| Revision as of 18:12, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456857102 of page Sulfamethizole for the Chem/Drugbox validation project (updated: 'DrugBank'). |
Latest revision as of 15:35, 8 October 2024 edit JWBE (talk | contribs)Extended confirmed users10,126 edits added Category:4-Aminophenyl compounds using HotCat |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
⚫ |
| verifiedrevid = 470473060 |
|
| Verifiedfields = changed |
|
|
⚫ |
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)benzene-1-sulfonamide |
| ⚫ |
| verifiedrevid = 409963679 |
|
| ⚫ |
| IUPAC_name = 4-amino-''N''-(5-methyl-1,3,4-thiadiazol-2-yl)- benzenesulfonamide |
|
|
| image = Sulfamethizole.svg |
|
| image = Sulfamethizole.svg |
|
| width = 250 |
|
| width = 250 |
|
⚫ |
<!--Clinical data-->| tradename = |
|
|
|
| ⚫ |
<!--Clinical data--> |
|
|
| tradename = |
|
|
| Drugs.com = {{drugs.com|CONS|sulfamethizole}} |
|
| Drugs.com = {{drugs.com|CONS|sulfamethizole}} |
|
| MedlinePlus = a682231 |
|
| MedlinePlus = a682231 |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_UK = <!-- GSL / P / POM / CD --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_US = <!-- OTC / Rx-only --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = <!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
|
|
<!--Pharmacokinetic data--> |
|
| ⚫ |
| bioavailability = |
|
|
| protein_bound = 98–99% |
|
| protein_bound = 98–99% |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = 3–8 hours |
|
| elimination_half-life = 3–8 hours |
|
| excretion = |
|
| excretion = <!--Identifiers--> |
|
|
|
|
<!--Identifiers--> |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 144-82-1 |
|
| CAS_number = 144-82-1 |
|
| ATC_prefix = B05 |
|
| ATC_prefix = B05 |
|
| ATC_suffix = CA04 |
|
| ATC_suffix = CA04 |
|
| ATC_supplemental = {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}} |
|
| ATC_supplemental = {{ATC|D06|BA04}} {{ATC|J01|EB02}} {{ATC|S01|AB01}} {{ATCvet|J01|EQ02}} |
|
| PubChem = 5328 |
|
| PubChem = 5328 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| Line 43: |
Line 36: |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D00870 |
|
| KEGG = D00870 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 9331 |
|
| ChEBI = 9331 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 1191 |
|
| ChEMBL = 1191 |
|
⚫ |
<!--Chemical data-->| C = 9 |
|
|
|
|
|
| H = 10 |
| ⚫ |
<!--Chemical data--> |
|
|
|
| N = 4 |
|
| C=9 | H=10 | N=4 | O=2 | S=2 |
|
|
|
| O = 2 |
|
| molecular_weight = 270.333 g/mol |
|
|
|
| S = 2 |
|
| smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2 |
|
| smiles = O=S(=O)(Nc1nnc(s1)C)c2ccc(N)cc2 |
|
| InChI = 1/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
|
| InChIKey = VACCAVUAMIDAGB-UHFFFAOYAZ |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
| StdInChI = 1S/C9H10N4O2S2/c1-6-11-12-9(16-6)13-17(14,15)8-4-2-7(10)3-5-8/h2-5H,10H2,1H3,(H,12,13) |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N |
|
| StdInChIKey = VACCAVUAMIDAGB-UHFFFAOYSA-N |
|
|
| melting_point = 208 |
|
}} |
|
}} |
|
|
'''Sulfamethizole''' is a ] ].<ref>{{cite journal | vauthors = Ayankojo AG, Tretjakov A, Reut J, Boroznjak R, Öpik A, Rappich J, Furchner A, Hinrichs K, Syritski V | display-authors = 6 | title = Molecularly Imprinted Polymer Integrated with a Surface Acoustic Wave Technique for Detection of Sulfamethizole | journal = Analytical Chemistry | volume = 88 | issue = 2 | pages = 1476–1484 | date = January 2016 | pmid = 26704414 | doi = 10.1021/acs.analchem.5b04735 }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== Further reading == |
|
|
{{refbegin}} |
|
|
* {{cite journal | vauthors = Ratanajamit C, Skriver MV, Nørgaard M, Jepsen P, Schønheyder HC, Sørensen HT | title = Adverse pregnancy outcome in users of sulfamethizole during pregnancy: a population-based observational study | journal = The Journal of Antimicrobial Chemotherapy | volume = 52 | issue = 5 | pages = 837–841 | date = November 2003 | pmid = 14519675 | doi = 10.1093/jac/dkg438 | doi-access = free }} |
|
|
* {{cite journal | vauthors = Kerrn MB, Frimodt-Møller N, Espersen F | title = Effects of sulfamethizole and amdinocillin against Escherichia coli strains (with various susceptibilities) in an ascending urinary tract infection mouse model | journal = Antimicrobial Agents and Chemotherapy | volume = 47 | issue = 3 | pages = 1002–1009 | date = March 2003 | pmid = 12604534 | pmc = 149286 | doi = 10.1128/AAC.47.3.1002-1009.2003 }} |
|
|
* {{cite journal | vauthors = Watanabe H, Hastings JW | title = Inhibition of bioluminescence in Photobacterium phosphoreum by sulfamethizole and its stimulation by thymine | journal = Biochimica et Biophysica Acta (BBA) - Bioenergetics | volume = 1017 | issue = 3 | pages = 229–234 | date = June 1990 | pmid = 2372557 | doi = 10.1016/0005-2728(90)90189-B }} |
|
|
{{refend}} |
|
|
|
|
|
{{Antibiotics and chemotherapeutics for dermatological use}} |
|
|
{{SulfonamideAntiBiotics}} |
|
|
{{Ophthalmological anti-infectives}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
|
{{blood-drug-stub}} |
|
|
{{dermatologic-drug-stub}} |