| Revision as of 22:18, 18 September 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{drugbox}} (changes to watched fields - updated 'ChemSpiderID_Ref', 'DrugBank_Ref', 'UNII_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'KEGG_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wi← Previous edit |
Latest revision as of 12:36, 30 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,027 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (17 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 403977794 |
|
| verifiedrevid = 451222383 |
|
| IUPAC_name = 6,6-dimethyl-3-(2-hydroxyethyl)thio-1-(thiazol-2-yl)-6,7-dihydro-2-benzothiophen-4(5H)-one |
|
| IUPAC_name = 6,6-dimethyl-3-(2-hydroxyethyl)thio-1-(thiazol-2-yl)-6,7-dihydro-2-benzothiophen-4(5H)-one |
|
| image = TB-21007_structure.png |
|
| image = TB-21007_structure.png |
|
|
| alt = Skeletal formula |
|
|
| image2 = TB-21007-3D-spacefill.png |
|
|
| alt2 = Space-filling model |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
|
| CAS_number = 207306-50-1 |
|
| CAS_number = 207306-50-1 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| ATC_prefix = |
|
|
|
| UNII = VL2NQQ83RN |
| ⚫ |
| ATC_suffix = |
|
|
| PubChem = |
|
| ATC_prefix = |
|
⚫ |
| ATC_suffix = |
|
|
| PubChem = 6918633 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 5293826 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 17603 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=15 | H=17 | N=1 | O=2 | S=3 |
|
| C=15 | H=17 | N=1 | O=2 | S=3 |
|
⚫ |
| SMILES = s3ccnc3-c2sc(SCCO)c1c2CC(C)(C)CC1=O |
|
| molecular_weight = 339.495 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| smiles = s3ccnc3-c2sc(SCCO)c1c2CC(C)(C)CC1=O |
|
|
|
| StdInChI = 1S/C15H17NO2S3/c1-15(2)7-9-11(10(18)8-15)14(20-6-4-17)21-12(9)13-16-3-5-19-13/h3,5,17H,4,6-8H2,1-2H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = QILRYFCEXLFIDS-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''TB-21007''' is a ] drug which acts as a subtype-selective ] at the ] containing ] ].<ref name="pmid11881985">{{cite journal |author=Chambers MS, Atack JR, Bromidge FA, ''et al.'' |title=6,7-Dihydro-2-benzothiophen-4(5H)-ones: a novel class of GABA-A alpha5 receptor inverse agonists |journal=J. Med. Chem. |volume=45 |issue=6 |pages=1176–9 |year=2002 |pmid=11881985|doi=10.1021/jm010471b}}</ref><ref name="pmid12747794">{{cite journal |author=Chambers MS, Atack JR, Broughton HB, ''et al.'' |title=Identification of a novel, selective GABA(A) alpha5 receptor inverse agonist which enhances cognition |journal=J. Med. Chem. |volume=46 |issue=11 |pages=2227–40 |year=2003 |pmid=12747794 |doi=10.1021/jm020582q |url=}}</ref> |
|
'''TB-21007''' is a ] drug which acts as a subtype-selective ] at the ] containing ] ].<ref name="pmid11881985">{{cite journal | vauthors = Chambers MS, Atack JR, Bromidge FA, Broughton HB, Cook S, Dawson GR, Hobbs SC, Maubach KA, Reeve AJ, Seabrook GR, Wafford K, MacLeod AM | display-authors = 6 | title = 6,7-Dihydro-2-benzothiophen-4(5H)-ones: a novel class of GABA-A alpha5 receptor inverse agonists | journal = Journal of Medicinal Chemistry | volume = 45 | issue = 6 | pages = 1176–9 | date = March 2002 | pmid = 11881985 | doi = 10.1021/jm010471b }}</ref><ref name="pmid12747794">{{cite journal | vauthors = Chambers MS, Atack JR, Broughton HB, Collinson N, Cook S, Dawson GR, Hobbs SC, Marshall G, Maubach KA, Pillai GV, Reeve AJ, MacLeod AM | display-authors = 6 | title = Identification of a novel, selective GABA(A) alpha5 receptor inverse agonist which enhances cognition | journal = Journal of Medicinal Chemistry | volume = 46 | issue = 11 | pages = 2227–40 | date = May 2003 | pmid = 12747794 | doi = 10.1021/jm020582q }}</ref> |
|
|
|
|
|
==See also== |
|
== See also == |
|
|
* ] |
|
* ] |
|
|
|
* ] |
|
* ] |
|
|
* ] |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
{{GABA receptor modulators}} |
|
|
|
|
|
⚫ |
] |
|
{{Psychostimulants, agents used for ADHD and nootropics}} |
|
|
⚫ |
] |
|
{{GABAergics}} |
|
|
|
] |
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
| ⚫ |
] |
|
|
] |
|
] |
|
] |
|
| ⚫ |
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{Nervous-system-drug-stub}} |