Revision as of 19:52, 13 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antineoplastic-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit |
Latest revision as of 13:29, 2 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,077 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
(15 intermediate revisions by 10 users not shown) |
Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{one source|date=August 2014}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
⚫ |
| verifiedrevid = 442308300 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 450347792 |
|
| IUPAC_name = ''N''-phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide |
|
| IUPAC_name = ''N''-phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide |
|
| image = Tariquidar.png |
|
| image = Tariquidar.png |
|
|
|
|
|
<!--Clinical data--> |
|
<!--Clinical data--> |
|
| tradename = |
|
| tradename = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_US = <!-- A / B / C / D / X --> |
|
| pregnancy_category = |
|
| pregnancy_category = |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
| legal_status = |
|
| legal_status = |
|
| routes_of_administration = |
|
| routes_of_administration = |
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 206873-63-4 |
|
| CAS_number = 206873-63-4 |
|
| ATC_prefix = none |
|
| ATC_prefix = none |
|
| ATC_suffix = |
|
| ATC_suffix = |
|
| ATC_supplemental = |
|
| ATC_supplemental = |
|
| PubChem = 148201 |
|
| PubChem = 148201 |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|
| DrugBank = |
|
| DrugBank = |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = J58862DTVD |
|
| UNII = J58862DTVD |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 348475 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 130650 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| chemical_formula = |
|
| chemical_formula = |
|
| C=38 | H=38 | N=4 | O=6 |
|
| C=38 | H=38 | N=4 | O=6 |
|
|
| smiles = COC1=C(C=C2CN(CCC2=C1)CCC3=CC=C(C=C3)NC(=O)C4=CC(=C(C=C4NC(=O)C5=CC6=CC=CC=C6N=C5)OC)OC)OC |
|
| molecular_weight = 646.73 g/mol |
|
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C38H38N4O6/c1-45-33-18-25-14-16-42(23-28(25)19-34(33)46-2)15-13-24-9-11-29(12-10-24)40-38(44)30-20-35(47-3)36(48-4)21-32(30)41-37(43)27-17-26-7-5-6-8-31(26)39-22-27/h5-12,17-22H,13-16,23H2,1-4H3,(H,40,44)(H,41,43) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = LGGHDPFKSSRQNS-UHFFFAOYSA-N |
|
|
|
|
}} |
|
}} |
|
|
|
|
|
'''Tariquidar''' (]/]) is a ] inhibitor<ref>Robey RW, Shukla S, Finley EM, Oldham RK, Barnett D, Ambudkar SV, Fojo T, Bates SE. Inhibition of P-glycoprotein (ABCB1)- and multidrug resistance-associated protein 1 (ABCC1)-mediated transport by the orally administered inhibitor, CBT-1((R)). Biochem Pharmacol'' 2008;3:1302-12. PMID 18234154.</ref> undergoing research as an adjuvant against multidrug resistance in cancer. |
|
'''Tariquidar''' (]/]) is a ] inhibitor<ref name="pmid18234154">{{cite journal | vauthors = Robey RW, Shukla S, Finley EM, Oldham RK, Barnett D, Ambudkar SV, Fojo T, Bates SE | title = Inhibition of P-glycoprotein (ABCB1)- and multidrug resistance-associated protein 1 (ABCC1)-mediated transport by the orally administered inhibitor, CBT-1((R)) | journal = Biochemical Pharmacology | volume = 75 | issue = 6 | pages = 1302–12 | date = March 2008 | pmid = 18234154 | pmc = 2346578 | doi = 10.1016/j.bcp.2007.12.001 }}</ref> undergoing research as an adjuvant against multidrug resistance in cancer. |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
] |
|
|
] |
|
|
|
|
|
{{antineoplastic-drug-stub}} |
|
{{antineoplastic-drug-stub}} |