| Revision as of 08:37, 1 June 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (changes to verified fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref') per Chem/Drugbox validation (rep← Previous edit |
Latest revision as of 18:05, 15 December 2024 edit undoBosula (talk | contribs)Extended confirmed users601 edits add mode of action and IRAC group.Tag: Visual edit |
| (24 intermediate revisions by 18 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
| Verifiedfields = changed |
|
| Verifiedfields = changed |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 413828492 |
|
| verifiedrevid = 431966904 |
|
|ImageFile=Tetradifon.png |
|
| ImageFile=Tetradifon.png |
|
|ImageSize=200px |
|
| ImageSize=200px |
|
|IUPACName=1,2,4-Trichloro-5-(4-chlorophenyl)sulfonylbenzene |
|
|
|
| PIN=1,2,4-Trichloro-5-(4-chlorobenzene-1-sulfonyl)benzene |
|
|OtherNames= |
|
| OtherNames= |
|
|Section1={{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
| CASNo_Ref = {{cascite}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo=116-29-0 |
|
| CASNo=116-29-0 |
|
| PubChem=8305 |
|
| PubChem=8305 |
|
| KEGG_Ref = {{keggcite|changed|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = C18451 |
|
| KEGG = C18451 |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
| ⚫ |
| SMILES=C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl)Cl |
|
|
|
| UNII = TIP8EA8VTS |
|
⚫ |
| SMILES=C1=CC(=CC=C1S(=O)(=O)C2=CC(=C(C=C2Cl)Cl)Cl)Cl |
|
|
| EINECS = 204-134-2 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 8004 |
|
|
| InChI = 1/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
|
|
| InChIKey = MLGCXEBRWGEOQX-UHFFFAOYAO |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C12H6Cl4O2S/c13-7-1-3-8(4-2-7)19(17,18)12-6-10(15)9(14)5-11(12)16/h1-6H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = MLGCXEBRWGEOQX-UHFFFAOYSA-N |
|
|
| RTECS = |
|
|
| MeSHName = |
|
|
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEBI = 39330 |
|
}} |
|
}} |
|
|Section2={{Chembox Properties |
|
|Section2={{Chembox Properties |
|
|
| C=12 |
|
| Formula=C<sub>12</sub>H<sub>6</sub>Cl<sub>4</sub>O<sub>2</sub>S |
|
|
|
| H=6 |
|
| MolarMass=356.05 g/mol |
|
|
|
| Cl=4 |
|
| Appearance= |
|
|
| Density= |
|
| O=2 |
|
| MeltingPt= |
|
| S=1 |
|
| BoilingPt= |
|
| Appearance= |
|
| Solubility= |
|
| Density= |
|
|
| MeltingPt= |
|
|
| BoilingPt= |
|
|
| Solubility= |
|
}} |
|
}} |
|
|Section3={{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards= |
|
| MainHazards= |
|
| FlashPt= |
|
| FlashPt= |
|
|
| AutoignitionPt = |
|
| Autoignition= |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
|
|
|
|
|
'''Tetradifon''' is a ].<ref>{{cite journal|title=Comparison of Tetradifon Emulsifiable Concentrate and Wettable Powder Formulations Against the Two-Spotted Spider Mite|journal=Journal of Economic Entomology|volume=59|issue=2|pages=303–306|doi=10.1093/jee/59.2.303|year=1966|last1=Lippold|first1=P. C}}</ref> It acts by inhibiting ] ] and is in ] group 12C. |
|
'''Tetradifon''' is an ].<ref>http://www.pesticideinfo.org/Detail_Chemical.jsp?Rec_Id=PC33608</ref> |
|
|
|
|
|
|
== References == |
|
== References == |
|
{{reflist}} |
|
{{reflist}} |
|
|
|
|
|
|
==External links== |
|
|
*{{PPDB|627}} |
|
{{insecticides}} |
|
{{insecticides}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{organic-compound-stub}} |
|
{{organohalide-stub}} |
|
|
|
|
] |
|
|
] |
|