| Revision as of 12:12, 30 April 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm chalconoids← Previous edit |
Latest revision as of 13:30, 16 October 2022 edit undoJCW-CleanerBot (talk | contribs)Bots130,205 editsm →top: clean up, replaced: , → ,Tag: AWB |
| (12 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 392614876 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 426713434 |
|
| Name = Sophoradin |
|
| Name = Sophoradin |
|
| ImageFile = Sophoradin.svg |
|
| ImageFile = Sophoradin.svg |
|
| ImageSize = 300px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of sophoradin |
|
| ImageName = Chemical structure of sophoradin |
|
| ImageAlt = Chemical structure of sophoradin |
|
| ImageAlt = Chemical structure of sophoradin |
|
| IUPACName = <nowiki>(E)-1--3-prop-2-en-1-one</nowiki> |
|
| PIN = 2′,4,4′-Trihydroxy-3,3′,5-tris(3-methylbut-2-en-1-yl)chalcone |
|
|
| OtherNames = |
|
| OtherNames = 2', 4, 4'-trihydroxy-3, 3', 5-tris (3-methyl-2-butenyl) chalcone<!-- <br> --> |
|
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 23057-54-7 |
|
| CASNo = 23057-54-7 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| CASNo1_Ref = {{cascite|correct|CAS}} |
|
| CASOther = |
|
|
|
| CASNo1 = 31934-68-6 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = GLR4RE4EBU |
|
| PubChem = 5321393 |
|
| PubChem = 5321393 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| SMILES = CC(=CCC1=CC(=CC(=C1O)CC=C(C)C)C=CC(=O)C2=C(C(=C(C=C2)O)CC=C(C)C)O)C |
|
|
| InChI = |
|
| ChemSpiderID = 4479146 |
|
|
| SMILES = O=C(c1ccc(O)c(c1O)C\C=C(/C)C)\C=C\c2cc(c(O)c(c2)C/C=C(\C)C)C\C=C(/C)C |
|
|
| InChI = 1/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+ |
|
|
| InChIKey = YAPAFDNQABLIIN-XNTDXEJSBZ |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C30H36O4/c1-19(2)7-11-23-17-22(18-24(29(23)33)12-8-20(3)4)10-15-27(31)26-14-16-28(32)25(30(26)34)13-9-21(5)6/h7-10,14-18,32-34H,11-13H2,1-6H3/b15-10+ |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = YAPAFDNQABLIIN-XNTDXEJSSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=30|H=36|O=4 |
|
| Formula = C<sub>30</sub>H<sub>36</sub>O<sub>4</sub> |
|
|
| MolarMass = 460.60 g/mol |
|
|
| ExactMass = 460.26136 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Sophoradin''' is an isoprenyl ]<ref></ref>, a type of polyphenolic compound, found in '']'', a herb used in traditional Chinese medicine. |
|
'''Sophoradin''' is an isoprenyl ],<ref></ref> a type of polyphenolic compound, found in '']'', an herb used in ]. |
|
|
|
|
|
] is an oral gastrointestinal medication and a synthetic derivative of sophoradin<ref>{{cite journal |author=Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R |title=Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin |journal=Hepatogastroenterology |volume=34 |issue=4 |pages=164–70 |year=1987 |month=August |pmid=3478294 |doi= |url=}}</ref>. |
|
] is an oral gastrointestinal medication and a synthetic ] of sophoradin.<ref>{{cite journal |vauthors=Konturek SJ, Mrzozowski T, Drozdowicz D, Pawlik W, Sendur R |title=Gastroprotective and ulcer healing effects of solon, a synthetic flavonoid derivative of sophoradin |journal=Hepatogastroenterology |volume=34 |issue=4 |pages=164–70 |date=August 1987 |pmid=3478294 }}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
<!-- ==External links== |
|
|
{{commons}} --> |
|
|
|
|
|
|
{{chalconoid}} |
|
{{chalconoid}} |
|
|
|
|
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{phenol-stub}} |