Misplaced Pages

TAPSO: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 00:51, 11 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm References: WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit Latest revision as of 00:07, 9 March 2024 edit undoInternetArchiveBot (talk | contribs)Bots, Pending changes reviewers5,385,078 edits Rescuing 1 sources and tagging 0 as dead.) #IABot (v2.0.9.5) (Maxim Masiutin - 17855 
(11 intermediate revisions by 11 users not shown)
Line 1: Line 1:
{{Chembox {{Chembox
| Verifiedfields = changed
| verifiedrevid = 417421121
| Watchedfields = changed
| verifiedrevid = 449646558
| ImageFile = TAPSO.svg | ImageFile = TAPSO.svg
| ImageSize = | ImageSize =
| ImageAlt = | ImageAlt =
| IUPACName = <nowiki>3-amino]-2-hydroxypropane-1-sulfonic acid</nowiki> | IUPACName = <nowiki>3-amino]-2-hydroxypropane-1-sulfonic acid</nowiki>
| OtherNames = 3--2-hydroxypropanesulfonic acid | OtherNames = 3--2-hydroxypropanesulfonic acid
| Section1 = {{Chembox Identifiers |Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|??}}
| CASNo = 68399-81-5
| PubChem = 109334 | CASNo = 68399-81-5
| UNII_Ref = {{fdacite|correct|FDA}}
| SMILES = }}
| UNII = 45Q4J0071U
| Section2 = {{Chembox Properties
| PubChem = 109334
| Formula = C<sub>7</sub>H<sub>17</sub>NO<sub>7</sub>S
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| MolarMass = 259.28 g/mol
| Appearance = | ChemSpiderID = 98301
| SMILES = O=S(=O)(O)CC(O)CNC(CO)(CO)CO
| Density =
| InChI = 1/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15)
| MeltingPt =
| InChIKey = RZQXOGQSPBYUKH-UHFFFAOYAF
| BoilingPt =
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| Solubility = }}
| StdInChI = 1S/C7H17NO7S/c9-3-7(4-10,5-11)8-1-6(12)2-16(13,14)15/h6,8-12H,1-5H2,(H,13,14,15)
| Section3 = {{Chembox Hazards
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| MainHazards =
| StdInChIKey = RZQXOGQSPBYUKH-UHFFFAOYSA-N}}
| FlashPt =
|Section2={{Chembox Properties
| Autoignition = }}
| Formula = C<sub>7</sub>H<sub>17</sub>NO<sub>7</sub>S
| MolarMass = 259.28 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}} }}
'''TAPSO''' is used to make ]s. It has a ] value of 7.635 (I=0, 25°C).<ref>{{cite journal |title=Thermodynamic Quantities for the Ionization Reactions of Buffers |last=Goldberg |first=R. |coauthors=Kishore, N.; Lennen, R. '''TAPSO''' is used to make ]s. It has a ] value of 7.635 (I=0, 25°C).<ref>{{cite journal |title=Thermodynamic Quantities for the Ionization Reactions of Buffers |last=Goldberg |first=R. |author2=Kishore, N. |author3=Lennen, R. |journal=J. Phys. Chem. Ref. Data |volume=31 |pages=231–370 |year=2002 |issue=2 |url=https://www.nist.gov/data/PDFfiles/jpcrd615.pdf |doi=10.1063/1.1416902 |access-date=2017-07-13 |archive-date=2008-10-06 |archive-url=https://web.archive.org/web/20081006062140/https://www.nist.gov/data/PDFfiles/jpcrd615.pdf |url-status=dead }}</ref> It can be used to make buffer solutions in the ] 7.0-8.2.
|journal=J. Phys. Chem. Ref. Data |volume=31 |pages=231–370 |year=2002 |url=http://www.nist.gov/data/PDFfiles/jpcrd615.pdf |doi=10.1063/1.1416902
}}</ref> It can be used to make buffer solutions in the ] 7.0-8.2.


== References == == References ==
{{reflist}} {{reflist}}


] ]