| Revision as of 19:08, 9 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,031 edits Saving copy of the {{chembox}} taken from revid 444132760 of page Taurocholic_acid for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 21:52, 4 February 2024 edit Shinkolobwe (talk | contribs)Extended confirmed users, Pending changes reviewers18,763 edits Starting with an UppercaseTag: Shortdesc helper |
| Line 1: |
Line 1: |
|
|
{{Short description|Yellowish crystalline bile acid}} |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
| verifiedrevid = 402679583 |
|
| verifiedrevid = 470481809 |
|
| Name = Taurocholic acid |
|
| Name = Taurocholic acid |
|
|
| ImageFile_Ref = {{chemboximage|correct|??}} |
|
| ImageFile = Taurocholic acid.png |
|
| ImageFile = Taurocholic acid structure.png |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Taurocholic acid |
|
| ImageName = Taurocholic acid |
|
| IUPACName =2-{amino}ethanesulfonic acid |
|
| IUPACName = 2-(3α,7α,12α-Trihydroxy-5β-cholan-24-amido)ethane-1-sulfonic acid |
|
|
| SystematicName = 2-<nowiki/>{(4''R'')-4-phenanthren-1-yl]pentanamido}ethane-1-sulfonic acid |
|
| Section1 = {{Chembox Identifiers |
|
| Section1 = {{Chembox Identifiers |
|
|
| IUPHAR_ligand = 4547 |
|
| InChI = 1/C26H45NO7S/c1-15(4-7-23(31)27-10-11-35(32,33)34)18-5-6-19-24-20(14-22(30)26(18,19)3)25(2)9-8-17(28)12-16(25)13-21(24)29/h15-22,24,28-30H,4-14H2,1-3H3,(H,27,31)(H,32,33,34)/t15-,16+,17-,18-,19+,20+,21-,22+,24+,25+,26-/m1/s1 |
|
| InChI = 1/C26H45NO7S/c1-15(4-7-23(31)27-10-11-35(32,33)34)18-5-6-19-24-20(14-22(30)26(18,19)3)25(2)9-8-17(28)12-16(25)13-21(24)29/h15-22,24,28-30H,4-14H2,1-3H3,(H,27,31)(H,32,33,34)/t15-,16+,17-,18-,19+,20+,21-,22+,24+,25+,26-/m1/s1 |
|
| InChIKey = WBWWGRHZICKQGZ-HZAMXZRMBW |
|
| InChIKey = WBWWGRHZICKQGZ-HZAMXZRMBW |
| Line 16: |
Line 19: |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 81-24-3 |
|
| CASNo = 81-24-3 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5E090O0G3Z |
|
|
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
|
| ChEMBL = 224867 |
|
| ChEMBL = 224867 |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 6423 |
|
| ChemSpiderID = 6423 |
|
| PubChem = 6675 |
|
| PubChem = 6675 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ChEBI = 28865 |
|
| ChEBI = 28865 |
|
| SMILES = C(CCC(=O)NCCS(=O)(=O)O)1CC21((C32(C43(CC(C4)O)C)O)O)C |
|
| SMILES = C(CCC(=O)NCCS(=O)(=O)O)1CC21((C32(C43(CC(C4)O)C)O)O)C |
|
}} |
|
}} |
| Line 26: |
Line 33: |
|
|C=26|H=45|N=1|O=7|S=1 |
|
|C=26|H=45|N=1|O=7|S=1 |
|
| MolarMass = 515.7058 g/mol |
|
| MolarMass = 515.7058 g/mol |
|
| Density = |
|
| Density = |
|
| MeltingPtC = 125.0 |
|
| MeltingPtC = 125.0 |
|
| BoilingPt = |
|
| BoilingPt = |
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
'''Taurocholic acid''', known also as '''cholaic acid''', '''cholyltaurine''', or '''acidum cholatauricum''', is a ] yellowish crystalline ] involved in the ] of ]s. It occurs as a sodium ] in the ] of ]s. It is a ] of ] with ]. In medical use, it is administered as a ] and ].<ref>{{cite journal|doi=10.1002/hep.20090|pmid=14999673|title=Cellular regulation of hepatic bile acid transport in health and cholestasis|year=2004|last1=Anwer|first1=M. Sawkat|journal=Hepatology|volume=39|issue=3|pages=581–590|s2cid=2601263 }}</ref> |
|
|
|
|
|
] of taurocholic acid yields ]. |
|
|
|
|
|
For commercial use, taurocholic acid is manufactured from ] bile, a byproduct of the meat-processing industry.<ref> {{Webarchive|url=https://web.archive.org/web/20090421063404/http://www.glycofinechem.com/content/taurocholic-acid-sodium-salt |date=2009-04-21 }} at GlycoFineChem.com</ref> |
|
|
|
|
|
This acid is also one of the many molecules in the body that has ] as its precursor.{{cn|date=March 2022}} |
|
|
|
|
|
==Toxicity== |
|
|
The ] of taurocholic acid in newborn rats is 380 mg/kg.{{cn|date=March 2022}} |
|
|
|
|
|
==See also== |
|
|
* ] |
|
|
|
|
|
==References== |
|
|
{{Reflist}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |