| Revision as of 00:53, 11 September 2011 editYobot (talk | contribs)Bots4,733,870 editsm WP:CHECKWIKI error 18 fixes + general fixes (BRFA 15) using AWB (7832)← Previous edit |
Latest revision as of 19:00, 7 May 2023 edit undoLegionMammal978 (talk | contribs)Extended confirmed users7,894 edits move systematic name |
| (26 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
|
| Watchedfields = changed |
|
| Watchedfields = changed |
|
| verifiedrevid = 401018834 |
|
| verifiedrevid = 449646890 |
|
| Name = Techtochrysin |
|
| Name = Techtochrysin |
|
| ImageFile = Tectochrysin.svg |
|
| ImageFile = Tectochrysin.svg |
|
| ImageSize = 250px |
|
| ImageSize = 220 |
|
|
| ImageAlt = Skeletal formula |
| ⚫ |
| ImageName = Techtochrysin structure |
|
|
|
| ImageFile1 = Techtochrysin molecule ball.png |
|
| IUPACName = 5-hydroxy-7-methoxy-2-phenylchromen-4-one |
|
|
|
| ImageSize1 = 220 |
| ⚫ |
| OtherNames = Tectochrysin<br>Methyl chrysin<br>5-Hydroxy-7-methoxyflavone<br>7-Methoxy-5-hydroxyflavone |
|
|
|
| ImageAlt1 = Ball-and-stick model |
| ⚫ |
| Section1 = {{Chembox Identifiers |
|
|
⚫ |
| ImageName = Techtochrysin structure |
| ⚫ |
| CASNo = 520-28-5 |
|
|
|
| IUPACName = 5-Hydroxy-7-methoxyflavone |
| ⚫ |
| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O |
|
|
|
| SystematicName = 5-Hydroxy-7-methoxy-2-phenyl-4''H''-1-benzopyran-4-one |
| ⚫ |
| InChI = |
|
|
⚫ |
| OtherNames = Tectochrysin<br>Methyl chrysin<br>7-Methoxy-5-hydroxyflavone |
|
| PubChem = 5281954 |
|
|
⚫ |
|Section1={{Chembox Identifiers |
| ⚫ |
}} |
|
|
|
| CASNo_Ref = {{cascite|correct|??}} |
| ⚫ |
| Section2 = {{Chembox Properties |
|
|
⚫ |
| CASNo = 520-28-5 |
| ⚫ |
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>4</sub> |
|
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
| ⚫ |
| MolarMass = 268.26 g/mol |
|
|
|
| UNII = 9UBO28W2AK |
|
| ExactMass = 268.073559 u |
|
|
⚫ |
| SMILES = COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O |
| ⚫ |
| Density = |
|
|
| MeltingPt = |
|
| PubChem = 5281954 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
| ⚫ |
| BoilingPt = |
|
|
|
| ChemSpiderID = 4445231 |
| ⚫ |
}} |
|
|
|
| InChI = 1/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
|
|
| InChIKey = IRZVHDLBAYNPCT-UHFFFAOYAP |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = IRZVHDLBAYNPCT-UHFFFAOYSA-N |
|
⚫ |
| RTECS = |
|
|
| MeSHName = |
|
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
|
| KEGG = C11621 |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 9426 |
|
|
|
|
⚫ |
}} |
|
⚫ |
|Section2={{Chembox Properties |
|
⚫ |
| Formula = C<sub>16</sub>H<sub>12</sub>O<sub>4</sub> |
|
⚫ |
| MolarMass = 268.26 g/mol |
|
⚫ |
| Density = |
|
|
| MeltingPt = |
|
⚫ |
| BoilingPt = |
|
⚫ |
}} |
|
}} |
|
}} |
|
'''Techtochrysin''' is a chemical compound. It is a ], a flavonoid isolated from ''Prunus cerasus'',<ref></ref> the ], a plant native to much of Europe and southwest Asia. |
|
'''Techtochrysin''' is a chemical compound. It is an ], a flavonoid isolated from ''Prunus cerasus'',<ref></ref> the ], a plant native to much of Europe and southwest Asia. |
|
|
|
|
|
==Glycosides== |
|
== Glycosides == |
|
* Techtochrysin 5-] |
|
* Techtochrysin 5-] |
|
|
|
|
|
==References== |
|
== References == |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
|
| Line 36: |
Line 58: |
|
{{flavone}} |
|
{{flavone}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
|
|
|
|
{{Aromatic-stub}} |
|
] |
|