| Revision as of 18:16, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{drugbox}} taken from revid 456625031 of page Sulfisomidine for the Chem/Drugbox validation project (updated: 'CAS_number'). |
Latest revision as of 20:33, 29 January 2023 edit Entranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Drugbox |
|
{{Drugbox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
⚫ |
| verifiedrevid = 470473700 |
|
| Watchedfields = changed |
|
| ⚫ |
| verifiedrevid = 409963556 |
|
|
| IUPAC_name = 4-amino-''N''-(2,6-dimethylpyrimidin-4-yl)<br>benzenesulfonamide |
|
| IUPAC_name = 4-amino-''N''-(2,6-dimethylpyrimidin-4-yl)<br>benzenesulfonamide |
|
| image = Sulfisomidine.svg |
|
| image = Sulfisomidine.svg |
|
|
| image2 = Sulfisomidine ball-and-stick.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = Oral |
|
| routes_of_administration = Oral |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = Minor ] |
|
| metabolism = Minor ] |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = ], 85% |
|
| excretion = ], 85% |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number_Ref = {{cascite|changed|??}} |
|
| CAS_number = <!-- blanked - oldvalue: 515-64-0 --> |
|
| CAS_number = 515-64-0 |
|
| ATC_prefix = J01 |
|
| ATC_prefix = J01 |
|
| ATC_suffix = EB01 |
|
| ATC_suffix = EB01 |
|
| PubChem = 5343 |
|
| PubChem = 5343 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 5150 |
|
| ChemSpiderID = 5150 |
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = W03L3ODK6E |
|
| UNII = W03L3ODK6E |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D01526 |
|
| KEGG = D01526 |
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 32166 |
|
| ChEBI = 32166 |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| Line 46: |
Line 46: |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=12 | H=14 | N=4 | O=2 | S=1 |
|
| C=12 | H=14 | N=4 | O=2 | S=1 |
|
| molecular_weight = 278.331 g/mol |
|
|
| smiles = O=S(=O)(Nc1nc(nc(c1)C)C)c2ccc(N)cc2 |
|
| smiles = O=S(=O)(Nc1nc(nc(c1)C)C)c2ccc(N)cc2 |
|
| InChI = 1/C12H14N4O2S/c1-8-7-12(15-9(2)14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
|
|
| InChIKey = YZMCKZRAOLZXAZ-UHFFFAOYAI |
|
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C12H14N4O2S/c1-8-7-12(15-9(2)14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
|
| StdInChI = 1S/C12H14N4O2S/c1-8-7-12(15-9(2)14-8)16-19(17,18)11-5-3-10(13)4-6-11/h3-7H,13H2,1-2H3,(H,14,15,16) |
| Line 56: |
Line 53: |
|
| StdInChIKey = YZMCKZRAOLZXAZ-UHFFFAOYSA-N |
|
| StdInChIKey = YZMCKZRAOLZXAZ-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
'''Sulfisomidine''' (]), also known as '''sulphasomidine''' (] until 2003),<ref> |
|
|
{{cite web |url= http://medicines.mhra.gov.uk/inforesources/productinfo/banslist.pdf |title= Changing substance names from BANs to rINNs. |url-status= bot: unknown |archiveurl= https://web.archive.org/web/20050827062201/http://medicines.mhra.gov.uk/inforesources/productinfo/banslist.pdf |archivedate= 2005-08-27 }} {{small|(34.5 ])}}. ] ] (December 12, 2003). Retrieved on 2007-08-26 through ].</ref> '''sulfamethin''' and '''sulfaisodimidine''', is a ] ]. It is closely related to ]. |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
==External links== |
|
|
* {{cite journal |vauthors=Melander A, Bitzén PO, Olsson S |title=Therapeutic equivalence of sulfaisodimidine 2 g twice daily and 1 g four times daily in lower urinary tract infections |journal=Acta Medica Scandinavica |volume=211 |issue=5 |pages=361–4 |year=1982 |pmid=7051761 |doi=10.1111/j.0954-6820.1982.tb01962.x}} |
|
|
|
|
|
{{Sulfonamides and trimethoprim}} |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
{{antibiotic-stub}} |