| Revision as of 04:42, 20 January 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - updated 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot|bu← Previous edit |
Latest revision as of 13:57, 2 May 2021 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits correct IUPAC name |
| (13 intermediate revisions by 12 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
⚫ |
| verifiedrevid = 408915915 |
|
| Verifiedfields = changed |
|
|
⚫ |
| Reference=<ref>'']'', 11th Edition, '''8963'''.</ref> |
| ⚫ |
| verifiedrevid = 401614940 |
|
|
|
| ImageFile=Sulisobenzon Structural Formula V.1.svg |
| ⚫ |
|Reference=<ref>'']'', 11th Edition, '''8963'''.</ref> |
|
|
⚫ |
| ImageSize=250px |
| ⚫ |
|ImageFile=Sulisobenzone.png |
|
|
|
| ImageAlt = Skeletal formula of sulisobenzone |
| ⚫ |
|ImageSize=200px |
|
|
⚫ |
| ImageFile2=Sulisobenzone-3D-balls.png |
|
|IUPACName=4-Hydroxy-2-methoxy-5-(oxo-phenylmethyl)benzenesulfonic acid |
|
|
|
| ImageAlt2 = Ball-and-stick model of the sulisobenzone molecule |
| ⚫ |
|OtherNames=Benzophenone-4 |
|
|
|
| PIN=5-Benzoyl-4-hydroxy-2-methoxybenzene-1-sulfonic acid |
|
⚫ |
| OtherNames=Benzophenone-4 |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 18829 |
|
| ChemSpiderID = 18829 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| Line 20: |
Line 22: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=4065-45-6 |
|
| CASNo=4065-45-6 |
|
| PubChem=19988 |
|
| PubChem=19988 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D05964 |
|
| KEGG = D05964 |
|
| SMILES = O=S(=O)(O)c1cc(c(O)cc1OC)C(=O)c2ccccc2 |
|
| SMILES = O=S(=O)(O)c1cc(c(O)cc1OC)C(=O)c2ccccc2 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula=C<sub>14</sub>H<sub>12</sub>O<sub>6</sub>S |
|
| Formula=C<sub>14</sub>H<sub>12</sub>O<sub>6</sub>S |
|
| MolarMass=308.31 g/mol |
|
| MolarMass=308.31 g/mol |
|
| Appearance=Light-tan powder |
|
| Appearance=Light-tan powder |
|
| Density= |
|
| Density= |
|
| MeltingPtC= 145 |
|
| MeltingPtC= 145 |
|
| BoilingPt= |
|
| BoilingPt= |
|
| Solubility= 1 g per 4 mL |
|
| Solubility= 1 g per 4 mL |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Sulisobenzone''' ('''benzophenone-4''') is an ingredient in some ]s which protects the skin from damage by UVB and short-wave UVA ].<ref>{{cite journal |author=Nohynek GJ, Schaefer H |title=Benefit and risk of organic ultraviolet filters |journal=Regul. Toxicol. Pharmacol. |volume=33 |issue=3 |pages=285–99 |year=2001 |month=June |pmid=11407932 |doi=10.1006/rtph.2001.1476 |url=}}</ref><ref></ref> |
|
'''Sulisobenzone''' ('''benzophenone-4''') is an ingredient in some ]s which protects the skin from damage by UVB and UVA ].<ref>{{cite journal |vauthors=Nohynek GJ, Schaefer H |title=Benefit and risk of organic ultraviolet filters |journal=Regul. Toxicol. Pharmacol. |volume=33 |issue=3 |pages=285–99 |date=June 2001 |pmid=11407932 |doi=10.1006/rtph.2001.1476 }}</ref><ref></ref> |
|
|
|
|
⚫ |
Its ] salt, '''sulisobenzone sodium''', is also referred to as ''']'''. |
|
|
|
|
| ⚫ |
Its ] salt, '''sulisobenzone sodium''', is also referred to as '''benzophenone-5'''. |
|
|
==References== |
|
==References== |
|
{{reflist}} |
|
{{reflist}} |
| Line 53: |
Line 56: |
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|