| Revision as of 07:48, 1 September 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'StdInChI', 'StdInChIKey').← Previous edit |
Latest revision as of 23:31, 23 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (9 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 447817179 |
|
| Verifiedfields = changed |
|
|
⚫ |
| IUPAC_name = ''N''-<nowiki/>{2-propanoyl}glycine |
| ⚫ |
| verifiedrevid = 444116912 |
|
| ⚫ |
| IUPAC_name = ''N''-{2-propanoyl}glycine |
|
|
| image = Stepronin.svg |
|
| image = Stepronin.svg |
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
| Line 16: |
Line 15: |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
| Line 23: |
Line 21: |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CASNo_Ref = {{cascite}} |
|
|
| CAS_number = 72324-18-6 |
|
| CAS_number = 72324-18-6 |
|
| ATC_prefix = R05 |
|
| ATC_prefix = R05 |
|
| ATC_suffix = CB11 |
|
| ATC_suffix = CB11 |
| ⚫ |
| StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) |
|
| ⚫ |
| StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N |
|
|
| PubChem = 54120 |
|
| PubChem = 54120 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = DB01423 |
|
| DrugBank = DB01423 |
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 48889 |
|
| ChemSpiderID = 48889 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 40: |
Line 34: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07381 |
|
| KEGG = D07381 |
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=10 | H=11 | N=1 | O=4 | S=2 |
|
| C=10 | H=11 | N=1 | O=4 | S=2 |
|
|
| smiles = CC(C(=O)NCC(=O)O)SC(=O)C1=CC=CS1 |
|
| molecular_weight = 273.331 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChI = 1S/C10H11NO4S2/c1-6(9(14)11-5-8(12)13)17-10(15)7-3-2-4-16-7/h2-4,6H,5H2,1H3,(H,11,14)(H,12,13) |
|
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
⚫ |
| StdInChIKey = JNYSEDHQJCOWQU-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
'''Stepronin''' is a ]<ref>{{cite journal | vauthors = Olivieri D, Bernareggi V, Quitadamo M | title = | journal = Archivio Monaldi per la Tisiologia e le Malattie dell'apparato Respiratorio | volume = 40 | issue = 5–6 | pages = 211–7 | year = 1985 | pmid = 3843171 }}</ref> and ].<ref>{{cite journal | vauthors = Yamada K, Satoh M, Shimura S, Sasaki T, Takishima T, Shirato K | title = An expectorant, stepronin, reduces airway secretion in vitro | journal = Respiration; International Review of Thoracic Diseases | volume = 61 | issue = 1 | pages = 42–7 | year = 1994 | pmid = 8177972 | doi = 10.1159/000196302 }}</ref> |
|
'''Stepronin''' is a ]. |
|
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{reflist}} |
|
|
|
|
|
{{Cough and cold preparations}} |
|
{{Cough and cold preparations}} |
| Line 53: |
Line 51: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
{{respiratory-system-drug-stub}} |