Revision as of 16:50, 16 February 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 459645162 of page 17-N-Allylamino-17-demethoxygeldanamycin for the Chem/Drugbox validation project (updated: 'CASNo'). |
Latest revision as of 19:43, 24 March 2024 edit Boghog (talk | contribs)Autopatrolled, Extended confirmed users, IP block exemptions, New page reviewers, Pending changes reviewers, Rollbackers, Template editors137,800 edits consistent citation formatting |
Line 1: |
Line 1: |
|
|
{{cs1 config|name-list-style=vanc|display-authors=6}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
| verifiedrevid = 457644489 |
|
| verifiedrevid = 477209222 |
|
|
| Name=Tanespimycin |
⚫ |
| Name=17-''N''-Allylamino-17-demethoxygeldanamycin |
|
|
| ImageFile = 17-N-Allylamino-17-demethoxygeldanamycin.svg |
|
| ImageFile = 17-N-Allylamino-17-demethoxygeldanamycin.svg |
|
| ImageSize = |
|
| ImageSize = 200px |
|
| IUPACName = docosa-8,12,14,18,21-<br />pentaen-10-yl] carbamate |
|
| IUPACName = docosa-8,12,14,18,21-pentaen-10-yl] carbamate |
|
⚫ |
| OtherNames = 17-''N''-Allylamino-17-demethoxygeldanamycin<br>17-AAG |
|
| OtherNames = |
|
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| IUPHAR_ligand = 7751 |
|
| InChI = 1/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
|
| InChI = 1/C31H43N3O8/c1-8-12-33-26-21-13-17(2)14-25(41-7)27(36)19(4)15-20(5)29(42-31(32)39)24(40-6)11-9-10-18(3)30(38)34-22(28(21)37)16-23(26)35/h8-11,15-17,19,24-25,27,29,33,36H,1,12-14H2,2-7H3,(H2,32,39)(H,34,38)/b11-9-,18-10+,20-15+/t17-,19+,24+,25+,27-,29+/m1/s1 |
|
| InChIKey = AYUNIORJHRXIBJ-TXHRRWQRBY |
|
| InChIKey = AYUNIORJHRXIBJ-TXHRRWQRBY |
|
| SMILES1 = C1C(((/C=C(/((/C=C\C=C(\C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)/C)OC)OC(=O)N)\C)C)O)OC |
|
| SMILES1 = C1C(((/C=C(/((/C=C\C=C(\C(=O)NC2=CC(=O)C(=C(C1)C2=O)NCC=C)/C)OC)OC(=O)N)\C)C)O)OC |
Line 17: |
Line 18: |
|
| StdInChIKey = AYUNIORJHRXIBJ-TXHRRWQRSA-N |
|
| StdInChIKey = AYUNIORJHRXIBJ-TXHRRWQRSA-N |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo_Ref = {{cascite|changed|??}} |
|
| CASNo = <!-- blanked - oldvalue: 75747-14-7 --> |
|
| CASNo = 75747-14-7 |
|
| PubChem = 6440175 |
|
| PubChem = 6440175 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 109480 |
|
| ChEMBL = 109480 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 4GY0AVT3L4 |
|
| ChemSpiderID = 21106220 |
|
| ChemSpiderID = 21106220 |
|
| SMILES = NC(=O)O1C(/C)=C/(C)(O)(OC)C(C)C\C2=C(/NCC=C)C(=O)\C=C(\NC(=O)C(\C)=C\C=C/1OC)C2=O |
|
| SMILES = NC(=O)O1C(/C)=C/(C)(O)(OC)C(C)C\C2=C(/NCC=C)C(=O)\C=C(\NC(=O)C(\C)=C\C=C/1OC)C2=O |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=31 | H=43 | N=3 | O=8 |
|
| Formula = C<sub>31</sub>H<sub>43</sub>N<sub>3</sub>O<sub>8</sub> |
|
|
|
| Appearance = |
|
| MolarMass = 585.689 g/mol |
|
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = |
|
| MeltingPt = |
|
| BoilingPt = |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
|
}} |
|
}} |
|
| Section7 = {{Chembox Hazards |
|
|Section7={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Tanespimycin''' ('''17-''N''-allylamino-17-demethoxygeldanamycin''', '''17-AAG''') is a derivative of the antibiotic ] that is being studied in the treatment of ], specifically in younger patients with certain types of ] or solid ], especially ] ]. |
|
|
|
|
|
It works by ] ], which is expressed in those tumors.<ref>{{cite journal | vauthors = Dimopoulos MA, Mitsiades CS, Anderson KC, Richardson PG | title = Tanespimycin as antitumor therapy | journal = Clinical Lymphoma, Myeloma & Leukemia | volume = 11 | issue = 1 | pages = 17–22 | date = February 2011 | pmid = 21454186 | doi = 10.3816/CLML.2011.n.002 }}</ref> |
|
|
|
|
|
It belongs to the family of ] called ]s. |
|
|
|
|
|
==Clinical trials== |
|
|
|
|
|
] conducted Phase 1<ref>{{ClinicalTrialsGov|NCT00093821|Phase 1 trial: 17-N-Allylamino-17-Demethoxygeldanamycin (17-AAG) in Treating Young Patients With Recurrent or Refractory Leukemia or Solid Tumors}}</ref><ref>{{ClinicalTrialsGov|NCT00079404|Phase 1 trial: 17-N-Allylamino-17-Demethoxygeldanamycin in Treating Young Patients With Relapsed or Refractory Solid Tumors or Leukemia}}</ref> and Phase 2 ]s. However, in 2010 the company halted ] of tanespimycin, during late-stage clinical trials as a potential treatment for multiple myeloma. While no definitive explanation was given, it has been suggested that Bristol-Myers Squibb halted development over concerns of the financial feasibility of tanespimycin development given the 2014 expiry of the patent on this compound, and the relative expense of manufacture.<ref name="available">{{Cite web | url=http://www.myelomabeacon.com/news/2010/07/22/tanespimycin-development-halted/ | archive-url = https://web.archive.org/web/20101228122346/http://www.myelomabeacon.com/news/2010/07/22/tanespimycin-development-halted/ | archive-date = 28 December 2010 |title = Bristol-Myers Squibb Halts Development of Tanespimycin | date = 22 July 2010 | work = The Myeloma Beacon }}</ref> |
|
|
|
|
|
== References == |
|
|
{{Reflist}} |
|
|
|
|
|
== External links == |
|
|
* |
|
|
* |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
] |