| Revision as of 17:39, 29 July 2010 editPotatoBot (talk | contribs)Bots51,239 editsm Stub sorting and placement of stub template(s)← Previous edit |
Latest revision as of 01:01, 8 October 2023 edit undoMfernflower (talk | contribs)Extended confirmed users7,828 edits →Synthesis |
| (26 intermediate revisions by 17 users not shown) |
| Line 1: |
Line 1: |
|
|
{{Short description|Chemical compound}} |
|
|
{{refimprove|date=January 2017}} |
|
{{Drugbox |
|
{{Drugbox |
|
|
| Verifiedfields = changed |
| ⚫ |
| IUPAC_name = ''N'',''N'',''N''-trimethyl-1-(10''H''-phenothiazin-10-yl)propan-2-aminium |
|
|
|
| verifiedrevid = 376122662 |
| ⚫ |
| image = Thiazinamium.png |
|
|
⚫ |
| IUPAC_name = ''N'',''N'',''N''-trimethyl-1-(10''H''-phenothiazin-10-yl)propan-2-aminium |
| ⚫ |
| imagename = Thiazinamium |
|
|
⚫ |
| image = Thiazinamium.png |
| ⚫ |
| CAS_number = 2338-21-8 |
|
|
⚫ |
| caption = Thiazinamium |
| ⚫ |
| ATC_prefix = R06 |
|
|
|
<!--Clinical data--> |
| ⚫ |
| ATC_suffix = AD06 |
|
|
|
| tradename = |
| ⚫ |
| PubChem = 6016 |
|
|
⚫ |
| pregnancy_category = |
| ⚫ |
| C = 18 | H = 23 | N = 2 | S = 1 |charge= + |
|
|
⚫ |
| legal_status = |
|
| molecular_weight = 299.45 g/mol |
|
|
⚫ |
| routes_of_administration = |
| ⚫ |
| smiles = CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)(C)(C)C |
|
|
|
<!--Pharmacokinetic data--> |
|
| bioavailability = |
|
| bioavailability = |
|
| protein_bound = |
|
| protein_bound = |
|
| metabolism = |
|
|
| elimination_half-life = |
|
| metabolism = |
|
|
| elimination_half-life = |
|
| excretion = |
|
| excretion = |
|
|
<!--Identifiers--> |
| ⚫ |
| pregnancy_category= |
|
|
|
| CAS_number_Ref = {{cascite|correct|CAS}} |
| ⚫ |
| legal_status = |
|
|
⚫ |
| CAS_number = 58-34-4 |
| ⚫ |
| routes_of_administration = |
|
|
⚫ |
| ATC_prefix = R06 |
|
⚫ |
| ATC_suffix = AD06 |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII = IA16WBX317 |
|
⚫ |
| PubChem = 6015 |
|
|
| ChemSpiderID = 5793 |
|
|
|
|
|
| index2_label = thiazinamium |
|
|
| CAS_number2_Ref = {{cascite|correct|CAS}} |
|
|
| CAS_number2 = 2338-21-8 |
|
|
| UNII2_Ref = {{fdacite|correct|FDA}} |
|
|
| UNII2 = 666W2P28N2 |
|
|
<!--Chemical data--> |
|
⚫ |
| C=18 | H=23 | N=2 | S=1| charge = + |
|
⚫ |
| smiles = CC(CN1C2=CC=CC=C2SC3=CC=CC=C31)(C)(C)C |
|
|
| StdInChI = 1S/C18H23N2S.CH4O4S/c1-14(20(2,3)4)13-19-15-9-5-7-11-17(15)21-18-12-8-6-10-16(18)19;1-5-6(2,3)4/h5-12,14H,13H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
|
|
| StdInChIKey = BVIDQAVCCRUFGU-UHFFFAOYSA-M |
|
}} |
|
}} |
|
|
|
|
|
'''Thiazinamium metilsulfate''' (]) or '''thiazinam''' is an ]. The ] is '''thiazinamium chloride''' (with a different ]). |
|
'''Thiazinamium metilsulfate''' (]) or '''thiazinam''' is an ]. The ] is '''thiazinamium chloride''' (with a different ]). |
|
|
|
|
|
== Synthesis == |
|
|
Since many of the uses of antihistamines involve conditions such as rashes, which should be treatable by local application, there is some rationale for developing drugs for topical use. The known side effects of antihistamines could in principle be avoided if the drug were functionalized to avoid systemic absorption. The known poor absorption of ] salts make such derivatives attractive for nonabsorbable antihistamines for topical use. |
|
|
] and ].<ref>{{cite journal | vauthors = Lewis AJ, Dervinis A, Carlson RP, Rosenthale E, Daniel WC |title=Thiazinamium chloride: A bronchodilator with antiallergic activity in animals|journal=Journal of Allergy and Clinical Immunology|volume=69|pages=155|year=1982 |doi=10.1016/S0091-6749(62)80531-4|doi-access=free}}</ref>]] |
|
|
|
|
|
== See also == |
|
== See also == |
|
* ] |
|
* ] |
|
|
*] |
|
|
|
|
|
== References == |
|
== References == |
|
{{Reflist|2}} |
|
{{Reflist}} |
|
|
|
|
|
|
|
|
|
{{Antihistamines}} |
|
{{Cholinergics}} |
|
{{Cholinergics}} |
|
{{Histaminergics}} |
|
{{Histaminergics}} |
| Line 36: |
Line 61: |
|
] |
|
] |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{respiratory-system-drug-stub}} |
|
{{respiratory-system-drug-stub}} |