2''S'',2′''R'',4a''R'',4b''S'',5′''R'',6a''S'',6b''R'',7''S'',9a''S'',10a''S'',10b''S'')-4a,5′,6a,7-Tetramethyl-1,2,3,4,4a,4b,5,6,6a,6b,7,9a,10,10a,10b,11-hexadecahydrospiroindenofuran-8,2′-piperidin]-2-ol |
| ⚫ |
| IUPACName = (3β,22α,25''R'')-Spirosol-5-en-3-ol |
|
|
| OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S |
|
| OtherNames = Purapuridine; Solancarpidine; Solanearpidine; Solanidine-S |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| Abbreviations = |
|
| Abbreviations = |
|
| CASNo = <!-- blanked - oldvalue: 126-17-0 --> |
|
| CASNo = 126-17-0 |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| EINECS = 204-774-2 |
|
|
| PubChem = 442985 |
|
| UNII = L40Y453Y96 |
|
⚫ |
| EINECS = 204-774-2 |
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
|
| PubChem = 442985 |
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 391288 |
|
| ChemSpiderID = 391288 |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
| ChEMBL = 518252 |
|
| ChEMBL = 514596 |
|
| SMILES = O6C/C5=C/C1(CC3(1C4O2(NC(C)CC2)(34)C)C)5(C)CC6 |
|
| SMILES = O6C/C5=C/C1(CC3(1C4O2(NC(C)CC2)(34)C)C)5(C)CC6 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
|
| StdInChI=1S/C27H43NO2/c1-16-7-12-27(28-15-16)17(2)24-23(30-27)14-22-20-6-5-18-13-19(29)8-10-25(18,3)21(20)9-11-26(22,24)4/h5,16-17,19-24,28-29H,6-15H2,1-4H3/t16-,17+,19+,20-,21+,22+,23+,24+,25+,26+,27-/m1/s1 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N |
|
| StdInChIKey = KWVISVAMQJWJSZ-VKROHFNGSA-N |
|
| RTECS = |
|
| RTECS = |
|
| MeSHName = |
|
| MeSHName = |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9190 |
|
| ChEBI = <!-- blanked - oldvalue: CHEBI:565242 --> |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG = <!-- blanked - oldvalue: C10822 --> |
|
| KEGG = C10822 |
|
⚫ |
}} |
|
| ATCCode_prefix = |
|
|
|
|Section2={{Chembox Properties |
|
| ATCCode_suffix = |
|
|
⚫ |
| C=27 | H=43 | N=1 | O=2 |
|
| ATC_Supplemental = |
|
|
|
| Appearance = |
|
⚫ |
| Density = |
|
|
| MeltingPt = |
|
|
| MeltingPt_notes = |
|
|
| BoilingPt = |
|
|
| BoilingPt_notes = |
|
|
| Solubility = |
|
|
| SolubleOther = |
|
⚫ |
| Solvent = |
|
⚫ |
| pKa = |
|
⚫ |
| pKb = |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section7={{Chembox Hazards |
|
|
| ExternalSDS = |
| ⚫ |
| C=27|H=43|N=1|O=2 |
|
|
| Appearance = |
|
| MainHazards = |
|
| Density = |
|
| NFPA-H = |
|
| MeltingPt = |
|
| NFPA-F = |
|
| Melting_notes = |
|
| NFPA-R = |
|
| BoilingPt = |
|
| NFPA-S = |
|
| Boiling_notes = |
|
| HPhrases = |
|
| Solubility = |
|
| PPhrases = |
|
| SolubleOther = |
|
| GHS_ref = |
|
| Solvent = |
|
| FlashPt = |
|
| pKa = |
|
| AutoignitionPt = |
|
| pKb = |
|
| ExploLimits = |
|
|
| PEL = |
| ⚫ |
}} |
|
|
|
|
|
| Section7 = {{Chembox Hazards |
|
|
| ExternalMSDS = |
|
|
| EUClass = |
|
|
| EUIndex = |
|
|
| MainHazards = |
|
| ⚫ |
| NFPA-H = |
|
| ⚫ |
| NFPA-F = |
|
| ⚫ |
| NFPA-R = |
|
|
| NFPA-O = |
|
|
| RPhrases = |
|
|
| SPhrases = |
|
|
| RSPhrases = |
|
|
| FlashPt = |
|
|
| Autoignition = |
|
|
| ExploLimits = |
|
| ⚫ |
| PEL = |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Solasodine''' is a ] ] ] that occurs in plants of the family ] such as potatoes and tomatoes.<ref name=Everist>{{cite book |last=Everist |first=S.L. |title=Poisonous Plants of Australia |publisher=Angus & Robertson |year=1981 |isbn=978-0-207-14228-4}}</ref> ] and ] are ] derivatives of solasodine.<ref name=Everist/> Solasodine is ] to hamster fetuses in a dose of 1200 to 1600 mg/kg.<ref>{{cite book |last=Kinghorn |first=A.D. |chapter=Toxins and Teratogens of the Solanaceae and Liliaceae |title=Toxic plants |publisher=Society for Economic Botany, Columbia University Press |year=2010 |pages=75–76 |isbn=978-0231515689 |chapter-url=https://books.google.com/books?id=CZPDzu2dGDEC&pg=PA75}}</ref> |
|
|
A 2013 literature survey found that various studies have indicated that solasodine may have diuretic, anticancer, antifungal, cardiotonic, antispermatogenetic, antiandrogenic, immunomodulatory, antipyretic and/or various other effects on central nervous system.<ref>{{cite journal |title=Medicinal significance, pharmacological activities, and analytical aspects of solasodine: A concise report of current scientific literature |first=Kanika |last=Patel |first2=Ravi B.|last2=Singh |first3=Dinesh K.|last3=Patel |journal=Journal of Acute Disease |volume=2 |issue=2 |year=2013 |pages=92–98 |doi=10.1016/S2221-6189(13)60106-7 |doi-access=free }}</ref> |
|
|
|
|
|
== Uses == |
|
|
It is commercially used as a precursor for the production of complex ] compounds such as ]s, via a ] intermediate.<ref name=Everist/> |
|
|
|
|
|
== See also == |
|
|
* '']'' |
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{alkaloid-stub}} |