| Revision as of 09:08, 1 May 2011 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm Category:Hydrolysable tannins← Previous edit |
Latest revision as of 19:21, 12 September 2022 edit undoEvanBaldonado (talk | contribs)Extended confirmed users13,823 editsm Replace hyphen with en-dash. |
| (20 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 414243370 |
|
| verifiedrevid = 426862711 |
|
| Name = Stenophyllanin A |
|
| Name = Stenophyllanin A |
|
| ImageFile = Stenophyllanin A.PNG |
|
| ImageFile = Stenophyllanin A.PNG |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of stenophyllanin A |
|
| ImageName = Chemical structure of stenophyllanin A |
|
| ImageAlt = Chemical structure of stenophyllanin A |
|
| ImageAlt = Chemical structure of stenophyllanin A |
|
|
| IUPACName = -2,3,4,7,8,9-hexahydroxy-12,17-dioxo-13,16-dioxatetracyclononadeca-1,3,5(18),6,8,10-hexaen-14-yl]-3,4,5,17,18,19-hexahydroxy-8,14-dioxo-9,13-dioxatricyclononadeca-1(19),2,4,6,15,17-hexaen-11-yl] 3,4,5-trihydroxybenzoate |
|
| IUPACName = |
|
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo = |
|
| CASNo = 97775-88-7 |
|
| CASNo_Ref = |
|
| CASNo_Ref = |
|
| CASOther = |
|
| PubChem = 101651021 |
|
|
| StdInChI=1S/C56H40O31/c57-18-2-1-12(3-20(18)59)47-27(66)6-14-19(58)10-21(60)32(48(14)84-47)35-34-36-33(44(74)46(76)45(34)75)31-17(9-26(65)40(70)43(31)73)55(80)87-51(50(35)86-56(36)81)49-28(83-52(77)13-4-22(61)37(67)23(62)5-13)11-82-53(78)15-7-24(63)38(68)41(71)29(15)30-16(54(79)85-49)8-25(64)39(69)42(30)72/h1-5,7-10,27-28,35,47,49-51,57-76H,6,11H2/t27?,28-,35-,47?,49-,50+,51?/m1/s1 |
|
| PubChem = |
|
|
|
| StdInChIKey = MRRHAYNXHYEUOD-KJJOKTLFSA-N |
|
| SMILES = |
|
|
|
| SMILES = C1C(C(OC2=C1C(=CC(=C2C3C4C(OC(=O)C5=CC(=C(C(=C5C6=C(C3=C(C(=C6O)O)O)C(=O)O4)O)O)O)C7C(COC(=O)C8=CC(=C(C(=C8C9=C(C(=C(C=C9C(=O)O7)O)O)O)O)O)O)OC(=O)C1=CC(=C(C(=C1)O)O)O)O)O)C1=CC(=C(C=C1)O)O)O |
|
| InChI = |
|
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>42</sub>H<sub>30</sub>O<sub>25</sub> <!-- may be incorrect --> |
|
| Formula = C<sub>42</sub>H<sub>30</sub>O<sub>25</sub> <!-- may be incorrect --> |
|
| MolarMass = 934,64 g/mol <!-- may be incorrect --> |
|
| MolarMass = 934,64 g/mol <!-- may be incorrect --> |
|
| ExactMass = 934,107615 u <!-- may be incorrect --> |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
| GHS_ref =<!-- no GHS data in PubChem Dec2021 --> |
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
⚫ |
'''Stenophyllanin A''' is an ]. It can be found in '']'', '']''<ref>Anti-tumor promoting activity of polyphenols from Cowania mexicana and Coleogyne ramosissima. Hideyuki Ito, Masateru Miyake, Eisei Nishitani, Kazuko Mori, Tsutomu Hatano, Takuo Okuda, Takao Konoshima, Midori Takasaki, Mutsuo Kozuka, Teruo Mukainaka, Harukuni Tokuda, Hoyoku Nishino and Takashi Yoshida, Cancer Letters, Volume 143, Issue 1, 23 August 1999, Pages 5–13, {{doi|10.1016/S0304-3835(99)00160-3}}</ref> and '']''.<ref>Tannins and related compounds part 26: isolation and structures of stenophyllanins A, B, and C, novel tannins from Quercus stenophylla, G. Nonaka, H. Nishimura, I. Nishioka, J. Chem. Soc. Perkin Trans. 1, 1985, pp. 163–172, {{doi|10.1039/P19850000163}}</ref> |
|
'''Stenophyllanin A''' is a tannin. It can be found in '']'', '']''<ref> |
|
| ⚫ |
Anti-tumor promoting activity of polyphenols from Cowania mexicana and Coleogyne ramosissima. Hideyuki Ito, Masateru Miyake, Eisei Nishitani, Kazuko Mori, Tsutomu Hatano, Takuo Okuda, Takao Konoshima, Midori Takasaki, Mutsuo Kozuka, Teruo Mukainaka, Harukuni Tokuda, Hoyoku Nishino and Takashi Yoshida, Cancer Letters, Volume 143, Issue 1, 23 August 1999, Pages 5-13, {{doi|10.1016/S0304-3835(99)00160-3}}</ref> and '']''<ref>Tannins and related compounds part 26: isolation and structures of stenophyllanins A, B, and C, novel tannins from Quercus stenophylla, G. Nonaka, H. Nishimura, I. Nishioka, J. Chem. Soc. Perkin Trans. 1, 1985, pp. 163-172, {{doi|10.1039/P19850000163}}</ref>. |
|
|
|
|
|
<!-- ==Metabolism== --> |
|
<!-- ==Metabolism== --> |
|
|
|
|
|
⚫ |
== References == |
|
⚫ |
{{reflist}} |
|
|
|
|
|
|
{{Ellagitannin}} |
| ⚫ |
==References== |
|
| ⚫ |
{{reflist}} |
|
|
|
|
|
|
|
] |
|
{{Hydrolysable tannin}} |
|
|
|
|
|
|
] |
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
{{aromatic-stub}} |