| Revision as of 19:38, 10 August 2011 editBeetstra (talk | contribs)Edit filter managers, Administrators172,081 edits Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'DrugBank').← Previous edit |
Latest revision as of 15:34, 8 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits removed Category:Anilines; added Category:4-Aminophenyl compounds using HotCat |
| (31 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
|
{{short description|Chemical used to treat pulmonary issues}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
|
| verifiedrevid = 470472993 |
|
| UNII = T6BL4ZC15G |
|
|
|
| IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide |
|
| verifiedrevid = 408901592 |
|
|
|
| image = Sulfalene2DCSD.svg |
|
| IUPAC_name = 4-Amino-''N''-(3-methoxypyrazinyl)benzenesulfonamide |
|
|
|
| width = |
|
| image = sulfalene.png |
|
|
|
| alt = |
|
|
| image2 = |
|
|
| width2 = |
|
|
| drug_name = |
|
|
| caption = |
|
|
<!--Clinical data--> |
|
|
| tradename = Eadazine, Kelfizina, Kelfizine W, Longum |
|
|
| Drugs.com = {{drugs.com|international|sulfametopyrazine}} |
|
|
| licence_EU = <!-- EMA requires brand name --> |
|
|
| licence_US = <!-- FDA may use generic name --> |
|
|
| DailyMedID = <!-- preference to licence_US --> |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category = |
|
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
| legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| dependency_liability = |
|
|
| routes_of_administration = Oral<ref name="MIMS">{{cite web | url = http://www.cimsasia.com/USA/drug/info/sulfalene/?q=Sulphonamides&type=full | title = Sulfalene | work = MIMS Drug Information System | access-date = 26 August 2011}}</ref> |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
|
| bioavailability = |
|
|
| protein_bound = 60 to 80%<ref name="MIMS"/> |
|
|
| metabolism = |
|
|
| elimination_half-life = 60 to 65 hours<ref name="MIMS"/> |
|
|
| excretion = ]<ref name="MIMS"/> |
|
|
|
|
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
|
| CAS_number = 152-47-6 |
|
|
| CAS_supplemental = |
|
|
| ATCvet = |
|
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = ED02 |
|
|
| ATC_supplemental = {{ATCvet|J01|EQ19}} |
|
|
| PubChem = 9047 |
|
|
| PubChemSubstance = |
|
|
| IUPHAR_ligand = |
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
| DrugBank = DB00664 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 8695 |
|
| ChemSpiderID = 8695 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
|
|
|
| UNII = T6BL4ZC15G |
|
| InChIKey = KXRZBTAEDBELFD-UHFFFAOYAH |
|
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| smiles = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 |
|
|
|
| KEGG = D01216 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
|
<!--Chemical data--> |
|
|
| C=11 | H=12 | N=4 | O=3 | S=1 |
|
|
| SMILES = O=S(=O)(Nc1nccnc1OC)c2ccc(N)cc2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
|
| StdInChI = 1S/C11H12N4O3S/c1-18-11-10(13-6-7-14-11)15-19(16,17)9-4-2-8(12)3-5-9/h2-7H,12H2,1H3,(H,13,15) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N |
|
| StdInChIKey = KXRZBTAEDBELFD-UHFFFAOYSA-N |
|
|
| synonyms = Sulfametopyrazine |
|
| CAS_number = 152-47-6 |
|
|
|
| density = |
|
| ATC_prefix = J01 |
|
|
| ATC_suffix = ED02 |
|
| melting_point = |
|
|
| melting_high = |
|
| PubChem = 9047 |
|
|
|
| melting_notes = |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
|
|
| boiling_point = |
|
| DrugBank = DB00664 |
|
|
|
| boiling_notes = |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
|
| KEGG = D01216 |
|
| solubility = |
|
|
| specific_rotation = |
|
| C=11|H=12|N=4|O=3|S=1 |
|
|
|
| sec_combustion = |
|
| molecular_weight = 280.304 g/mol |
|
|
| bioavailability = |
|
|
| protein_bound = |
|
|
| metabolism = |
|
|
| elimination_half-life = |
|
|
| excretion = |
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
| pregnancy_category= |
|
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
| legal_status = |
|
|
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
|
'''Sulfalene''' (], ]) or '''sulfametopyrazine''' (]) is a long-acting ] ] used for the treatment of ], ]s and ].<ref name="DrugBank">{{DrugBank|DB00664}}</ref><ref name = MD/> As of 2014 there were only two countries in which it is currently still marketed: ] and ].<ref name = MD>{{cite web|title=Sulfametopyrazine|work=Martindale: The Complete Drug Reference|publisher=Pharmaceutical Press|date=9 May 2013|access-date=28 March 2014| veditors = Brayfield A |url=http://www.medicinescomplete.com/mc/martindale/current/4920-k.htm}}</ref> |
|
'''Sulfalene''' is a ] ]. |
|
|
|
|
|
|
|
It was discovered by researchers at ] and first published in 1960 and was marketed as Kelfizina.<ref name="pmid5332105">{{cite journal | vauthors = Baruffa G | title = Clinical trials in Plasmodium falciparum malaria with a long-acting sulphonamide | journal = Transactions of the Royal Society of Tropical Medicine and Hygiene | volume = 60 | issue = 2 | pages = 222–4 | date = 1966 | pmid = 5332105 | doi = 10.1016/0035-9203(66)90030-7 }}</ref><ref>Per prior citation, the first publication: {{cite journal | vauthors = Camerino B, Palamidessi G | date = 1960 | title = Derivati della parazina II. Sulfonamdopir |language=it | journal = Gazz Chim Ital | volume = 90 | pages = 1802–1815 }}</ref> |
|
|
|
|
|
|
==See also== |
|
|
*] |
|
|
== References == |
|
|
<references/> |
|
|
|
|
|
{{Sulfonamides and trimethoprim}} |
|
{{Sulfonamides and trimethoprim}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|