| Revision as of 18:10, 4 August 2011 editCheMoBot (talk | contribs)Bots141,565 edits Updating {{chembox}} (no changed fields - added verified revid - updated 'UNII_Ref', 'ChemSpiderID_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (← Previous edit |
Latest revision as of 19:00, 18 August 2022 edit undoFswitzer4 (talk | contribs)Extended confirmed users10,990 editsm Added UNII |
| (16 intermediate revisions by 11 users not shown) |
| Line 1: |
Line 1: |
|
{{chembox |
|
{{chembox |
|
|
| Verifiedfields = changed |
| ⚫ |
| verifiedrevid = 440962759 |
|
|
|
| Watchedfields = changed |
|
⚫ |
| verifiedrevid = 443051844 |
|
| Name = Thunberginol B |
|
| Name = Thunberginol B |
|
| ImageFile = Thunberginol B.png |
|
| ImageFile = Thunberginol B.svg |
|
| ImageSize = 200px |
|
| ImageSize = 200px |
|
| ImageName = Chemical structure of thunberginol B |
|
| ImageName = Chemical structure of thunberginol B |
|
| ImageAlt = Chemical structure of thunberginol B |
|
| ImageAlt = Chemical structure of thunberginol B |
|
| IUPACName = 3-(3,4-dihydroxyphenyl)-6,8-dihydroxyisochromen-1-one |
|
| PIN = 3-(3,4-Dihydroxyphenyl)-6,8-dihydroxy-1''H''-2-benzopyran-1-one |
|
| OtherNames = <!-- <br> --> |
|
| OtherNames = <!-- <br> --> |
|
|Section1= {{Chembox Identifiers |
|
|Section1={{Chembox Identifiers |
|
|
| CASNo_Ref = {{cascite|correct|??}} |
|
| CASNo = 147666-81-7 |
|
| CASNo = 147666-81-7 |
|
| CASNo_Ref = |
|
| CASNoOther = |
|
|
| UNII_Ref = {{fdacite|correct|FDA}} |
|
| CASOther = |
|
|
|
| UNII = D2866L3MW5 |
|
| PubChem = 5473310 |
|
| PubChem = 5473310 |
|
|
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|
|
| ChemSpiderID = 4583010 |
|
| SMILES = C1=CC(=C(C=C1C2=CC3=CC(=CC(=C3C(=O)O2)O)O)O)O |
|
| SMILES = C1=CC(=C(C=C1C2=CC3=CC(=CC(=C3C(=O)O2)O)O)O)O |
|
|
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| ⚫ |
| InChI = |
|
|
|
| StdInChI = 1S/C15H10O6/c16-9-3-8-5-13(7-1-2-10(17)11(18)4-7)21-15(20)14(8)12(19)6-9/h1-6,16-19H |
|
|
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|
|
| StdInChIKey = NHFGEHLUROYMEB-UHFFFAOYSA-N |
|
| MeSHName = |
|
| MeSHName = |
|
}} |
|
}} |
|
|Section2= {{Chembox Properties |
|
|Section2={{Chembox Properties |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| Formula = C<sub>15</sub>H<sub>10</sub>O<sub>6</sub> |
|
| MolarMass = 286.23 g/mol |
|
| MolarMass = 286.23 g/mol |
|
| ExactMass = 286.047738 u |
|
|
| Appearance = |
|
| Appearance = |
|
| Density = |
|
| Density = |
|
| MeltingPt = <!-- °C --> |
|
| MeltingPt = |
|
| BoilingPt = <!-- °C --> |
|
| BoilingPt = |
|
| Solubility = |
|
| Solubility = |
|
}} |
|
}} |
|
| Section3 = {{Chembox Hazards |
|
|Section3={{Chembox Hazards |
|
| MainHazards = |
|
| MainHazards = |
|
| FlashPt = |
|
| FlashPt = |
|
| Autoignition = |
|
| AutoignitionPt = |
|
| RPhrases = <!-- {{R10}}, {{R23}}, {{R34}}, {{R50}} etc. --> |
|
|
| SPhrases = <!-- {{S1/2}}, {{S9}}, {{S16}}, {{S26}}, {{S36/37/39}}, {{S45}}, {{S61}} etc. --> |
|
|
}} |
|
}} |
|
}} |
|
}} |
|
'''Thunberginol B''' is an ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>Inhibitory effects of thunberginols A and B isolated from Hydrangeae Dulcis Folium on mRNA expression of cytokines and on activation of activator protein-1 in RBL-2H3 cells. Matsuda H, Wang Q, Matsuhira K, Nakamura S, Yuan D and Yoshikawa M, Phytomedicine. 2008 Mar;15(3), pp. 177-84. Epub 2007 Oct 22, {{PMID|17950587}}</ref> |
|
'''Thunberginol B''' is an ] found in ''Hydrangeae Dulcis Folium'', the processed leaves of ''] var. thunbergii''.<ref>{{Cite journal |
|
|
| last1 = Matsuda | first1 = H. |
|
|
| last2 = Wang | first2 = Q. |
|
|
| last3 = Matsuhira | first3 = K. |
|
|
| last4 = Nakamura | first4 = S. |
|
|
| last5 = Yuan | first5 = D. |
|
|
| last6 = Yoshikawa | first6 = M. |
|
|
| doi = 10.1016/j.phymed.2007.09.010 |
|
|
| title = Inhibitory Effects of Thunberginols A and B Isolated from ''Hydrangeae Dulcis Folium'' on mRNA Expression of Cytokines and on Activation of Activator Protein-1 in RBL-2H3 Cells |
|
|
| journal = Phytomedicine |
|
|
| volume = 15 |
|
|
| issue = 3 |
|
|
| pages = 177–184 |
|
|
| year = 2008 |
|
|
| pmid = 17950587 |
|
⚫ |
| pmc = |
|
|
| url = http://www.phytomedicinejournal.com/article/S0944-7113%2807%2900230-9/abstract |
|
|
}}</ref> |
|
|
|
|
|
==References== |
|
== References == |
|
{{reflist}} |
|
{{Reflist}} |
|
|
|
|
|
{{Isocoumarin}} |
|
{{Isocoumarin}} |
| Line 44: |
Line 67: |
|
] |
|
] |
|
|
|
|
|
|
|
|
{{Natural-phenol-stub}} |
|
|
|
{{aromatic-stub}} |