| Revision as of 02:09, 9 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to verified fields - updated 'DrugBank_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Misplaced Pages talk:WikiProject_Pharmacology|er← Previous edit |
Latest revision as of 15:36, 8 October 2024 edit undoJWBE (talk | contribs)Extended confirmed users10,129 edits added Category:4-Aminophenyl compounds using HotCat |
| (14 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{drugbox |
|
|
|
{{Drugbox |
|
| Verifiedfields = changed |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443793085 |
| ⚫ |
| UNII = W5E840UV9P |
|
|
⚫ |
| IUPAC_name = 4-amino-N-(5-methylpyrimidin-2-yl)benzenesulfonamide |
| ⚫ |
| verifiedrevid = 408903857 |
|
|
⚫ |
| image = sulfaperine.png |
| ⚫ |
| IUPAC_name = 4-amino-N-(5-methylpyrimidin-2-yl)benzenesulfonamide |
|
|
|
|
| ⚫ |
| image = sulfaperine.png |
|
|
|
<!--Clinical data--> |
|
|
| tradename = |
|
⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
⚫ |
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
⚫ |
| legal_status = |
|
⚫ |
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
⚫ |
| protein_bound = |
|
⚫ |
| metabolism = |
|
⚫ |
| elimination_half-life = |
|
⚫ |
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
⚫ |
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
⚫ |
| CAS_number = 599-88-2 |
|
⚫ |
| ATC_prefix = J01 |
|
⚫ |
| ATC_suffix = ED06 |
|
⚫ |
| PubChem = 68933 |
|
⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
⚫ |
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 62158 |
|
| ChemSpiderID = 62158 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI = 1/C11H12N4O2S/c1-8-6-13-11(14-7-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
|
|
⚫ |
| UNII = W5E840UV9P |
|
| InChIKey = DZQVFHSCSRACSX-UHFFFAOYAW |
|
|
|
| ChEBI = 131722 |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D07240 |
|
|
|
|
|
<!--Chemical data--> |
|
⚫ |
| C=11 | H=12 | N=4 | O=2 | S=1 |
|
| smiles = O=S(=O)(Nc1ncc(cn1)C)c2ccc(N)cc2 |
|
| smiles = O=S(=O)(Nc1ncc(cn1)C)c2ccc(N)cc2 |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| Line 15: |
Line 48: |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = DZQVFHSCSRACSX-UHFFFAOYSA-N |
|
| StdInChIKey = DZQVFHSCSRACSX-UHFFFAOYSA-N |
| ⚫ |
| CAS_number = |
|
| ⚫ |
| ATC_prefix = J01 |
|
| ⚫ |
| ATC_suffix = ED06 |
|
| ⚫ |
| PubChem = 68933 |
|
| ⚫ |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| ⚫ |
| DrugBank = |
|
| ⚫ |
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| ⚫ |
| KEGG = D07240 |
|
| ⚫ |
| C=11|H=12|N=4|O=2|S=1 |
|
|
| molecular_weight = 264.305 g/mol |
|
| ⚫ |
| bioavailability = |
|
| ⚫ |
| protein_bound = |
|
| ⚫ |
| metabolism = |
|
| ⚫ |
| elimination_half-life = |
|
| ⚫ |
| excretion = |
|
| ⚫ |
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| ⚫ |
| pregnancy_category= |
|
| ⚫ |
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| ⚫ |
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| ⚫ |
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| ⚫ |
| legal_status = |
|
| ⚫ |
| routes_of_administration = |
|
|
}} |
|
}} |
|
|
|
|
|
'''Sulfaperin''' (or '''sulfaperine''') is a ] ]. |
|
'''Sulfaperin''' (or '''sulfaperine''') is a ] ].<ref>{{cite book | vauthors = Elks J, Ganellin CR |title=Dictionary of drugs: Chemical Data, Structures, and Bibliographies |date=1990 |publisher=Springer |location=Dordrecht |isbn=978-1-4757-2085-3 |page=1129 |edition=First |url=https://books.google.com/books?id=0vXTBwAAQBAJ&dq=Sulfaperin&pg=PA1129}}</ref> |
|
|
|
|
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
{{Sulfonamides and trimethoprim}} |
|
{{Sulfonamides and trimethoprim}} |
| Line 49: |
Line 59: |
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |
|
{{antibiotic-stub}} |
|
|
|
|
] |
|