Misplaced Pages

:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Thiamylal: Difference between pages - Misplaced Pages

Article snapshot taken from[REDACTED] with creative commons attribution-sharealike license. Give it a read and then ask your questions in the chat. We can research this topic together.
(Difference between pages)
Page 1
Page 2
Content deleted Content addedVisualWikitext
Revision as of 12:57, 10 January 2012 editBeetstra (talk | contribs)Edit filter managers, Administrators172,074 edits Saving copy of the {{drugbox}} taken from revid 456895720 of page Thiamylal for the Chem/Drugbox validation project (updated: '').  Latest revision as of 03:12, 12 January 2025 edit Arthurfragoso (talk | contribs)Extended confirmed users, Template editors4,591 edits dark mode fix 
Line 1: Line 1:
{{Short description|Chemical compound}}
{{ambox | text = This page contains a copy of the infobox ({{tl|drugbox}}) taken from revid of page ] with values updated to verified values.}}
{{Drugbox {{Drugbox
| Verifiedfields = changed | Watchedfields = changed
| verifiedrevid = 418293178 | verifiedrevid = 470606310
| IUPAC_name = 5-allyl-5-(1-methylbutyl)-2-thioxodihydropyrimidine-4,6(1''H'',5''H'')-dione | IUPAC_name = 5-(Pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidenedihydropyrimidine-4,6(1''H'',5''H'')-dione
| image = thiamylal.png | image = ThiamylalSVG.svg
| image_class = skin-invert-image
| width = 100 | width = 100

<!--Clinical data--> <!--Clinical data-->
| tradename = | tradename =
Line 14: Line 14:
| pregnancy_category = | pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_BR = B1
⚫ | legal_CA = Schedule III
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=] |language=pt-BR |publication-date=2023-04-04}}</ref>
⚫ | legal_CA = Schedule IV
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = Schedule III | legal_US = Schedule III
| legal_status = | legal_status =
| routes_of_administration = | routes_of_administration =

<!--Pharmacokinetic data--> <!--Pharmacokinetic data-->
| bioavailability = | bioavailability =
| protein_bound = | protein_bound =
| metabolism = | metabolism = Hepatic
| elimination_half-life = | elimination_half-life = 14.3 h (cats)
| excretion = | excretion =

<!--Identifiers--> <!--Identifiers-->
| IUPHAR_ligand = 7305
| CASNo_Ref = {{cascite|correct|CAS}}
| CAS_number_Ref = {{cascite|correct|??}} | CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 77-27-0 | CAS_number = 77-27-0
Line 35: Line 35:
| ATC_suffix = AF90 | ATC_suffix = AF90
| PubChem = 3032285 | PubChem = 3032285
| DrugBank_Ref = {{drugbankcite|changed|drugbank}} | DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01154 | DrugBank = DB01154
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
Line 41: Line 41:
| UNII_Ref = {{fdacite|correct|FDA}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 01T23W89FR | UNII = 01T23W89FR
| KEGG_Ref = {{keggcite|changed|kegg}} | KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D06106 | KEGG = D06106
| ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9536 | ChEBI = 9536
| ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 440 | ChEMBL = 440

<!--Chemical data--> <!--Chemical data-->
| C=12 | H=18 | N=2 | O=2 | S=1 | C=12 | H=18 | N=2 | O=2 | S=1
| molecular_weight = 254.35 g/mol
| smiles = O=C1NC(=S)NC(=O)C1(C(C)CCC)C\C=C | smiles = O=C1NC(=S)NC(=O)C1(C(C)CCC)C\C=C
| InChI = 1/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)
| InChIKey = XLOMZPUITCYLMJ-UHFFFAOYAG
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17) | StdInChI = 1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)
Line 60: Line 56:
| synonyms = Thiamylal, Thioseconal, Surital | synonyms = Thiamylal, Thioseconal, Surital
}} }}

'''Thiamylal''' ('''Surital''') is a ] derivative invented in the 1950s. It has ], ], and ] effects, and is used as a strong but short acting sedative. Thiamylal is still in current use, primarily for induction in ] ]<ref name="pmid16640004">{{cite journal | vauthors = Hsieh MY, Hung GY, Hsieh YL, Chang CY, Hwang B | title = Deep sedation with methohexital or thiamylal with midazolam for invasive procedures in children with acute lymphoblastic leukemia | journal = Acta Paediatrica Taiwanica = Taiwan Er Ke Yi Xue Hui Za Zhi | volume = 46 | issue = 5 | pages = 294–300 | date = 2005 | pmid = 16640004 }}</ref> or as an anticonvulsant to counteract side effects from other anaesthetics.<ref name="pmid17339174">{{cite journal | vauthors = Tsai CJ, Wang HM, Lu IC, Tai CF, Wang LF, Soo LY, Lu DV | title = Seizure after local anesthesia for nasopharyngeal angiofibroma | journal = The Kaohsiung Journal of Medical Sciences | volume = 23 | issue = 2 | pages = 97–100 | date = February 2007 | pmid = 17339174 | doi = 10.1016/S1607-551X(09)70383-3 | doi-access = free }}</ref> It is the thiobarbiturate analogue of ].

== References ==
<references />

{{Sedatives}}
{{GABAA receptor positive modulators}}
{{Xenobiotic-sensing receptor modulators}}
{{General anesthetics}}

]
]
]


{{sedative-stub}}
Misplaced Pages:WikiProject Chemicals/Chembox validation/VerifiedDataSandbox and Thiamylal: Difference between pages Add topic