Misplaced Pages

Tariquidar: Difference between revisions

Article snapshot taken from Wikipedia with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
Browse history interactively
Page 1
Page 2
← Previous editContent deleted Content addedVisualWikitext
Revision as of 19:52, 13 September 2011 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s): antineoplastic-drug-stub. See approval. Report errors and suggestions at User talk:PotatoBot.← Previous edit Latest revision as of 13:29, 2 April 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers173,077 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper 
(15 intermediate revisions by 10 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{one source|date=August 2014}}
{{Drugbox {{Drugbox
| Verifiedfields = changed
| verifiedrevid = 442308300
| Watchedfields = changed
| verifiedrevid = 450347792
| IUPAC_name = ''N''-phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide | IUPAC_name = ''N''-phenyl]carbamoyl]-4,5-dimethoxyphenyl]quinoline-3-carboxamide
| image = Tariquidar.png | image = Tariquidar.png


<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> | legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =


<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism =
| elimination_half-life = | elimination_half-life =
| excretion = | excretion =


<!--Identifiers--> <!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 206873-63-4 | CAS_number = 206873-63-4
| ATC_prefix = none | ATC_prefix = none
| ATC_suffix = | ATC_suffix =
| ATC_supplemental = | ATC_supplemental =
| PubChem = 148201 | PubChem = 148201
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = | DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = J58862DTVD | UNII = J58862DTVD
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 348475
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 130650


<!--Chemical data--> <!--Chemical data-->
| chemical_formula = | chemical_formula =
| C=38 | H=38 | N=4 | O=6 | C=38 | H=38 | N=4 | O=6
| smiles = COC1=C(C=C2CN(CCC2=C1)CCC3=CC=C(C=C3)NC(=O)C4=CC(=C(C=C4NC(=O)C5=CC6=CC=CC=C6N=C5)OC)OC)OC
| molecular_weight = 646.73 g/mol
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C38H38N4O6/c1-45-33-18-25-14-16-42(23-28(25)19-34(33)46-2)15-13-24-9-11-29(12-10-24)40-38(44)30-20-35(47-3)36(48-4)21-32(30)41-37(43)27-17-26-7-5-6-8-31(26)39-22-27/h5-12,17-22H,13-16,23H2,1-4H3,(H,40,44)(H,41,43)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = LGGHDPFKSSRQNS-UHFFFAOYSA-N

}} }}


'''Tariquidar''' (]/]) is a ] inhibitor<ref>Robey RW, Shukla S, Finley EM, Oldham RK, Barnett D, Ambudkar SV, Fojo T, Bates SE. Inhibition of P-glycoprotein (ABCB1)- and multidrug resistance-associated protein 1 (ABCC1)-mediated transport by the orally administered inhibitor, CBT-1((R)). Biochem Pharmacol'' 2008;3:1302-12. PMID 18234154.</ref> undergoing research as an adjuvant against multidrug resistance in cancer. '''Tariquidar''' (]/]) is a ] inhibitor<ref name="pmid18234154">{{cite journal | vauthors = Robey RW, Shukla S, Finley EM, Oldham RK, Barnett D, Ambudkar SV, Fojo T, Bates SE | title = Inhibition of P-glycoprotein (ABCB1)- and multidrug resistance-associated protein 1 (ABCC1)-mediated transport by the orally administered inhibitor, CBT-1((R)) | journal = Biochemical Pharmacology | volume = 75 | issue = 6 | pages = 1302–12 | date = March 2008 | pmid = 18234154 | pmc = 2346578 | doi = 10.1016/j.bcp.2007.12.001 }}</ref> undergoing research as an adjuvant against multidrug resistance in cancer.


==References== ==References==
{{Reflist}} {{Reflist}}




] ]
] ]
]

]
]


{{antineoplastic-drug-stub}} {{antineoplastic-drug-stub}}