| Revision as of 06:33, 20 January 2011 editPashihiko (talk | contribs)Extended confirmed users3,559 editsNo edit summary← Previous edit |
Latest revision as of 20:29, 29 January 2023 edit undoEntranced98 (talk | contribs)Extended confirmed users, Pending changes reviewers, Rollbackers172,984 edits Importing Wikidata short description: "Chemical compound"Tag: Shortdesc helper |
| (34 intermediate revisions by 19 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
|
|
|
{{refimprove|date=August 2014}} |
|
|
|
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = 5- pyrimidine- 2,4- diamine |
|
|
|
| Watchedfields = changed |
| ⚫ |
| image = Tetroxoprim.svg |
|
|
|
| verifiedrevid = 408927686 |
| ⚫ |
| CAS_number = 53808-87-0 |
|
|
⚫ |
| IUPAC_name = 5-pyrimidine-2,4-diamine |
|
| CAS_supplemental = |
|
|
⚫ |
| image = Tetroxoprim.svg |
| ⚫ |
| ATC_prefix = J01 |
|
|
|
|
| ⚫ |
| ATC_suffix = EE06 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_supplemental = (with ]) |
|
|
|
| tradename = |
| ⚫ |
| PubChem = 65450 |
|
|
| DrugBank = |
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
| ⚫ |
| KEGG = D06097 |
|
|
| chemical_formula = |
|
| pregnancy_category = |
|
⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
| ⚫ |
| C=16 | H=22 | N=4 | O=4 |
|
|
⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
| molecular_weight = 334.70 g/mol |
|
|
⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
| ⚫ |
| smiles = COCCOC1=C(C=C(C=C1OC)CC2=CN=C(N=C2N)N)OC |
|
|
⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
| ⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
| legal_status = |
|
⚫ |
| routes_of_administration = |
| ⚫ |
| metabolism = |
|
|
|
|
|
|
<!--Pharmacokinetic data--> |
|
⚫ |
| bioavailability = |
|
|
| protein_bound = |
|
⚫ |
| metabolism = |
|
| elimination_half-life = |
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
|
|
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> |
|
|
|
<!--Identifiers--> |
| ⚫ |
| pregnancy_US = <!-- A / B / C / D / X --> |
|
|
|
| CAS_number_Ref = {{cascite|correct|??}} |
|
| pregnancy_category= |
|
|
⚫ |
| CAS_number = 53808-87-0 |
| ⚫ |
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--> |
|
|
⚫ |
| ATC_prefix = J01 |
| ⚫ |
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --> |
|
|
⚫ |
| ATC_suffix = EE06 |
| ⚫ |
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --> |
|
|
⚫ |
| ATC_supplemental = (with ]) |
| ⚫ |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
|
|
⚫ |
| PubChem = 65450 |
|
| legal_status = |
|
|
|
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| ⚫ |
| routes_of_administration = |
|
|
|
| DrugBank = |
|
|
| UNII_Ref = {{fdacite|changed|FDA}} |
|
|
| UNII = 5R6712AY0K |
|
|
| KEGG_Ref = {{keggcite|correct|kegg}} |
|
⚫ |
| KEGG = D06097 |
|
|
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|
|
| ChEMBL = 32039 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 58910 |
|
|
|
|
|
<!--Chemical data--> |
|
|
| chemical_formula = |
|
⚫ |
| C=16 | H=22 | N=4 | O=4 |
|
⚫ |
| smiles = COCCOC1=C(C=C(C=C1OC)CC2=CN=C(N=C2N)N)OC |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChI = 1S/C16H22N4O4/c1-21-4-5-24-14-12(22-2)7-10(8-13(14)23-3)6-11-9-19-16(18)20-15(11)17/h7-9H,4-6H2,1-3H3,(H4,17,18,19,20) |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = WSWJIZXMAUYHOE-UHFFFAOYSA-N |
|
}} |
|
}} |
|
|
|
|
|
'''Tetroxoprim''' (]) is a derivative of ]. It was first described in 1979.<ref>{{cite journal |author=Aschhoff HS, Vergin H |title=Tetroxoprim—a new inhibitor of bacterial dihydrofolate reductase |journal=J Antimicrob Chemother |volume=5 |issue=B |pages=19–25 |year=1979 |month=November |pmid=43863 |doi= |url=}}</ref> |
|
'''Tetroxoprim''' (]) is a derivative of ]. It was first described in 1979.<ref>{{cite journal |vauthors=Aschhoff HS, Vergin H |title=Tetroxoprim—a new inhibitor of bacterial dihydrofolate reductase |journal=J Antimicrob Chemother |volume=5 |issue=B |pages=19–25 |date=November 1979 |pmid=43863 |doi= 10.1093/jac/5.supplement_b.19}}</ref><ref name="auto"/><ref name="auto1"/> |
|
|
|
|
|
Its chemical formula is C=16 | H=22 | N=4 | O=4. <ref name="auto">{{Cite web|url=https://pubchem.ncbi.nlm.nih.gov/compound/65450|title=Tetroxoprim|website=pubchem.ncbi.nlm.nih.gov}}</ref><ref name="auto1">{{Cite web|url=https://www.sciencedirect.com/topics/nursing-and-health-professions/tetroxoprim|title=Tetroxoprim - an overview | ScienceDirect Topics|website=www.sciencedirect.com}}</ref> |
|
|
|
|
|
==References== |
|
==References== |
|
{{Reflist}} |
|
{{Reflist}} |
|
|
|
| ⚫ |
{{antibiotic-stub}} |
|
|
|
|
|
|
{{Sulfonamides and trimethoprim}} |
|
{{Sulfonamides and trimethoprim}} |
|
|
|
|
|
] |
|
] |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
⚫ |
{{antibiotic-stub}} |