Revision as of 13:40, 28 June 2009 editAnypodetos (talk | contribs)Autopatrolled, Extended confirmed users, Pending changes reviewers, Rollbackers39,350 editsm Added ATC codes← Previous edit |
Latest revision as of 17:29, 6 January 2025 edit undo97.102.205.224 (talk) Give more concise organic SMILES form. "c1cnoc1" rather than "C1=CON=C1" and "c2ccccc2" rather than "C2=CC=CC=C2". |
(43 intermediate revisions by 29 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{ref improve|date=August 2014}} |
|
|
{{confused|sulfadiazine}} |
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| IUPAC_name = 4-amino-''N''-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
|
|
|
| Watchedfields = changed |
⚫ |
| image = Sulfafurazole.svg |
|
|
|
| verifiedrevid = 408901459 |
⚫ |
| CAS_number = 127-69-5 |
|
|
⚫ |
| IUPAC_name = 4-Amino-''N''-(3,4-dimethyl-1,2-oxazol-5-yl)benzenesulfonamide |
⚫ |
| ATC_prefix = J01 |
|
|
⚫ |
| image = Sulfafurazole.svg |
⚫ |
| ATC_suffix = EB05 |
|
|
|
|
⚫ |
| ATC_supplemental = {{ATC|S01|AB02}} {{ATCvet|J01|EQ05}} |
|
|
|
<!--Clinical data--> |
⚫ |
| PubChem = 5344 |
|
|
|
| tradename = |
⚫ |
| DrugBank = APRD00595 |
|
|
|
| Drugs.com = {{drugs.com|international|sulfafurazole}} |
⚫ |
| C=11 | H=13 | N=3 | O=3 | S=1 |
|
|
|
| MedlinePlus = a601049 |
|
| molecular_weight = 267.30 g/mol |
|
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| smiles = CC1=C(ON=C1C)NS(=O)(=O)C2=CC=C(C=C2)N |
|
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
⚫ |
| bioavailability = |
|
|
⚫ |
| pregnancy_category = To be avoided within two months of term |
⚫ |
| protein_bound = |
|
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
⚫ |
| metabolism = |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
⚫ |
| elimination_half-life = |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
⚫ |
| excretion = Excreted unchanged in urine |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category= To be avoided within two months of term |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = Rx-only |
|
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = Excreted unchanged in urine |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
⚫ |
| CAS_number = 127-69-5 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = EB05 |
|
⚫ |
| ATC_supplemental = {{ATC|S01|AB02}} {{ATCvet|J01|EQ05}} |
|
⚫ |
| PubChem = 5344 |
|
|
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} |
|
⚫ |
| DrugBank = DB00263 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 740T4C525W |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D00450 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 453 |
|
|
| ChemSpiderID = 5151 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=11 | H=13 | N=3 | O=3 | S=1 |
|
|
| smiles = Cc1c(C)noc1NS(=O)(=O)c2ccc(N)cc2 |
|
|
| StdInChI = 1S/C11H13N3O3S/c1-7-8(2)13-17-11(7)14-18(15,16)10-5-3-9(12)4-6-10/h3-6,14H,12H2,1-2H3 |
|
|
| StdInChIKey = NHUHCSRWZMLRLA-UHFFFAOYSA-N |
|
|
| melting_point = 194 |
|
}} |
|
}} |
|
⚫ |
'''Sulfafurazole''' (], also known as '''sulfisoxazole''') is a ] ] with a dimethyl-] substituent. It possesses antibiotic activity against a wide range of ] and ] organisms.<ref name = "Holmes_2017">{{cite book | vauthors = Holmes NE, Grauson ML | chapter = Sulfonamides | pages = 1571–1624 | veditors = Paterson DL, McCarthy JS, Mouton JW, Mills J, Grayson ML, Cosgrove SE, Crowe S, Hope W | title = Kucers' The Use of Antibiotics | edition = 7th | publisher = CRC Press | date = October 2017 | isbn = 978-1-4987-4796-7 }}</ref> It is sometimes given in combination with ] (see ]) or ]. It is used locally in a 4% solution or ointment. |
|
|
|
|
|
|
==References== |
⚫ |
'''Sulfafurazole''' (], also known as '''sulfisoxazole''') is a ] ] with an ] substituent. It has antibiotic activity against a wide range of ] and ] organisms. It is sometimes given in combination with ] or ]. It is used locally in a 4% solution or ointment. |
|
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
==External links== |
Line 34: |
Line 65: |
|
* {{MedlinePlusDrugInfo|medmaster|a601115}} |
|
* {{MedlinePlusDrugInfo|medmaster|a601115}} |
|
* {{DiseasesDB|30455}} |
|
* {{DiseasesDB|30455}} |
|
|
|
|
{{-}} |
|
|
{{Sulfonamides and trimethoprim}} |
|
{{Sulfonamides and trimethoprim}} |
|
|
{{Ophthalmological anti-infectives}} |
|
|
{{Xenobiotic-sensing receptor modulators}} |
|
|
|
|
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|
|
] |
|