| Revision as of 19:09, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444130296 of page TFM_(piscicide) for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 16:34, 16 October 2024 edit Trilletrollet (talk | contribs)Extended confirmed users32,515 edits removed Category:Agnatha; added Category:Lampreys using HotCat |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{Chembox |
|
{{Chembox |
|
|
| Verifiedfields = changed |
|
| verifiedrevid = 444128431 |
|
| verifiedrevid = 470482059 |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = 3-Trifluoromethyl-4-nitrophenol.png |
|
| ImageFile = 3-Trifluoromethyl-4-nitrophenol.png |
|
| ImageSize = 120px |
|
| ImageSize = 120px |
|
| IUPACName = 4-nitro-3-(trifluoromethyl)phenol |
|
| Name = TFM |
|
|
| PIN = 4-Nitro-3-(trifluoromethyl)phenol |
|
| OtherNames = |
|
| OtherNames = |
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| InChI = 1/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
|
|
| CASNo = 88-30-2 |
|
| InChIKey = ZEFMBAFMCSYJOO-UHFFFAOYAI |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| InChI1 = 1S/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
|
|
| UNII = 96W52A3IFS |
|
| InChIKey1 = ZEFMBAFMCSYJOO-UHFFFAOYSA-N |
|
|
⚫ |
| PubChem = 6931 |
|
| CASNo = <!-- blanked - oldvalue: 88-30-2 --> |
|
|
⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ⚫ |
| PubChem = 6931 |
|
| ⚫ |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
|
| ChemSpiderID = 6665 |
|
| ChemSpiderID = 6665 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = ZEFMBAFMCSYJOO-UHFFFAOYSA-N |
|
| StdInChIKey = ZEFMBAFMCSYJOO-UHFFFAOYSA-N |
|
| SMILES = O=()c1c(cc(O)cc1)C(F)(F)F |
|
| SMILES = O=()c1c(cc(O)cc1)C(F)(F)F |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI =1S/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
| StdInChI = 1S/C7H4F3NO3/c8-7(9,10)5-3-4(12)1-2-6(5)11(13)14/h1-3,12H |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| C=7 | H=4 | F=3 | N=1 | O=3 |
|
| C=7 | H=4 | F=3 | N=1 | O=3 |
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
'''TFM''' (3-]-4-]) is a common ], i.e., a ] ] used to combat ] and ] of fish.<ref name=fsheet>{{cite web|url= http://www.glfc.org/pubs/FACT_4.pdf |title=TFM and SEA LAMPREY CONTROL: A Success Story |publisher=Great Lakes Fishery Commission |year=2000 |access-date=2020-12-25}}</ref> |
|
|
|
|
|
The substance was discovered in 1958 when researching means to combat ]s and it {{As of|2006|alt=currently}} remains the primary ] (lamprey-killer) in the ] area.<ref name=fsheet/> |
|
|
|
|
|
TFM toxicity has not been thoroughly investigated for humans, but is considered an irritant, respiratory irritant, and toxic by the manufacturer.<ref>{{cite web|url= https://www.pfaltzandbauer.com/SDSFile.ashx?ItemCode=T23635 |title=Safety Data Sheet |publisher=Pfaltz & Bauer |date=2018-10-01 |accessdate=2020-12-25}}</ref> Toxicity studies of other mammals have generally found it to be non-toxic at concentrations expected to be found in treated areas. Impact on other fish species may be controlled by selective application during the larvae season for lampreys and other management of its concentration. TFM does not accumulate, since it breaks down within several days.<ref name=fsheet/> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{jawless-fish-stub}} |