| Revision as of 12:43, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,044 edits Saving copy of the {{chembox}} taken from revid 444220459 of page Tetramethrin for the Chem/Drugbox validation project (updated: ''). |
Latest revision as of 14:30, 16 September 2024 edit Wmigda (talk | contribs)282 editsm Added wiki-link expanding Category 2 carcinogen meaning in the EU |
| Line 1: |
Line 1: |
|
{{ambox | text = This page contains a copy of the infobox ({{tl|chembox}}) taken from revid of page ] with values updated to verified values.}} |
|
|
{{chembox |
|
{{chembox |
|
|
| Watchedfields = changed |
|
| verifiedrevid = 408928455 |
|
| verifiedrevid = 470604751 |
|
| Name = Tetramethrin |
|
|
| ImageFile1 = Tetramethrin-stereoisomers-2D-skeletal.png |
|
| Name = Tetramethrin |
|
|
| ImageFile1 = Tetramethrin-stereoisomers-2D-skeletal.png |
|
| ImageSize1 = 200px |
|
| ImageSize1 = |
|
| ImageName1 = Tetramethrin |
|
| ImageName1 = Tetramethrin |
|
| ImageFile2 = Tetramethrin 3D.png |
|
| ImageFile2 = Tetramethrin 3D.png |
|
| ImageSize2 = 200px |
|
| ImageSize2 = |
|
| ImageName2 = 3D model |
|
| ImageName2 = 3D model |
|
| IUPACName = (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|
| IUPACName = (1,3-Dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
|
|
| PIN = (1,3-Dioxo-1,3,4,5,6,7-hexahydro-2''H''-isoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropane-1-carboxylate |
|
| IUPACName_hidden = yes |
|
|
| Section1 = {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
|
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
|
| ChemSpiderID = 75773 |
|
|
| PubChem = 83975 |
|
| ChemSpiderID = 75773 |
|
|
| PubChem = 83975 |
|
|
| EINECS = 214-619-0 |
|
|
| RTECS = GZ1730000 |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
| KEGG = D07368 |
|
| KEGG = D07368 |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| UNII = Z72930Q46K |
|
| UNII = Z72930Q46K |
|
| InChI = 1/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
|
| InChI = 1/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
|
| InChIKey = CXBMCYHAMVGWJQ-UHFFFAOYAA |
|
| InChIKey = CXBMCYHAMVGWJQ-UHFFFAOYAA |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChI = 1S/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
|
| StdInChI = 1S/C19H25NO4/c1-11(2)9-14-15(19(14,3)4)18(23)24-10-20-16(21)12-7-5-6-8-13(12)17(20)22/h9,14-15H,5-8,10H2,1-4H3 |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
|
| StdInChIKey = CXBMCYHAMVGWJQ-UHFFFAOYSA-N |
|
| StdInChIKey = CXBMCYHAMVGWJQ-UHFFFAOYSA-N |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo_Ref = {{cascite|correct|CAS}} |
|
| CASNo = 7696-12-0 |
|
| CASNo = 7696-12-0 |
|
|
| ChEBI_Ref = {{ebicite|correct|EBI}} |
|
| ATCvet = yes |
|
|
⚫ |
| ChEBI = 39397 |
| ⚫ |
| ATCCode_prefix = P53 |
|
| ⚫ |
| ATCCode_suffix = AC13 |
|
| ⚫ |
| ChEBI = 39397 |
|
|
| SMILES = O=C1\C3=C(/C(=O)N1COC(=O)C2C(\C=C(/C)C)C2(C)C)CCCC3 |
|
| SMILES = O=C1\C3=C(/C(=O)N1COC(=O)C2C(\C=C(/C)C)C2(C)C)CCCC3 |
|
}} |
|
}} |
|
| Section2 = {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>19</sub>H<sub>25</sub>NO<sub>4</sub> |
|
| Formula = C<sub>19</sub>H<sub>25</sub>NO<sub>4</sub> |
|
| MolarMass = 331.406 g/mol |
|
| MolarMass = 331.406 g/mol |
|
|
| Appearance = white crystalline solid |
|
| Density = |
|
|
|
| Odor = strong, ]-like |
|
| MeltingPt = 65-80 °C |
|
|
|
| Density = 1.108 g/cm<sup>3</sup> |
| ⚫ |
| BoilingPt = }} |
|
|
|
| MeltingPtC = 65 to 80 |
|
|
| MeltingPt_notes = |
|
⚫ |
| BoilingPt = |
|
|
| Solubility = 0.00183 g/100 mL |
|
|
| SolubleOther = soluble in ], ] <br> slightly soluble in ], ], ] <br> very slightly soluble in ] |
|
|
| VaporPressure = 10 Pa |
|
|
| LogP = 4.73 |
|
|
| RefractIndex = 1.5175 |
|
}} |
|
}} |
|
|
|Section6={{Chembox Pharmacology |
|
⚫ |
| ATCCode_prefix = P03 |
|
⚫ |
| ATCCode_suffix = BA04 |
|
|
| ATC_Supplemental = {{ATCvet|P53|AC13}} |
|
|
}} |
|
|
|Section7={{Chembox Hazards |
|
|
| LD50 = 20,000 mg/kg (rat, oral) |
|
|
}} |
|
|
}} |
|
|
|
|
|
'''Tetramethrin''' is a potent synthetic ] in the ] family. It is a white ]line ] with a ] of 65–80 °C. The commercial product is a mixture of ]s. |
|
|
|
|
|
It is commonly used as an insecticide, and affects the insect's nervous system. It is found in many household insecticide products.<ref>{{CPID|id=596}}</ref> |
|
|
|
|
|
Tetramethrin has an expected half-life of 12.5–14 days in soil and 13–25 days in water.<ref>{{cite web |title=Re-evaluation Decision RVD2018-01, Tetramethrin and Its Associated End-use Products |date=23 February 2018 |url=https://www.canada.ca/en/health-canada/services/consumer-product-safety/reports-publications/pesticides-pest-management/decisions-updates/reevaluation-decision/2018/tetramethrin.html}}</ref> Tetramethrin was classified as a ] ] in 2018 by ] of the ].<ref>{{cite web |title=Commission Regulation (EU) 2018/1480 of 4 October 2018 amending, for the purposes of its adaptation to technical and scientific progress, Regulation (EC) No 1272/2008 of the European Parliament and of the Council on classification, labelling and packaging of substances and mixtures and correcting Commission Regulation (EU) 2017/776 (Text with EEA relevance.) |date=4 October 2018 |url=https://op.europa.eu/en/publication-detail/-/publication/fe49a71c-c862-11e8-9424-01aa75ed71a1}}</ref> |
|
|
|
|
|
==References== |
|
|
{{reflist}} |
|
|
|
|
|
==External links== |
|
|
* |
|
|
* |
|
|
*{{PPDB|628}} |
|
|
{{insecticides}} |
|
|
|
|
|
] |
|
|
] |
|
|
] |
|
|
] |
|
|
|
|
|
{{organic-compound-stub}} |