| Revision as of 07:44, 24 December 2010 editNono64 (talk | contribs)Autopatrolled, Pending changes reviewers, Rollbackers96,246 editsm cleanup← Previous edit |
Latest revision as of 21:04, 21 June 2019 edit undoEdgar181 (talk | contribs)Extended confirmed users196,325 editsm deprecated stub category (via WP:JWB) |
| (16 intermediate revisions by 8 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
|
| verifiedrevid = 403997908 |
|
| Name = Terflavin B |
|
| Name = Terflavin B |
|
| ImageFile = Terflavin B.PNG |
|
| ImageFile = Terflavin B.png |
|
| ImageSize = 200px |
|
|
| ImageName = Chemical structure of terflavin B |
|
| ImageName = Chemical structure of terflavin B |
|
| ImageAlt = Chemical structure of terflavin B |
|
| ImageAlt = Chemical structure of terflavin B |
|
| IUPACName = |
|
| IUPACName = |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 103744-86-1 |
|
| CASNo = 103744-86-1 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
| CASOther = |
|
|
| PubChem = 44584734 |
|
| PubChem = 44584734 |
|
| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
|
| SMILES = C1=C(C=C(C(=C1O)O)O)C(=O)OCC2C(C(C(C(O2)O)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C5C6=C4C(=O)OC7=C6C(=CC(=C7O)O)C(=O)O5)O)O)O)O)O |
| Line 16: |
Line 17: |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>34</sub>H<sub>24</sub>O<sub>22</sub> |
|
| Formula = C<sub>34</sub>H<sub>24</sub>O<sub>22</sub> |
|
| MolarMass = 784.54 g/mol |
|
| MolarMass = 784.54 g/mol |
|
| ExactMass = 784.075922 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Terflavin B''' is a ]. It can be found in ''Myrobalanus chebula'' ('']''), the black chebulic, and in '']'', the Indian almond<ref></ref>. |
|
'''Terflavin B''' is an ], a type of hydrolysable tannin. It can be found in ''Myrobalanus chebula'' ('']''), the black chebulic, and in '']'', the Indian almond.<ref></ref> |
|
|
|
|
|
|
It is formed from a ] dilactone and a ] linked to a glucose molecules. |
| ⚫ |
==References== |
|
|
|
|
|
⚫ |
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
{{Ellagitannin}} |
|
{{Hydrolysable tannin}} |
|
|
|
|
|
|
⚫ |
] |
|
] |
|
| ⚫ |
] |
|
|
] |
|
|
|
|
|
|
{{Polyphenol-stub}} |
|
{{aromatic-stub}} |