| Revision as of 22:19, 18 September 2011 editBogBot (talk | contribs)Bots53,132 edits populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot← Previous edit |
Latest revision as of 19:06, 31 March 2023 edit undo5.142.105.225 (talk)No edit summary |
| (14 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
{{Drugbox |
|
{{Drugbox |
|
| verifiedrevid = 398759566 |
|
| verifiedrevid = 451222566 |
|
| IUPAC_name = 3,3-bis(ethylsulfonyl)pentane |
|
| IUPAC_name = 3,3-bis(ethylsulfonyl)pentane |
|
| image = Tetronal.svg |
|
| image = Tetronal structure.svg |
|
| width = 250 |
|
| width = 250 |
|
|
|
|
| Line 10: |
Line 11: |
|
|
|
|
|
<!--Identifiers--> |
|
<!--Identifiers--> |
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| CAS_number = 2217-59-6 |
|
| CAS_number = 2217-59-6 |
|
| PubChem = 75197 |
|
| PubChem = 75197 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = 5XG2X0OW34 |
|
|
| ChemSpiderID = 67743 |
|
|
|
|
|
<!--Chemical data--> |
|
<!--Chemical data--> |
|
| C=9 | H=20 | O=4 | S=2 |
|
| C=9 | H=20 | O=4 | S=2 |
|
| molecular_weight = 256.383 g/mol |
|
|
| smiles = CCC(CC)(S(=O)(=O)CC)S(=O)(=O)CC |
|
| smiles = CCC(CC)(S(=O)(=O)CC)S(=O)(=O)CC |
|
|
| StdInChI = 1S/C9H20O4S2/c1-5-9(6-2,14(10,11)7-3)15(12,13)8-4/h5-8H2,1-4H3 |
|
|
| StdInChIKey = VTZYVPLHCQBWSP-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Tetronal''' is a ]<ref>(1907). . N. Y.: Merck & Co., p. 436.</ref> and ] ] with ] ]s{{Citation needed|date=November 2010}}. It is not as effective as trional.<ref>Coblentz, Virgil (1908). . Boston: Apothecary Publishing Co., p. 123.</ref> |
|
'''Tetronal''' is a ]<ref>{{cite book | date = 1907 | chapter-url = https://archive.org/stream/cu31924003469677#page/n453/mode/2up | chapter = Tetronal | title = Merck's 1907 Index | location = New York | publisher = Merck & Co. | page = 436 }}</ref> and ] ] with ] ]s{{Citation needed|date=November 2010}}. It is not as effective as trional.<ref>{{cite book | vauthors = Coblentz V | date = 1908 | url = https://books.google.com/books?id=L3PtAAAAMAAJ&pg=PA123 | title = The Newer Remedies | location = Boston | publisher = Apothecary Publishing Co. | page = 123 }}</ref> |
|
|
|
|
|
==History== |
|
==History== |
|
Tetronal was prepared and introduced by ] and ] in 1888.<ref>Drinkwater, H. (1924). . New York: The Macmillan Company, p. 40.</ref> |
|
Tetronal was introduced by ] and ] in 1888.<ref>{{cite book | vauthors = Drinkwater H | date = 1924 | url = https://archive.org/stream/fiftyyearsofmedi00drin#page/40/mode/2up | title = Fifty years of medical progress, 1873-1922 | location = New York | publisher = The Macmillan Company | page = 40 }}</ref> |
|
|
|
|
|
==See also== |
|
==See also== |
| Line 29: |
Line 35: |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
{{Hypnotics}} |
|
{{Hypnotics}} |
|
{{General anesthetics}} |
|
{{General anesthetics}} |
|
{{GABAergics}} |
|
{{GABAAR PAMs}} |
|
{{GABAAergics}} |
|
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
|
] |
|
|
|
|
|
|
|
|
|
{{nervous-system-drug-stub}} |
|
{{sedative-stub}} |